Find f(-2) for f(x) = 2(4)^x

Answers

Answer 1

Answer:

2(4)^-2

=2/4^2

2/16

1/8

thanks

Answer 2

Answer:

f(- 2) = [tex]\frac{1}{8}[/tex]

Step-by-step explanation:

To find f(- 2) substitute x = - 2 into f(x) , that is

f(- 2) = 2 [tex](4)^{-2}[/tex] = 2 × [tex]\frac{1}{4^2}[/tex] = 2 × [tex]\frac{1}{16}[/tex] = [tex]\frac{2}{16}[/tex] = [tex]\frac{1}{8}[/tex]


Related Questions

Solve: XXV - IV Show your answer in standard form.​

Answers

Step-by-step explanation:

the answer is xxl in roman number or 21

Step-by-step explanation:

SEE THE IMAGE FOR SOLUTION

HOPE IT HELPS

HAVE A GREAT DAY

10.

Define an operation ★ on the set of real numbers as follows:


a ★ b = 0.5ab

If 0.1 ★ b = 10, then evaluate bb.


a. 500


b. 200


c. 20


d. 50

Please explain how you got your answer.

Answers

If ab = 0.5ab, then

0.1 ★ b = 0.5 (0.1) b = 0.05b = 10

==>   b = 10/0.05 = 200

what is the HCF of 7 and 13​

Answers

Answer:

The HCF of 7 and 13 is 1

Step-by-step explanation:

Prime numbers only have one factor which is 1 and itself
•••••••••••••••••••••••••••••••
doomdabomb: All brainliest
and thanks are appreciated
and would mean a lot to me,
thanks!

The temperature in Miami, Florida Is 22 degrees warmer than three times the temperature in Bangor, Maine. The temperature in Miami is 82 degrees. Write an equation to determine the temperature in Bangor.
3x + 82 = 22
3x + 22 = 82
3x - 22 = 82
3x - 82 = 22

Answers

Answer:

the answer is c I believe

Solve for x in the triangle. Round your answer to the nearest tenth.

Answers

Answer:

x = 6.2

Step-by-step explanation:

Since this is a right triangle, we can use trig functions

tan theta = opp / adj

tan 32 = x/ 10

10 tan 32 = x

x=6.24869

Rounding to the nearest tenth

x = 6.2

Answer:

x=6.2 (Rounded to the nearest tenth)

Step-by-step explanation:

This problem gives you an angle(32°), and ask for the dimension of the opposite side to that angle(x), along with another dimension the adjacent side(10).

Since you have the opposite and adjacent sides, you can use tangent. opposite (x) over adjacent (10). Tan(32) =[tex]\frac{x}{10}[/tex]. You want (x) so multiply tan(32) by 10. Then round to the nearest tenth.

Remember to put calculator in degree mode!

tan (32) = 0.6248693519 multiply by ten 6.248693519. Round to nearest 10th 6.2.

Hope this helps!

The manufacturer ID number for Bayer Healthcare is (325866) and the item number for a bottle of Aleve Liquid Gels is (53590). What is the valid UPC? *)
A) 3-25866-53590-5
B) 3-25866-53590-0
C) 1-25866-53590-0
D) 5-35900-32586-6​

Answers

The manufacturer ID number for Bayer Healthcare is (325866) and the item number for a bottle of Aleve Liquid Gels is (53590). then valid UPC would be option B) 3-25866-53590-0 by checking the check digit.

It is known that a UPC is made up of 6 to 9 digits from the left that is the manufacturer id number and 5 digits from the right before the last digit is the product id number.

the last digit is used to check the integrity of the UPC and is known as a check digit.A specific algorithm based on the odd and even number of the previous 11 digits determines the last number, which is used to confirm the validity or integrity of the UPC.

A UPC can be validated with a manual calculation:

Given :

UPC = 3-25866-53590-5/0

=> Step 1: Add the digits at odd positions.

3 + 5 + 6 +5 + 5 + 0 = 24

=> Step 2: Multiply the number obtained in steps 1 by 3.

24*3 = 72

=> Step 3: The digits at even positions have to be added except check digit

2 + 8 + 6 +3 +9 = 28

=> Step 4: Add the numbers obtained in Step 2 and step 3.

