Tom has a job that pays £9.32 per hour. He worked for 40 hours last week . How much did he earns

Answers

Answer 1

Answer:

372.8

Step-by-step explanation:

Per hour = 9.32

Worked 40 hours

Total amount of money he earned last week = 40 x 9.32

= 372.8

Answer 2

Answer:

Tom has a job that pays £9.32 per hour. He worked for 40 hours last week . How much did he earns

9.32 x 40 = £372.80

Step-by-step explanation:

9.32 pounds times 40 hours


Related Questions

convert 72° into grades.

Answers

Answer:

80 grades is the answer.

Step-by-step explanation:

72° into grades

1° = 10/9 grades

72° = 10/9 × 72grades

= 720/9 grades

= 80 grades

Answer:

80 grades

Step-by-step explanation:

72° into grades  

=>1° = 10/9 grades

=>72° = 10/9 × 72 grades  

=>72° = 720/9 grades

=>72° = 80 grades

(2.75 x 107) + (1.23 x 108) simplify

Answers

Answer:

427.09

Step-by-step explanation:

(2.75 x 107) + (1.23 x 108)

294.25 + 132.84 = 427.09

The minimum mark to obtain a Grade A is 75. Cheryn managed to achieve an average of Grade A for three of her English quizzes. What is the minimum mark she scored in her first quiz if scored 76 and 89 marks in her second and third quiz, respectively?​

Answers

9514 1404 393

Answer:

  60

Step-by-step explanation:

Let m represent the mark Cheryn scored on her first quiz. Then her average is ...

  (m +76 +89)/3 ≥ 75

  m +165 ≥ 225 . . . . . . . . multiply by 3

  m ≥ 60 . . . . . . . . . . . . subtract 165

Cheryn scored a minimum of 60 marks on her first quiz.

Determine the perimeter of triangleABC with A(2;3) B(3;-2) and C (-2;-3).​

Answers

Answer:

Plot the coordinates on a graph and join them to form a triangle. After doing that, you can count the length of each triangular side and find the sum of the 3 sides. That will be your answer.

Can anyone help? It’s due in the morning

Answers

21) Angle 4

Angle 5

Angle GVH

Angle GVI

Angle HVI

22) Area of parallelogram = [tex]bh[/tex]

     A = 9 × 4 = [tex]36mi^2[/tex]

23) Area of a triangle = [tex]\frac{1}{2} bh[/tex]

     A =    [tex]\frac{1}{2} (12)(7.3)[/tex]

     A = [tex]43.8m^2[/tex]

24) Distance between each pair of point:

Distance between two points = [tex]\sqrt{(x_{B}-x_{A} )^2+(y_{B}-y_{A} )}[/tex]

Add the values in the formula & solve:

[tex]=\sqrt{(-2-0)^2+(2--4)^2}[/tex]

[tex]=\sqrt{(-2)^2+6^2}[/tex]

[tex]=\sqrt{4+36}[/tex]

[tex]=\sqrt{40}=6.3246[/tex]

25) Midpoint [tex](x_{M},y_{M} )=(\frac{x_{A} -x_{B} } {2} ,\frac{y_{A}+y_{B} }{2} )[/tex]

                                    [tex]=(\frac{10+0}{2},\frac{6+7}{2} )[/tex]

                                    [tex]=(\frac{10}{2} ,\frac{13}{2} )[/tex]

Midpoint of a line segment [tex](x_{M},y_{M} )=(5,6.5)[/tex]

I hope this helps....

Is 64 a rational number or irrational?

Answers

Answer:

Step-by-step explanation:

the answer is irrational hope this helps

Answer:

Rational.

Step-by-step explanation:

64 is a rational number because it's a whole number. Irrational numbers are real numbers including: [tex]\pi, \sqrt{2}[/tex], and etc. Basically, rational numbers are anything that can be expressed as the quotient of two integers: 64/1

PLS HELP ME ON THIS QUESTION I WILL MARK YOU AS BRAINLIEST IF YOU KNOW THE ANSWER PLS GIVE ME A STEP-BY-STEP EXPLANATION!!

Answers

Answer: c

Step-by-step explanation:

The correct answer is option C i.e. all of the options

Question : Why did I choose the answer as option C

Reason : To assure it we'll match all the options with the figure

First of all in the given figure all the sides and angles are equal hence, we can refer it as regular

Secondly, It is convex because all the parts are pointing outwards and inner ones are not more than 180°

Finally, As it has 8 sides it is an octagon

Now, we can see all the three options are matching leaving C which states all of these options, hence C is correct

Extras :

1) What is Octagon ?

ans :- Octagon is an 8 sided polygon

2) What is a regular polygon ?

ans :- Any polygon which has equal angles and sides is known as a regular polygon.

