evaluate :5/63-(-6/21)​

Answers

Answer 1

Answer:

answer is [tex]\frac{23}{63}[/tex]

Step-by-step explanation:

the equation is

[tex]\frac{5}{63}-(-\frac{6}{21} )[/tex]

=> [tex]\frac{5}{63}+\frac{6}{21}[/tex]

=> [tex]\frac{5}{63}+\frac{2}{7}[/tex] ;(divide numerator and denominator of [tex]\frac{6}{21}[/tex] by 3)

=> [tex]\frac{5+2*9}{63}[/tex]

=> [tex]\frac{23}{63}[/tex]

hope you have understood this

pls mark it as the brainliest


Related Questions

Determine the perimeter of triangleABC with A(2;3) B(3;-2) and C (-2;-3).​

Answers

Answer:

Plot the coordinates on a graph and join them to form a triangle. After doing that, you can count the length of each triangular side and find the sum of the 3 sides. That will be your answer.

please help me solve this exercise.!!
find the value of tanx if sinx+cosx=1/5 and 0<x<π.

Answers

Answer:  -4/3

=============================================================

Explanation:

Let's square both sides and do a bit of algebra to get the following.

[tex]\sin(x) + \cos(x) = 1/5\\\\\left(\sin(x) + \cos(x)\right)^2 = \left(1/5\right)^2\\\\\sin^2(x) + 2\sin(x)\cos(x) + \cos^2(x) = 1/25\\\\\sin^2(x) + \cos^2(x) + 2\sin(x)\cos(x) = 1/25\\\\1 + 2\sin(x)\cos(x) = 1/25\\\\\sin(2x) = 1/25 - 1\\\\\sin(2x) = 1/25 - 25/25\\\\\sin(2x) = -24/25\\\\[/tex]

Now apply the pythagorean trig identity to determine cos(2x) based on this. You should find that cos(2x) = -7/25

This then means tan(2x) = sin(2x)/cos(2x) = 24/7.

From here, you'll use this trig identity

[tex]\tan(2x) = \frac{2\tan(x)}{1-\tan^2(x)}\\\\[/tex]

which is the same as solving

[tex]\tan(2x) = \frac{2w}{1-w^2}\\\\[/tex]

where w = tan(x)

Plug in tan(2x) = 24/7 and solve for w to get w = -4/3 or w = 3/4

So either tan(x) = -4/3 or tan(x) = 3/4.

If we were to numerically solve the original equation for x, then we'd get roughly x = 2.21; then notice how tan(2.21) = -1.345 approximately when your calculator is in radian mode.

Since tan(x) < 0 in this case, we go for tan(x) = -4/3

If I Have 100 Dollars And i go to the bank and i ask for 30 more and use that money on a store and i have 12 Dollars Left How Much Did the Thing I Bought Cost/ How Much Money did i spend?

Answers

Answer:

$118

Step-by-step explanation:

First, find how much money you had after going to the bank:

100 + 30

= $130

Find how much money you spent at the store by subtracting 12 from 130:

130 - 12

= 118

So, you spent $118

I need help really bad does can I contact anyone for help I need to complete or I fail really bad.

Answers

Step-by-step explanation:

45 >= 4x + 5

40 >= 4x

10 >= x (x <= 10)

and

53 > 4x + 5

48 > 4x

12 > x (x < 12)

so, both conditions need to be true (that is the meaning of "and").

how can that be achieved ? well, the harder, narrower condition beats any other.

so, when x <= 10, then it is automatically also smaller than 12.

so, the solution (inequality notation) is

x <= 10

and the graph just shows a line that starts at 10 (with a full, black dot at 10, as the point is included) and goes all the way to the left (to infinity and beyond ...)

Please solve this problem ​

Answers

take the help of the attachments.

answer to this problem?​

Answers

Answer:

The p is 4

Step-by-step explanation:

PLS HELP ME ON THIS QUESTION I WILL MARK YOU AS BRAINLIEST IF YOU KNOW THE ANSWER!! Determine the Value of K in the diagram ( secant lines to circles).

Answers

Answer:

k = 10

Step-by-step explanation:

According to intersecting secants theorem we have the following equation:

3x*(3x + 5x) = 2x*(2x + kx)

Solve it for k:

3x*8x = 4x² + 2kx²24x² = (4 + 2k)x²24 = 4 + 2k20 = 2kk = 10

Determine if the expression -5y^5-y^3 is a polynomial or not. If it is a polynomial, state the type and degree of the polynomial.

Answers

Answer:

Yes, it is a polynomial, and the degree is 5

Step-by-step explanation:

A polynomial is a combination of terms separated using + or − signs and normally have exponents. So, this equation is a polynomial. The degree is just the highest exponential value, which is 5 because -5y is being raised to the 5th power

Right now Jack’s age is greater than twice Fred’s age by 4. After 8 years, the sum of their ages is 59. Find Fred’s age.