72+ 28 = 100

=> Step 5: The number obtained in step 4 is subtracted from the next multiple of 10.

Here 100 will be subtracted from 110.

110 - 100 = 10

the last digit will be 0,

Thus, the correct option is B. 3-25866-53590-0.

Learn more about:

https://brainly.com/question/12538564

solve for x.
a. 2
b. 5
c. 0
d. 7

Answers

Answer:

x=0

Step-by-step explanation:

Tangent Chord Angle = 1/2 Intercepted Arc

A circle is 360 degrees

The missing arc is

360 - (2x+260)

360 -2x-260

100 -2x

Using the formula

50 = 1/2(100-2x)

50  = 50 -x

Subtract 50 from each side

0 = -x

x=0

if something goes 4% per min how long will it tack to reach 100%

Answers

Answer:

It will take 25 minutes

Step-by-step explanation:

4% every minute for 25 mins is 4x25=100

38) Paula is making a pair of drapes for her dining room. Each of the four drapery panels, when completed, measures 8 feetlang by 4 feet wide. What is the total area of the four drapery panels?




pls help if I see a off topic answer or a silly joke I will report and make sure u get in trouble so do not joke around.​

Answers

Answer:

128 ft^2

Step-by-step explanation:

each drapery has an area of 8*4 feet^2 and there are four panes so the total area is 8*4*4= 128

please helpp!!!!!!!!​

Answers

Step-by-step explanation:

the answer is in picture

Any help is very much appreciated!! (:

Answers

Answer:

the third option

Step-by-step explanation:

the 5 pounds weight at birth is the starting value.

so, the function needs to have a constant part of at least +5.

and every month 0.5 pounds are added.

that is exactly the situating to use multiplication : weight gain per month times the number of months (plus the starting value of 5 pounds) delivers the weight after a certain number of months.

w = weight after t months

t = number of months measured

Write the equation of the line that passes through the points (3, -7) and (-6, -13)

Answers

Answer:

-18 y + 91 y = 73 y

(3, -7) y (-6, -13)  

{-18 y, 91 y}

Angela has a rectangular piece of paper and cuts a rectangle out of a corner what are the area and perimeter of the resulting shape help me find the perimeter only

Answers

The perimeter of a shape is the summation of the visible lengths of the shape. The area; however, is the product of the length and the width of the shape

The perimeter of the figure is 74cm and the area of the figure is 231 square cm

I've added shape as an attachment.

The perimeter is the sum of all side lengths. So, we have:

[tex]Perimeter = 6cm + 7cm + 15cm + 9cm + 21cm + 16cm[/tex]

[tex]Perimeter = 74cm[/tex]

To calculate the area, we split the shape into 2.

The first has the following dimension:

[tex]Length = 6cm[/tex]

[tex]Width = 7cm[/tex]

While the second has the following dimension

[tex]Length = 21cm[/tex]

[tex]Width = 9cm[/tex]

The area of the shape is:

[tex]Area = 6cm \times 7cm + 21cm\times 9cm[/tex]

[tex]Area = 231cm^2[/tex]

Hence, the shape has a perimeter of 74cm and an area of 231 square cm

Read more about area and perimeters at:

https://brainly.com/question/11957651

A 10 oz bottle of shampoo cost $2.40 and a 12oz bottle cost $2.64 find the unit rate for each which bottle has the lower unit cost

Answers

Answer:

12oz bottle

Step-by-step explanation:

10 oz bottle

Take the price and divide by the ounces

2.40 /10 = .24 per ounce

12oz bottle

2.64 / 12 =.22 per ounce

A retailer bought 1000 glass tumblers at rs 80 each.50 glass tumblers were broken and he sold the rest at Rs 96 each .find his profit or loss percent​

Answers

Step-by-step explanation:

Soln

Given

Cp of 1 glass tumbler=80.1000

=Rs 80000

Number of broken glass tumbler=50

Number of remaining glass tumbler=1000-50

=950

Sp of one glass tumbler=96

Sp of 950 glass tumbler=96.950

=91200

Now

Sp > Cp so it is profit

Profit%=sp-cp/cp.100

=91200-80000/80000.100

=11200/80000.100

=14%

Answer:

14%profit

Step-by-step explanation:

Cost of 1000 tumblers=1000×80=80,000

50 of them were broken: 1000-50=950

: He sells 950 tumblers of rs.96 each= ( 950×96)

S.P=91200

We can clearly see he gains for rs.11200.