3) What is convex ?

ans :- A convex is a shape where all the parts points outwards and interior angles are not more than 180°

Can you please help me!!!!!​

Answers

This is the venn diagram. Try and make a new one.

I'm Timed
Which situation could this expression represent?
6 + 15 ÷ 3

Michael has 6 stamps in his collection. He adds 15 more stamps to the collection. He divides the collection into 3 piles. How many stamps are in each pile?

Walter has 6 stamps in his collection. He divides the stamps evenly into 3 piles and adds 15 new stamps to one of the piles. How many stamps are in this pile?

Andy has 15 stamps in his collection. He divides the stamps evenly into 3 piles and adds 6 stamps to one of the piles. How many stamps are in this pile?

Brycen has 15 stamps in his collection. He adds 6 more stamps to the collection. He divides the collection into 3 piles. How many stamps are in each pile?

Answers

It would be C. Because PEMDAS. Division goes first in this equation. So it’d be 15 divided by 3 plus 6

Answer:

It's Micheal because he started with 6 and added 15 and he divided them into 3 piles

answer to this problem?​

Answers

Answer:

The p is 4

Step-by-step explanation:

If I Have 100 Dollars And i go to the bank and i ask for 30 more and use that money on a store and i have 12 Dollars Left How Much Did the Thing I Bought Cost/ How Much Money did i spend?

Answers

Answer:

$118

Step-by-step explanation:

First, find how much money you had after going to the bank:

100 + 30

= $130

Find how much money you spent at the store by subtracting 12 from 130:

130 - 12

= 118

So, you spent $118

b) 2x (x - y) + 3y (x - y)​

Answers

Use distributive law

[tex]\boxed{\sf a(b+c)=ab+ac}[/tex]

Now

[tex]\\ \sf\longmapsto 2x(x-y)+3y(x-y)[/tex]

[tex]\\ \sf\longmapsto 2x^2-2xy+3xy-3y^2[/tex]

[tex]\\ \sf\longmapsto 2x^2-3y^2-2xy+3x^2[/tex]

[tex]\\ \sf\longmapsto 2x^2-3y^2+xy[/tex]

Taking common

Answer: 2x (x-y) + 3y (x-y)

             = ( x-y ) ( 2x-3y )

Erica recently invested in gold that is growing in value 4% annually. She invested $4000 initially. Find the value of her investment after 6 years.

Answers

Answer:

4%  = 0.04

4000 = 0.04

6 years = 0.04

Step-by-step explanation:

Hope this helps!

in a box of 80 glasses,3 are broken.workout percentage of broken glasses​

Answers

Answer:

3.75%

Step-by-step explanation:

The percent that are broken is the number broken over the total * 100%

3/80 * 100%

.0375 * 100%

3.75%

Answer:

3.75% of the glass are broken

Step-by-step explanation:

3/80 × 100 = 3.75

I hope this helps.

Please solve this problem ​

Answers

take the help of the attachments.

PLS HELP ME ON THIS QUESTION I WILL MARK YOU AS BRAINLIEST IF YOU KNOW THE ANSWER!! Determine the Value of K in the diagram ( secant lines to circles).

Answers

Answer:

k = 10

Step-by-step explanation:

According to intersecting secants theorem we have the following equation:

3x*(3x + 5x) = 2x*(2x + kx)

Solve it for k:

3x*8x = 4x² + 2kx²24x² = (4 + 2k)x²24 = 4 + 2k20 = 2kk = 10

help me please I need
[tex] {x}^{2} + 2x + 6 \\ {x}^{2} + 4x + 2[/tex]

Answers

Step-by-step explanation:

SEE THE IMAGE FOR SOLUTION..

hey, can i please get your intro? would you like to be my friend?

