9514 1404 393
Answer:
6
Step-by-step explanation:
The compound interest formula tells you the future value of principal P invested at annual rate r compounded n times per year for t years is ...
A = P(1 +r/n)^(nt)
Solving for t, we get ...
t = log(A/P)/(n·log(1 +r/n))
Using the given values, we find t to be ...
t = log(38302/32000)/(12·log(1 +0.03/12)) ≈ 5.9997
The investment was for 6 years.
What is the base and height of parallelogram S?
Find the fractal dimension of the object.
Answer:
maaqqqf aku ngak tau soal jawaban in
Find the midpoint of the line segment joining (–4, –2) and (2,8)
Show all work
Answer:
Mid- point =(-4+2/2, -2+8/2)
=(-2/2,6/2)
=(-1,3)
The mid point of the line segment joining (–4, –2) and (2,8) is (-1, 3)
Mid point formulamid point = (x₁ + x₂ / 2, y₁ + y₂ / 2)
Therefore,
(-4, -2)(2, 8)
x₁= -4
x₂ = 2
y₁ = -2
y₂ = 8
Hence,
mid point = (-4 + 2 / 2, -2 + 8 / 2)
mid point = (-2 / 2, 6 / 2)
mid point = (-1, 3)
learn more on mid point here: https://brainly.com/question/1501820
The sum of 'n' terms of an arithmetic sequence is 4n^2+3n. What is the first term, the common difference, and the sequence?
Answer:
The sequence has first term 7 and common difference is 8.
So the sequence is f(n)=7 + 8(n-1)
Step-by-step explanation:
Let a be the first term.
Let a+d be the second term where d is the common difference.
Then a+2d is the third....
And a+(n-1)d is the nth term.
Adding these terms we get:
an+(n-1)(n)/2×d
For the first term of this sum I seen we had n amount of a's and for the second term I used the well known identity sum of the first n positive integers is n(n+1)/2.
Let's simplify:
an+(n-1)(n)/2×d
Distribute:
an+(n^2d/2)-(nd/2)
Find common denominator:
(2an/2)+(n^2d/2)-(nd/2)
Combine terms into one:
(2an+n^2d-nd)/2
Reorder terms:
(n^2d+2an-nd)/2
Regroup terms:
(n^2d+(2a-d)n)/2
We want the following sum though:
4n^2+3n
This means d/2=4 (so d=8) and (2a-d)/2=3.
So plug d=8 into second equation to solve for a.
(2a-8)/2=3
2a-8=6
2a=14
a=7
The sequence has first term 7 and common difference is 8.
So the sequence is f(n)=7 + 8(n-1).
square root 12 is ___ greater than square root 7
Answer:0.8
Step-by-step explanation:
Multiple Choice
Which statement is an example of the Identity Property of Multiplication?
A. 8.0 = 0
B. 8. 1 = 8
C. 8.-1 = -8
D. -8.-1 = 8
Answer:
I think that the answer is - 8.-1=8
Curtis purchased a bicycle on credit. When he received his credit card statement, he noticed several charges he did not make. What should he do?
Answer: He should call the card card company and discuss the charges and make it known that he did not make those charges. He should address each charge by the amount shown. Once he has finished, the credit card company will call the company that sent in the request for payment and inform the company there are questions about the charges and request that the charges be removed.
.
Step-by-step explanation:
Lament has a jar containing 6 red chips, 10 blue chips, and 4 yellow chips. If he removes one chip at random, what is the probability that it will not be red?
The probability of not getting red is 7/10
What is probability?The area of mathematics known as probability deals with numerical representations of the likelihood that an event will occur or that a statement is true. An event's probability is a number between 0 and 1, where, roughly speaking, 0 denotes the event's impossibility and 1 denotes certainty.
Given
Your bowl has 20 chips. (4+10+6).
6 of them are red. 6/20 = 3/10
so the odds of getting a red chip are 3/10 ,
meaning the odds against getting red are 1-(3/10) = 7/10
To learn more about probability refer to:
https://brainly.com/question/13604758
#SPJ2
what is the HCF of 216
Answer:
The answer for this question is 1
At any given time about 5.5% of women (age 15-45) are pregnant. A home pregnancy test is accurate 99% of the time if the woman taking the test is actually pregnant and 99.5% accurate if the woman is not pregnant. If the test yields a positive result, what is the posterior probability of the hypothesis that the woman is pregnant?
Answer:
0.99%
Step-by-step explanation:
Value of [(3/2)^(-2)] is *
Answer:
[tex] { (\frac{3}{2} )}^{ - 2} \\ = { (\frac{2}{3}) }^{2} \\ = \frac{4}{9} \\ thank \: you[/tex]
Rachael needs to rent a car while on vacation. The rental company charges $17.95, plus 19 cents for each
mile driven. If Rachael only has $40 to spend on the car rental, what is the maximum number of miles she
can drive?