P%=gain/C.P×100

11200×80000×100

=14%

Which two of the objects shown below could we slice diagonal to their bases/faces to create ellipse cross-sections (that aren't circles)?
Choose 2 answers:
Choose 2 answers:

(Choice A)
A
Cone

(Choice B)
B
Cube

(Choice C)
C
Cylinder

(Choice D)
D
Sphere

Answers

Answer:

C

Step-by-step explanation:

The cylinder would show an ellipse when cut diagonally. Please Brainliest PLSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSSS.

The answer is choice A

Find the product.
1.(a + 3)(a - 4)
2. (x - 3)2
3. (2a – 62)(a + 462)
4.(x - 5)(x2 + 4x - 6)

Answers

Answer:

1. a²-a-12

2. 2x-6

3. 2a²+862a-28644

4. x³-x²-26x+30

Step-by-step explanation:

1. (a + 3)(a - 4) = a²-4a+3a-12 = a²-a-12

2. (x - 3)2 = 2x-6

3. (2a – 62)(a + 462) =2a²+924a-62a-28644 = 2a²+862a-28644

4.(x - 5)(x²+ 4x - 6) = x³+4x²-6x-5x²-20x+30 = x³-x²-26x+30

In the opposite figuret triangle OAB has an area of 72 cm2 and. Triangle ODC has an area of 288 Cm2 Then XandY equal​

Answers

area of OAB = 72 = (1/2) sin (AOB) * OA * OB solve the above for sin(AOB) to find sin(AOB) = 1/2 area of ODC = 288 = (1/2) sin (DOC) * OD * OD Note that sin(DOC) = sin(AOB) = 1/2, OD = 18 + y and OC = 16 + x and substitute in the above to obtain the first equation in x and y 1152 = (18 + y)(16 + x)...

HOPE SO IT HELPS YOU

You can
Figure A to map it onto Figure Din a single transformation."

1.answers
2.rotate
3.reflect
4.translate
5.dilate

Answers

Answer: a

Step-by-step explanation:

Given angle EFG has angle bisector FH, where EF = GF, find the value of y if EH = 5y + 10 and HG = 28 - y.

Answers

Answer:

y = 3

Step-by-step explanation:

*As seen in the photo, the fact that EF = GF and the bisector being there makes EH = HG.

5y + 10 = 28 - y

*Add y to both sides.

6y + 10 = 28

*Subtract 10 from both sides.

6y = 18

*Divide both sides by 6.

y = 3

In triangle EFG, with angle bisector FH and equal lengths for EF and GF, the value of y is 3.

Use the concept of a triangle defined as:

A triangle is a 3-sided polygon, which has three vertices and three angles which has a sum of 180 degrees.

Given that,

Angle EFG has an angle bisector FH.

EF = GF (the lengths of the corresponding sides of triangle EFG are equal).

EH = 5y + 10 (length of segment EH).

HG = 28 - y (length of segment HG).

To find the value of y,

Start by applying the angle bisector theorem in triangle EFG.

According to the theorem,

The ratio of the lengths of the segments formed by the angle bisector to the corresponding sides should be equal.

Since EF = GF,

Set up the following equation:

EH / HG = EF / FG

Substituting the given values, we have:

[tex]\dfrac{(5y + 10)}{ (28 - y)} = \dfrac{1} { 1}[/tex]

Cross-multiplying, we get:

5y + 10 = 28 - y

Combining like terms, we have:

6y = 18

Dividing both sides by 6, we find:

y = 3

Therefore, the value of y is 3.