Myself Ojasvi

Class 8, 13

India

Denise buys a tote bag at a gift shop for $12. The same bag is available at Denise's pharmacy for 2/3 the price she paid at the gift shop. Let's say you have enough money to buy 10 bags from the gift shop. How many bags can you buy from the pharmacy with the same amount of money? A.3 B.12 C.15 D.18

Answers

Answer:

15

Step-by-step explanation:

The price of the bag at the pharmacy is

2/3 * 12 = 8 dollars

You have enough for 10 at the gift shop

10 * 12 = 120

Take 120 dollars and divide by 8 dollars to see how many you can get at the pharmacy

120/8 =15

Answer:

the answer is C. it was on my mid-term

Step-by-step explanation:

Given 4,7,10,13. Determine a rule to describe the general term, Tn.​

Answers

Answer:

[tex]T_{n}[/tex] = 3n + 1

Step-by-step explanation:

There is a common difference between consecutive terms, that is

7 - 4 = 10 - 7 = 13 - 10 = 3

This indicates the sequence is arithmetic with nth term

[tex]T_{n}[/tex] = a₁ + (n - 1)d

where a₁ is the first term and d the common difference

Here a₁ = 4 and d = 3 , then

[tex]T_{n}[/tex] = 4 + 3(n - 1) = 4 + 3n - 3 = 3n + 1

the area of a parallelogram is 48cm².if the two adjacent sides are 8cm and 6cm, find the length of its diagonal .​

Answers

Answer:

10cm

Step-by-step explanation:

Assuming the shape is a rectangle since it's already stated that it's a parallelogram, and the area is stated, we can use the Pythagorean theorem to find the length

[tex]a^{2} +b^2=c^2[/tex], where c will be the length

isolate c

[tex]c^2=a^2+b^2[/tex]

[tex]c=\sqrt{a^2+b^2}[/tex]

substitute for a and b

[tex]c=\sqrt{8^2+6^2}[/tex]

[tex]c=\sqrt{64+36}[/tex]

[tex]c=\sqrt{100}[/tex]

[tex]c=10[/tex]

which value of -7(x2-6)+2y when x=2 and y=6

Answers

Answer:

Solution

= -7 (x2 -6) +2y

= -7 ( 2*2 - 6 ) + 2 * 6

= -7 ( 4 - 6) + 12

= -7 - 2 + 12

= - 9 + 12

= 3

I hope this help u :)

TRIGONOMETRY
Could someone please help me with 5.2 please...it would really help alot:)​

Answers

sin(x+y) - sin(x-y) - 1 = cos(2x)

sin(90) - sin(x-y) - 1 = cos(2x)

1 - sin(x-(90-x)) - 1 = cos(2x)

-sin(2x-90) = cos(2x)

-1*(sin(2x)cos(90) - cos(2x)sin(90)) = cos(2x)

-1*(sin(2x)*0 - cos(2x)*1) = cos(2x)

-1*(0 - cos(2x)) = cos(2x)

-1*(-cos(2x)) = cos(2x)

cos(2x) = cos(2x)

This confirms the identity is true.

Notice that throughout this proof, I only changed the left hand side.

On the 5th line, I used the identity sin(A-B) = sin(A)cos(B)-cos(A)sin(B).

Match the vocabulary word to its correct definition.

1. mean
The mean is the average value of the data you collect. In statistics, you find the mean of your sample. Then you use that mean to approximate the mean of the entire population. If you want the mean of the data to be a good approximation of the mean of the entire population, your need to make sure that you collect a random sample. To find the mean, you find the sum of the data points you collected and divide it by the number of data points in the set. For example, if the data you collected was {3, 3, 6}. Then the mean would be (3 + 3 + 6) ÷ 3 = 12 ÷ 3 = 4. It's important to note that the mean does not have to be a data point in your set. You can generalize the formula as well. If you collect n data points {d1, d2, d3, … dn}, then the mean of your data set is . The Greek letter μ—pronounced "mu"—is used because the word "mean" begins with the letter "m." It is important that you divide by the number of data points in your set, n.
2. population
An experiment is a well-defined procedure under controlled conditions designed to gather data that tests a hypothesis. For example, you want to test the hypothesis that flowers grow faster when they are watered every other day as opposed to every day. Then you could water one set of plants every day and another set of plants every other day. What data would you collect? The height of each plant once a day. What conditions would you need to control? You would need to make sure that the groups of plants are treated the same in every other way by getting the same amount of sun and being maintained at the same temperature, etc.
3. experiment
Bias is the preference for a particular group or subset. In the example above, the bias was toward viewers who like sports. When your sample is not chosen at random, you introduce bias into your study. So, in a certain sense, a biased sample is the opposite of a random sample. Why? In a biased sample, some members of the population are more likely to be chosen than others. In a random sample, every member of the population is equally likely to be chosen. Bias may also occur in surveys. See "survey" below for more information on this type of bias.
4. sample
A population is the entire group you want to understand. So, in a certain sense, you can think of the population as the "opposite" of the sample because a sample is not the entire population. A sample is chosen subset upon that you use to draw conclusions about the entire population.
5. bias
Random means free from bias. So, if you choose a random sample from a population, every member of the population has an equal chance of being chosen. It should be pointed out that this "true randomness" is an ideal which is difficult to achieve in real world experiments conducted on real world populations. That is why statisticians make every effort to ensure their samples chosen as free from bias as is possible, that is, as randomly as possible under real world conditions.
6. survey
A sample is a subset chosen from a population. In most cases, you want a random sample. Why? A random sample has the best chance of accurately representing the entire population.
7. random
A survey is the means of collecting a sample. In statistics, a survey is often a question or set of questions. It is critical that the questions, like the sample itself, be free from bias. Bias in a question tends to favor one response. As an extreme example of a biased question about colors might be, "Don't you think blue is beautiful and yellow is yucky?" An unbiased form of the question might be, "Which color do you prefer, blue or yellow?" Though careful, statisticians might be concerned about the order in which the colors are offered, so that might further simplify the question to, "What is your favorite color?" This type of question is most free from bias because it does not suggest a response and therefore does not favor a response.