Answer:
116 miles
Step-by-step explanation:
We can solve this by first writing an equation for the cost of the car rental. To begin, the base cost is $17.95, so any further costs must be added to that. Next, the car costs 19 cents (0.19 dollars) for each mile driven, so for each mile, we add 19 cents. This can be written as 0.19 *x if x represents the amount of miles driven. Therefore, we can add the two input costs of the car (the base cost and cost per mile) to get
17.95 + 0.19 * x = total cost.
After that, we want to maximize x/the number of miles with only 40 dollars. We can do this by setting this equal to the total cost, as going over the total cost is impossible and going under would be limiting the amount of miles (this because we are adding money for each mile, so more money means more miles). Therefore, we have
17.95 + 0.19 * x = 40
subtract 17.95 from both sides to isolate the x and its coefficient
22.05 = 0.19 * x
divide both sides by 0.19 to isolate x
22.05/0.19 = x = 116.05
The question asked us to round down, and 116.05 rounded down is 116 for our answer
prove that 2^n+1>(n+2).sin(n)
Step-by-step explanation:
F(n)=|sin(n)|+|sin(n+1)|
then
F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)
and
F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)
so we must prove when n∈(0,π), have
F(n)>2sin12
when n∈(0,π−1),then
F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn
and n∈(π−1,π),then
F(n)=sinn−sin(n+1)
How prove it this two case have F(n)>2sin12? Thank you
and I know this well know inequality
|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R
The highest mountain in earth is 29,028 ft. The lowest under sea trench is -35,840ft. Which has the highest absolute value
Answer:
undersea trench
Step-by-step explanation:
Absolute value is the distance from zero
The highest mountain trench is |29028| or 29028 ft from zero
The lowest under sea trench is | -35840| of 35840 ft from zero
The highest absolute value is the undersea trench
Height always be positive .
Highest mountain in earth=29028ftAbsolute value:-
[tex]\\ \sf\longmapsto |29028|=29028ft[/tex]
Lowest undersea trench=-35840ftAbsolute value:-
[tex]\\ \sf\longmapsto |-35840|=35840ft[/tex]
raise the difference of q and 5 to the 3rd power
write as an expression
Answer:
(q-5)³
Step-by-step explanation:
the difference of q and 5 is written as q - 5
Then you add an exponent with the digit 3
(q-5)³
If my answer is incorrect, pls correct me!
If you like my answer and explanation, mark me as brainliest!
-Chetan K
8. If 30 cents out of every 1 dollar goes to taxes and the rest is net income, what's the
ratio of taxes to net income?
d
A. 30 : 7
B. 3:10
C. 30 : 1
D. 3:7
Answer:
D. 3:7Step-by-step explanation:
1 dollar = 30 cents tax + 70 cents net income
The ratio of taxes to net income:
30 : 70 = 3 : 7Correct choice is D
If 30cents are out then net income=100-30=70
ratio:-
[tex]\\ \rm\Rrightarrow \dfrac{30}{70}[/tex]
[tex]\\ \rm\Rrightarrow \dfrac{3}{7}[/tex]
[tex]\\ \rm\Rrightarrow 3:7[/tex]
Find the slope of the line passing through the points (9, 1) and (9,-4).
Answer:
slope is undefined
Step-by-step explanation:
(9, 1 ) and (9, - 4 )
Since the x- coordinates of the 2 points are 9, then the line is vertical and parallel to the y- axis with slope being undefined.
Slope is the change in y over the change in x.
Slope = (-4 - 1) / (9 -9) = -5/0 you cannot divide by 0,so the slope is undefined. This means it is a vertical line
3. a) Why is X3 is a polynomial but
[tex] \frac{7}{x {}^{2} } [/tex]
, is not a polynomial? write in your words.
Answer:
because the power of variable is -2
Step-by-step explanation:
polynomials are a combination of constant and variable or only variable, being that power of variable is always positive natural no.
7/x^2 denotes 7x^-2
A number is multiplied by 8, and that product is added to 2. The sum is equal to the product of 2 and 25. Find the number.
Answer: the number = 6
Step-by-step explanation:
Let x be the number.
Set equation according to the information given
2 + 8x = 2 × 25
Simplify by multiplication
2 + 8x = 50
Subtract 2 on both sides
2 + 8x - 2 = 50 - 2
8x = 48
Divide 8 on both sides
8x / 8 = 48 / 8
[tex]\boxed {x=6}[/tex]
Hope this helps!! :)
Please let me know if you have any questions
1) (1) The selling price (ii) The cost price (iii) Profit The marked price of an article is 15% above its selling price and the cost price is 25% less tha its marked price. Find the discount percent and gain percent.