To learn more about the triangle visit;

brainly.com/question/1058720

#SPJ3

Solve : p, q, s, t, w​

Answers

P:-

[tex]\\ \sf\longmapsto (x+y)^2-4x^2y^2[/tex]

[tex]\\ \sf\longmapsto x^2+2xy+y^2-4x^2y^2[/tex]

[tex]\\ \sf\longmapsto x^2+y^2-4x^2y^2+2xy[/tex]

Q:-

[tex]\\ \sf\longmapsto x^2-2(x+y)-y^2[/tex]

[tex]\\ \sf\longmapsto x^2-2x-2y-y^2[/tex]

[tex]\\ \sf\longmapsto x^2-y^2-2x-2y[/tex]

S:-

[tex]\\ \sf\longmapsto x^2-4x-21+10y-y^2[/tex]

[tex]\\ \sf\longmapsto x^2-y^2-4x+10y-21[/tex]

T:-

[tex]\\ \sf\longmapsto a^2-10a+24+6b-9b^2[/tex]

[tex]\\ \sf\longmapsto a^2-9b^2-10a+6b+24[/tex]

The expression 13.25×5+6.5 gives the total cost in dollars of renting a bicycle and helmet for 5 days. The fee for the helmet does not depend upon the number of days.

Answers

Answer:

13.25×5+13, cost per day with a helmet.

Step-by-step explanation:

Numerical Expressions • Practice

Answer:

13.25×5+13, Per day without a helmet

Step-by-step explanation:

A bag contains 42 red, 45 green, 20
yellow, and 32 purple candies. You
pick one candy at random. Find the
probability that it is green or yellow.

Answers

Answer:

 =65/139

Step-by-step explanation:

42 red, 45 green, 20yellow, and 32 purple candies = 139 candies

P( green or yellow) = green or yellow / total

                                =(45+20) / 139

                                  =65/139

Slope -1/4, passes through (12,-4)​

Answers

Answer:

y = - [tex]\frac{1}{4}[/tex] x - 1

Step-by-step explanation:

Assuming you require the equation of the line

The equation of a line in slope- intercept form is

y = mx + c ( m is the slope and c the y- intercept )

Here m = - [tex]\frac{1}{4}[/tex] , then

y = - [tex]\frac{1}{4}[/tex] x + c ← is the partial equation

To find c substitute (12, - 4) into the partial equation

- 4 = - 3 + c ⇒ c = - 4 + 3 = - 1

y = - [tex]\frac{1}{4}[/tex] x - 1 ← equation of line

5(^ 1/5 +-4) 2(-4)(-0.8)^ 2

Answers

Answer:

Step-by-step explanation:

[tex]\displaystyle\ \Large \boldsymbol{} \frac{5(\frac{1}{5}+(-4) )}{2\cdot(-4) \cdot (0-0,8)^2} =\frac{^1 \ 5^{ }\!\!\!\!\diagup\cdot \frac{1}{5\!\!\!\!\diagup}-20 }{-8 \cdot 0,64 } = \\\\\\ \frac{-20+1}{-5,12} =\frac{-19}{-5,12} \cdot \frac{25}{25} =\frac{475}{128} =\boxed{\pmb{3\frac{91}{128} }}[/tex]

if x=-1 , y=1 and z =2 then find the value of. a . 2x+3y +4z b. 5x2 +3y2+7z2​

Answers

Answer:

a.2×1= 2 + 3×1=3 +4×2=8 now we have to put this ans and the ans is 13.

b. 5×1×2=10 + 3×1×2=6+ 7×2×2=28 now also we have to put this ans and this ans is 13

Problem Solve for t.
2(t+1) = 10

Answers

t=4

explanation

2(t+1)=10

2t+2=10

2t=8

t=4

Find the largest prime factor of 18! + 19! + 20!

Answers

Answer: Prime Factors for 18: 2, 3, and 3

Prime Factors for 19: 19

Prime Factors for 20: 2, 2, and 5

Can you mark brainlest

Step-by-step explanation:

I need help i tried to do this but can't get it.

Answers

Answer: x=5, y=-1

Hope this helps

please solve this

.............​

Answers

Answer:

D

Step-by-step explanation:

Note that I will be using a, b, and y instead of their Greek counterparts.