Answers

Answer:

1. mean-The mean is the average value of the data you collect. In statistics, you find the mean of your sample. Then you use that mean to approximate the mean of the entire population. If you want the mean of the data to be a good approximation of the mean of the entire population, your need to make sure that you collect a random sample. To find the mean, you find the sum of the data points you collected and divide it by the number of data points in the set. For example, if the data you collected was {3, 3, 6}. Then the mean would be (3 + 3 + 6) ÷ 3 = 12 ÷ 3 = 4. It's important to note that the mean does not have to be a data point in your set. You can generalize the formula as well. If you collect n data points {d1, d2, d3, … dn}, then the mean of your data set is . The Greek letter μ—pronounced "mu"—is used because the word "mean" begins with the letter "m." It is important that you divide by the number of data points in your set, n.

2. Population-A population is the entire group you want to understand. So, in a certain sense, you can think of the population as the "opposite" of the sample because a sample is not the entire population. A sample is chosen subset upon that you use to draw conclusions about the entire population.

3. Experiment-An experiment is a well-defined procedure under controlled conditions designed to gather data that tests a hypothesis. For example, you want to test the hypothesis that flowers grow faster when they are watered every other day as opposed to every day. Then you could water one set of plants every day and another set of plants every other day. What data would you collect? The height of each plant once a day. What conditions would you need to control? You would need to make sure that the groups of plants are treated the same in every other way by getting the same amount of sun and being maintained at the same temperature, etc.

4. Sample-A sample is a subset chosen from a population. In most cases, you want a random sample. Why? A random sample has the best chance of accurately representing the entire population.

5. Bais-Bias is the preference for a particular group or subset. In the example above, the bias was toward viewers who like sports. When your sample is not chosen at random, you introduce bias into your study. So, in a certain sense, a biased sample is the opposite of a random sample. Why? In a biased sample, some members of the population are more likely to be chosen than others. In a random sample, every member of the population is equally likely to be chosen. Bias may also occur in surveys. See "survey" below for more information on this type of bias.

6. Survey-A survey is the means of collecting a sample. In statistics, a survey is often a question or set of questions. It is critical that the questions, like the sample itself, be free from bias. Bias in a question tends to favor one response. As an extreme example of a biased question about colors might be, "Don't you think blue is beautiful and yellow is yucky?" An unbiased form of the question might be, "Which color do you prefer, blue or yellow?" Though careful, statisticians might be concerned about the order in which the colors are offered, so that might further simplify the question to, "What is your favorite color?" This type of question is most free from bias because it does not suggest a response and therefore does not favor a response.

7. Random-Random means free from bias. So, if you choose a random sample from a population, every member of the population has an equal chance of being chosen. It should be pointed out that this "true randomness" is an ideal which is difficult to achieve in real world experiments conducted on real world populations. That is why statisticians make every effort to ensure their samples chosen as free from bias as is possible, that is, as randomly as possible under real world conditions.

Step-by-step explanation:

It says what each of them are in each paragraph, you just need to match them up.

Hope this helps :)

Yet another calculus question :)


Given [tex]y = x^3 - 2x[/tex] for [tex]x \geq 0[/tex], find the equation of the tangent line to y where the absolute value of the slope is minimized.

I have tried taking both the first and second derivatives and setting them equal to 0 and using that as the answer, but they're incorrect. Could somebody please explain how to complete the question correctly? Thank you so much!