Answers

Fred's age is 13 years

Let

Fred's age = x

Jack's age = 2x + 4

After 8 years:

Fred's age = x + 8Jack's age = 2x + 4 + 8

= 2x + 12

Sum of their ages = 59

Sum of their ages = Fred's age + Jack's age

59 = (x + 8) + (2x + 12)

59 = x + 8 + 2x + 12

59 = 3x + 20

59 - 20 = 3x

39 = 3x

x = 39/3

x = 13 years

Therefore, Fred's age = 13 years

https://brainly.com/question/24371832

Is 64 a rational number or irrational?

Answers

Answer:

Step-by-step explanation:

the answer is irrational hope this helps

Answer:

Rational.

Step-by-step explanation:

64 is a rational number because it's a whole number. Irrational numbers are real numbers including: [tex]\pi, \sqrt{2}[/tex], and etc. Basically, rational numbers are anything that can be expressed as the quotient of two integers: 64/1

which value of -7(x2-6)+2y when x=2 and y=6

Answers

Answer:

Solution

= -7 (x2 -6) +2y

= -7 ( 2*2 - 6 ) + 2 * 6

= -7 ( 4 - 6) + 12

= -7 - 2 + 12

= - 9 + 12

= 3

I hope this help u :)

define a ploynomial with real coeffients​

Answers

Answer:

an expression of more than two algebraic terms, especially the sum of several terms that contain different powers of the same variable is called polynomial. A polynomial with real coefficients is a product of irreducible polynomials of first and second degrees.

the area of a parallelogram is 48cm².if the two adjacent sides are 8cm and 6cm, find the length of its diagonal .​

Answers

Answer:

10cm

Step-by-step explanation:

Assuming the shape is a rectangle since it's already stated that it's a parallelogram, and the area is stated, we can use the Pythagorean theorem to find the length

[tex]a^{2} +b^2=c^2[/tex], where c will be the length

isolate c

[tex]c^2=a^2+b^2[/tex]

[tex]c=\sqrt{a^2+b^2}[/tex]

substitute for a and b

[tex]c=\sqrt{8^2+6^2}[/tex]

[tex]c=\sqrt{64+36}[/tex]

[tex]c=\sqrt{100}[/tex]

[tex]c=10[/tex]

Can you please help me!!!!!​

Answers

This is the venn diagram. Try and make a new one.

PLS HELP ME ON THIS QUESTION I WILL MARK YOU AS BRAINLIEST IF YOU KNOW THE ANSWER PLS GIVE ME A STEP-BY-STEP EXPLANATION!!

Answers

Answer: c

Step-by-step explanation:

The correct answer is option C i.e. all of the options

Question : Why did I choose the answer as option C

Reason : To assure it we'll match all the options with the figure

First of all in the given figure all the sides and angles are equal hence, we can refer it as regular

Secondly, It is convex because all the parts are pointing outwards and inner ones are not more than 180°

Finally, As it has 8 sides it is an octagon

Now, we can see all the three options are matching leaving C which states all of these options, hence C is correct

Extras :

1) What is Octagon ?

ans :- Octagon is an 8 sided polygon

2) What is a regular polygon ?

ans :- Any polygon which has equal angles and sides is known as a regular polygon.

3) What is convex ?

ans :- A convex is a shape where all the parts points outwards and interior angles are not more than 180°

Given 4,7,10,13. Determine a rule to describe the general term, Tn.​

Answers

Answer:

[tex]T_{n}[/tex] = 3n + 1

Step-by-step explanation:

There is a common difference between consecutive terms, that is

7 - 4 = 10 - 7 = 13 - 10 = 3

This indicates the sequence is arithmetic with nth term

[tex]T_{n}[/tex] = a₁ + (n - 1)d

where a₁ is the first term and d the common difference

Here a₁ = 4 and d = 3 , then

[tex]T_{n}[/tex] = 4 + 3(n - 1) = 4 + 3n - 3 = 3n + 1

Match the vocabulary word to its correct definition.