First, we know that sin(c+d) = sin(c)cos(d) + cos(d)sin(a) and sin(c-d) = sin(c)cos(d) - cos(d)sin(a). We can apply these here to get

sin(b+y) = sin(b)cos(y) + cos(b)sin(y)

sin(b-y) = sin(b)cos(y) - cos(b)sin(y)

sin(a+y) = sin(a)cos(y) + cos(a)sin(y)

sin(a-y) = sin(a)cos(y) - cos(a)sin(y)

Plugging these into our equation, we get

(sin(b)cos(y) + cos(b)sin(y) - (sin(b)cos(y) - cos(b)sin(y)))

/

(sin(a)cos(y) + cos(a)sin(y)-(sin(a)cos(y) - cos(a)sin(y)))

=

2cos(b)sin(y) / 2cos(a)sin(y)

= cos(b)sin(y)/cos(a)sin(y)

= cos(b)/cos(a)

Next, we can see that a+b = π, so we can subtract b from both sides to get a = π -b. Plugging that in for a in our equation, we get

cos(b) / cos(π-b)

After that, we know that cos(c-d) = cos(c)cos(d) - sin(c)sin(d). Plugging that in here, we get

cos(π-b) = cos(π)cos(b) - sin(π)sin(b)

= -cos(b) + 0

= -cos(b)

Plugging that back into our equation, we get

cos(b) / -cos(b) = -1

Other Questions
How to find joint and combined variation? Priya is buying raisins and almonds to make trail mix. Almonds cost $5.20 per pound and raisins cost $2.75 per pound. Priya spent $11.70 buying almonds and raisins. The relationship between pounds off almonds a, pounds of raisins r, and the total cost is represented by the equation 5.20a + 2.75r = 11.70. How many pounds of raisins did Priya buy if she bought the following amount of almonds: a pounds of almonds What did the Milgram experiment show? A. That people quickly adopt new roles B. That people will go along with the majority C. That people are basically bad D. That people obey authority Which of the following equations has exactly one solution?A. 4x 4 + 2x = 6x - 4B. 2(4x + 5) = 8x + 10C. 4x - 8 = 4(x - 4)D. 3x + 5 = 2x - 6 is there similarities between plagiarism and software piracy? explain. Match the features of a word processing software to their corresponding functions.OptionsReplaceChange AllExplainenables you to add or remove misspelled wordsarrowRightprovides the description of grammar errorsarrowRightchanges all occurrences of the misspelled wordsarrowRightchanges the behavior of the grammar checkerarrowRight ASAPWhen you become too cold, your hypothalamus will signal what parts of your body to raise the temperature?A. Muscles and kidneysB. Skin and pancreasC. Muscles and skinD. Kidneys and lungs What role did he play in down fall of Mughal Empire? Gabriel's family is investing $5,000 into two different bonds for college. One bond gavean interest of 5% per year, and the other 3%. If the combined interest for the year was$220, how much money was invested in each bond? can uh help me in this Consider the following reaction: Cr(NO3)3 (aq) + 2NaF (aq) --> 3NaNO3 (aq) + CrF3 (s) If 21.0 grams of NaF are needed to precipitate all of the Cr+3 ions present in 0.125L of a solution of Cr(NO3)3, what is the molarity of the Cr(NO3)3 solution? Your answer should be to 2 decimal places. Help ASAP!! Answer must be in radicals and in terms of pi. i need help with these two questions According to the U.S. National Center for Health Statistics, there is a 98% probability that a20-year-old male will survive to age 30.(a) Using statistical software, simulate taking 100 random samples of size 30 from thispopulation.(b) Using the results of the simulation, compute the probability that exactly 29 of the 30 malessurvive to age 30.(c) Compute the probability that exactly 29 of the 30 males survive to age 30, using thebinomial probability distribution.(d) Using the results of the simulation, compute the probability that at most 27 of the 30 malessurvive to age 30.(e) Compute the probability that at most 27 of the 30 males survive to age 30 using thebinomial probability distribution.(f) Compute the mean number of male survivors in the 100 simulations of the probabilityexperiment. Is it close to the expected value?(g) Compute the standard deviation of the number ofmale survivors in the 100 simulations of the probability experiment. Compare the result to thetheoretical standard deviation of the probability distribution calculate using the distributive property 719 The cross-section of a searchlight mirror is shaped like a parabola. The light bulb is located 3 centimeters from the base along the axis of symmetry. If the mirror is 20 centimeters across at the opening, find its depth in centimeters. (Round your answer to the nearest tenth if necessary.) The square pyramid pictured below has a surface area of9 m6 m6 m Cules son los rasgos sobresalientes de los gneros literarios (teatro, poesa, cuento, ensayo y oratoria)? there are 9 CTSOs, name 3 What is the area of the polygon below