Answers

Answer:  y = (-4/3)*sqrt(2/3)

This is the same as writing [tex]y = -\frac{4}{3}\sqrt{\frac{2}{3}}[/tex]

============================================================

Explanation:

The phrasing "where the absolute value of the slope is minimized" is an interesting way of saying "the tangent slope is 0". This is because absolute values are never negative, so the smallest it can get is 0.

Your teacher has given you

y = x^3 - 2x

which differentiates into

dy/dx = 3x^2 - 2

after using the power rule

The derivative function lets us determine the slope of the tangent. The slope is the dy/dx value. Since we want a slope of 0, we'll set 3x^2-2 equal to zero and solve for x. So you have the correct idea, but you won't involve the second derivative.

dy/dx = 0

3x^2 - 2 = 0

3x^2 = 2

x^2 = 2/3

x = sqrt(2/3)

Notice how I'm ignoring the negative version of this root. This is due to the fact that [tex]x \ge 0[/tex]

-------------------------

Now plug this x value back into the original equation to find its corresponding y coordinate.

y = x^3 - 2x

y = x(x^2 - 2)

y = sqrt(2/3)*( 2/3 - 2 )

y = sqrt(2/3)*( -4/3 )

y = (-4/3)*sqrt(2/3)

Note that x = sqrt(2/3) leads to x^2 = 2/3 after squaring both sides.

-------------------------

Therefore, the equation of this tangent line is y = (-4/3)*sqrt(2/3)

All horizontal lines are of the form y = k, for some constant k. This constant value is basically what number you want the horizontal line to go through on the y axis. That number would be (-4/3)*sqrt(2/3).

Given: In Parallelogram ABCD,
• mA = (7y+13)º
• m2B = (106 - 2x)º
• mC = (10y - 32)º
• m2D = (3x – 4)º

What are the values of x and y

Answers

Answer:

x = 110

y = 15

Step-by-step explanation:

AB is parallel to CD

angle B and angle D are alternate and they are equal

106-2x = 3x-4

106 + 4 = 3x - 2x

110 = x

same goes for y

7y + 13 = 10y - 32

13 + 32 = 10y - 7y

45 = 3y divide both sides by 3

15 = y

I need help really bad does can I contact anyone for help I need to complete or I fail really bad.

Answers

Step-by-step explanation:

45 >= 4x + 5

40 >= 4x

10 >= x (x <= 10)

and

53 > 4x + 5

48 > 4x

12 > x (x < 12)

so, both conditions need to be true (that is the meaning of "and").

how can that be achieved ? well, the harder, narrower condition beats any other.

so, when x <= 10, then it is automatically also smaller than 12.

so, the solution (inequality notation) is

x <= 10

and the graph just shows a line that starts at 10 (with a full, black dot at 10, as the point is included) and goes all the way to the left (to infinity and beyond ...)

please help me solve this exercise.!!
find the value of tanx if sinx+cosx=1/5 and 0<x<π.

Answers

Answer:  -4/3

=============================================================

Explanation:

Let's square both sides and do a bit of algebra to get the following.

[tex]\sin(x) + \cos(x) = 1/5\\\\\left(\sin(x) + \cos(x)\right)^2 = \left(1/5\right)^2\\\\\sin^2(x) + 2\sin(x)\cos(x) + \cos^2(x) = 1/25\\\\\sin^2(x) + \cos^2(x) + 2\sin(x)\cos(x) = 1/25\\\\1 + 2\sin(x)\cos(x) = 1/25\\\\\sin(2x) = 1/25 - 1\\\\\sin(2x) = 1/25 - 25/25\\\\\sin(2x) = -24/25\\\\[/tex]

Now apply the pythagorean trig identity to determine cos(2x) based on this. You should find that cos(2x) = -7/25

This then means tan(2x) = sin(2x)/cos(2x) = 24/7.

From here, you'll use this trig identity

[tex]\tan(2x) = \frac{2\tan(x)}{1-\tan^2(x)}\\\\[/tex]

which is the same as solving

[tex]\tan(2x) = \frac{2w}{1-w^2}\\\\[/tex]

where w = tan(x)

Plug in tan(2x) = 24/7 and solve for w to get w = -4/3 or w = 3/4

So either tan(x) = -4/3 or tan(x) = 3/4.

If we were to numerically solve the original equation for x, then we'd get roughly x = 2.21; then notice how tan(2.21) = -1.345 approximately when your calculator is in radian mode.