Answer: (iii) Profit The marked price of an article is 15% above its selling price and the cost price is 25% less tha its marked price. Find the discount percent and gain percent.
Step-by-step explanation:
Kirk is ordering a cheeseburger for lunch. There are 9 cheeses and 7 buns to choose from. For the sauce, Kirk has 4 options. How many different hamburgers can Kirk order if he makes exactly one selection for each option?
Answer:
252 options
Step-by-step explanation:
Please let me know if you want an explanation for why this is the answer (comment on this answer). A lot of people don't actually read the explanations, so I wouldn't want to waste my time. However, if you would like it I would be more than happy to type one out for you. Thanks!
A whitetail deer can sprint at speeds up to 30 miles per hour. American bison can run at speeds up to 3,520 feet per minute. Which animal is faster and by how many miles per hour? There are 5,280 feet in one mile.
Answer:
The Bison is faster by 10 miles per hour.
Step-by-step explanation:
The Bison runs at 3520 ft / min
= 3520/ 5280 miles / minute
= (3520/ 5280) * 60 miles per hour
= 40 miles per hour
Harrison has 20 tasks on to do list he has completed 5%. How many tasks has he completed?
Answer:
1 task
Step-by-step explanation:
100%=20 tasks
5%=1 task
Your student is struggling with basic addition skills. you can help them by
Answer:
1) focus in the positive
2)keep thing in perspective
3) ask students where there fear is coming
4)help students create a study schedule
5) priotize classroom preparation efforts.
14 cm 8 cm 10cm 5 cm.
find the area and the perimeter of the above figures
Perimeter = Sum of all sides
Perimeter = 14cm + 8cm + 10cm + 5cm
Perimeter = 22cm + 15cm
Perimeter = 37cm
Step-by-step explanation:
hope it helps you
...
........
Julie wanted to find out the approximate percentage of non-traditional female college students at public universities. She decided to randomly select 25 females from each university in her state and collect and analyze the data.
Select the statement that is TRUE.
The 25 females that Julie interviews are the sample, and the females that Julie does not interview are the population.
The 25 females that Julie interviews are the sample, and all female college students at state universities are the population.
All female college students at state universities are the sample, and the 25 females that Julie interviews are the population.
The female college students at state universities are the sample, and the female college students at all universities in the United States are the population.
To solve this question, we need to understand sample and population concepts.
From this, the answer is:
The 25 females that Julie interviews are the sample, and all female college students at state universities are the population.
Example:
I want to estimate the proportion of New York state residents who are Buffalo Bills fans. So i ask, lets say, 1000 randomly selected New York state residents whether they are Buffalo Bills fans, and expand this to the entire population of New York State residents, which is the population of the study.
The sample will be: 1000 randomly selected New York state residents
The population will be: All New York state residents
In this question:
Sample: 25 females from each university in her state.
Population: All female college students in her student.
Thus, the correct statement is:
The 25 females that Julie interviews are the sample, and all female college students at state universities are the population.
For a similar example, you can check https://brainly.com/question/24331410
A homeowner needs two loads of gravel for the driveway to their new house. One loads weighs 8 tons and the second load
weighs 1,200 pounds. What is the total weight of the gravel, in tons, used for the driveway?
Total weight of the gravel, in tons used for the driveway is 8.6 tons
Weight of first load = 8 tons
Weight of second load = 1200 pounds
Convert pounds to tons:
1 pound = 0.0005 ton
1200 pounds = 0.6 ton
Then,
Weight of second load = 0.6 ton
Total weight of the gravel, in tons = Weight of first load + Weight of second load
= 8 tons + 0.6 tons
= 8.6 tons
https://brainly.com/question/24370065
PLEASE gelp me with this, gelp me please oh please gelp me!
Answer:
V = 2143.57 cm^3
Step-by-step explanation:
The volume of a sphere is
V = 4/3 pi r^3
The diameter is 16 so the radius is 1/2 of the diameter or 8
V = 4/3 ( 3.14) (8)^3
V =2143.57333
Rounding to the nearest hundredth
V = 2143.57 cm^3
Answer:
2143.57 cm^3
Step-by-step explanation:
V = 4/3 * 3.14 * r^3
r = 1/2 * 16 = 8
So V = 4/3 * 3.14 * 8^3
= 2143.57 cm^3.
The sum of a number x and
eleven
Answer:
what is the sum.
Step-by-step explanation:
Take the sum - 11 =x
Reduce 20/60 to its lowest common denominator
Answer:
it is 1/4
Step-by-step explanation:
20/60=10/30=1/3
Answer:
20/60=1/3
Step-by-step explanation:
20/60
HCF=20,
20*1=20, 20*3=60
1/3
or,
Remove the zeros,
2/6
Divide by 2 on both,
1/3
or divide by any common factor on both and keep dividing until u cant no more
20/60=1/3