Since tan(x) < 0 in this case, we go for tan(x) = -4/3

Right now Jack’s age is greater than twice Fred’s age by 4. After 8 years, the sum of their ages is 59. Find Fred’s age.

Answers

Fred's age is 13 years

Let

Fred's age = x

Jack's age = 2x + 4

After 8 years:

Fred's age = x + 8Jack's age = 2x + 4 + 8

= 2x + 12

Sum of their ages = 59

Sum of their ages = Fred's age + Jack's age

59 = (x + 8) + (2x + 12)

59 = x + 8 + 2x + 12

59 = 3x + 20

59 - 20 = 3x

39 = 3x

x = 39/3

x = 13 years

Therefore, Fred's age = 13 years

https://brainly.com/question/24371832

Determine if the expression -5y^5-y^3 is a polynomial or not. If it is a polynomial, state the type and degree of the polynomial.

Answers

Answer:

Yes, it is a polynomial, and the degree is 5

Step-by-step explanation:

A polynomial is a combination of terms separated using + or − signs and normally have exponents. So, this equation is a polynomial. The degree is just the highest exponential value, which is 5 because -5y is being raised to the 5th power

Shaded areas ( What is the area of the shaded region? )

Answers

Answer:

119.43 cm²

Step-by-step explanation:

The shaded area (A) is calculated as

A = area of rectangle - area of circle

   = (11 × 12) - π × 2²

  = 132 - 4π

  ≈ 119.43 cm² ( to the nearest hundredth )

Other Questions
2(3+4)(73)(2 2) 1. Draw the condensed structural formula of sodium benzoate showing all charges, atoms including any lone pairs in the side chain functional group, and all sigma and pi bonds.2. Draw the condensed structural formula of benzoic acid showing all atoms including any lone pairs in the side chain functional group, and all sigma and pi bonds. Indicate the acidic hydrogen.3. Draw the condensed structural formula of tetrahydrofuran (THF) showing all heteroatoms plus their lone pairs and all sigma and pi bonds. PLEASE HEL URGENT 25 POINTS!!!Write 0.0000012 in scientific notation which of the following represents x= 1/2 y written in general form? Write a letter to your father's friend concerning the nature of education in Ghana Five more than twice a number is three. Write that in equation All of these are very important parts of studying physics EXCEPT1. describing the organization of the universe2. understanding natural laws3. memorizing complicated explanations4. deducing and applying natural laws In the context of the poem, what does the word blithe most likely mean? 5. What change would increase the amount of gas able to be dissolved in a given amount of liquid water? (2 points)Increasing temperatureaIncreasing pressureIncreasing surface areaOIncreasing rate of stirring 60830Determine the value of x. a number is divisible by 10 if it has ____ in ones place . s bit ca pic 16f887 I need help ASAP!!Please explain how you got the answer sodium bisulfite is an ionic compound that is used as a mild bleaching agent and a food preservative. It contains the bisulfate ion, an amphiprotic ion with the chemical formula HSO-. a. Write the chemical equation for the reaction of HSO- with OH-. Is the bisulfite ion functioning as an acid or a base in this reaction?b. Write the chemical equation for the reaction of HSO- with HO+. Is the bisulfite ion functioning as an acid or a base in this reaction? For what value of x is the parallelogram a rhombus. For the past two weeks, Manuel has been studying for an upcoming psychology exam. Even though he read the textbook carefully every day while studying, during the exam, he could not recall the material regarding how psychologists studied the mental processes of memory. Manuel most likely experienced a problem in the ________ process of memory. 11. The student government is selling flowers for homecoming. The project costs them $20 for advertising and$3 for each flower sold.a. Evaluate the expressions 3n+20 and 3(n+20) when n = 4.b. Which expression shows their total cost? How do you know? x+y+6x+8y+24=0 asap reply plss.. Sana umabon ng 1 makasagot What is 3 times 10^9 Use the present tense form of the verb in parentheses that agrees in numberwith the subject.1. This hockey game becaone of the most exciting games I've ever seen. (be)2. She has a big project to complete for science class tonight. (have)3. Today, the players been all prepared to defeat the league champions. (be)4. My friendto see the newest movies in theaters. (go)5. My familyto go to the park on Sunday. (like)6. The host uw to make sure the guest feel welcomed. (need)7. Kanased talented basketball players. (have)8. Fifteen dollarsthe cost of the movie ticket. (are)9. The motherto be upset with her child. (appear)10. Kim hasa lot of good friends. (have)