1. mean
The mean is the average value of the data you collect. In statistics, you find the mean of your sample. Then you use that mean to approximate the mean of the entire population. If you want the mean of the data to be a good approximation of the mean of the entire population, your need to make sure that you collect a random sample. To find the mean, you find the sum of the data points you collected and divide it by the number of data points in the set. For example, if the data you collected was {3, 3, 6}. Then the mean would be (3 + 3 + 6) ÷ 3 = 12 ÷ 3 = 4. It's important to note that the mean does not have to be a data point in your set. You can generalize the formula as well. If you collect n data points {d1, d2, d3, … dn}, then the mean of your data set is . The Greek letter μ—pronounced "mu"—is used because the word "mean" begins with the letter "m." It is important that you divide by the number of data points in your set, n.
2. population
An experiment is a well-defined procedure under controlled conditions designed to gather data that tests a hypothesis. For example, you want to test the hypothesis that flowers grow faster when they are watered every other day as opposed to every day. Then you could water one set of plants every day and another set of plants every other day. What data would you collect? The height of each plant once a day. What conditions would you need to control? You would need to make sure that the groups of plants are treated the same in every other way by getting the same amount of sun and being maintained at the same temperature, etc.
3. experiment
Bias is the preference for a particular group or subset. In the example above, the bias was toward viewers who like sports. When your sample is not chosen at random, you introduce bias into your study. So, in a certain sense, a biased sample is the opposite of a random sample. Why? In a biased sample, some members of the population are more likely to be chosen than others. In a random sample, every member of the population is equally likely to be chosen. Bias may also occur in surveys. See "survey" below for more information on this type of bias.
4. sample
A population is the entire group you want to understand. So, in a certain sense, you can think of the population as the "opposite" of the sample because a sample is not the entire population. A sample is chosen subset upon that you use to draw conclusions about the entire population.
5. bias
Random means free from bias. So, if you choose a random sample from a population, every member of the population has an equal chance of being chosen. It should be pointed out that this "true randomness" is an ideal which is difficult to achieve in real world experiments conducted on real world populations. That is why statisticians make every effort to ensure their samples chosen as free from bias as is possible, that is, as randomly as possible under real world conditions.
6. survey
A sample is a subset chosen from a population. In most cases, you want a random sample. Why? A random sample has the best chance of accurately representing the entire population.
7. random
A survey is the means of collecting a sample. In statistics, a survey is often a question or set of questions. It is critical that the questions, like the sample itself, be free from bias. Bias in a question tends to favor one response. As an extreme example of a biased question about colors might be, "Don't you think blue is beautiful and yellow is yucky?" An unbiased form of the question might be, "Which color do you prefer, blue or yellow?" Though careful, statisticians might be concerned about the order in which the colors are offered, so that might further simplify the question to, "What is your favorite color?" This type of question is most free from bias because it does not suggest a response and therefore does not favor a response.

Answers

Answer:

1. mean-The mean is the average value of the data you collect. In statistics, you find the mean of your sample. Then you use that mean to approximate the mean of the entire population. If you want the mean of the data to be a good approximation of the mean of the entire population, your need to make sure that you collect a random sample. To find the mean, you find the sum of the data points you collected and divide it by the number of data points in the set. For example, if the data you collected was {3, 3, 6}. Then the mean would be (3 + 3 + 6) ÷ 3 = 12 ÷ 3 = 4. It's important to note that the mean does not have to be a data point in your set. You can generalize the formula as well. If you collect n data points {d1, d2, d3, … dn}, then the mean of your data set is . The Greek letter μ—pronounced "mu"—is used because the word "mean" begins with the letter "m." It is important that you divide by the number of data points in your set, n.

2. Population-A population is the entire group you want to understand. So, in a certain sense, you can think of the population as the "opposite" of the sample because a sample is not the entire population. A sample is chosen subset upon that you use to draw conclusions about the entire population.

3. Experiment-An experiment is a well-defined procedure under controlled conditions designed to gather data that tests a hypothesis. For example, you want to test the hypothesis that flowers grow faster when they are watered every other day as opposed to every day. Then you could water one set of plants every day and another set of plants every other day. What data would you collect? The height of each plant once a day. What conditions would you need to control? You would need to make sure that the groups of plants are treated the same in every other way by getting the same amount of sun and being maintained at the same temperature, etc.

4. Sample-A sample is a subset chosen from a population. In most cases, you want a random sample. Why? A random sample has the best chance of accurately representing the entire population.

5. Bais-Bias is the preference for a particular group or subset. In the example above, the bias was toward viewers who like sports. When your sample is not chosen at random, you introduce bias into your study. So, in a certain sense, a biased sample is the opposite of a random sample. Why? In a biased sample, some members of the population are more likely to be chosen than others. In a random sample, every member of the population is equally likely to be chosen. Bias may also occur in surveys. See "survey" below for more information on this type of bias.

6. Survey-A survey is the means of collecting a sample. In statistics, a survey is often a question or set of questions. It is critical that the questions, like the sample itself, be free from bias. Bias in a question tends to favor one response. As an extreme example of a biased question about colors might be, "Don't you think blue is beautiful and yellow is yucky?" An unbiased form of the question might be, "Which color do you prefer, blue or yellow?" Though careful, statisticians might be concerned about the order in which the colors are offered, so that might further simplify the question to, "What is your favorite color?" This type of question is most free from bias because it does not suggest a response and therefore does not favor a response.

7. Random-Random means free from bias. So, if you choose a random sample from a population, every member of the population has an equal chance of being chosen. It should be pointed out that this "true randomness" is an ideal which is difficult to achieve in real world experiments conducted on real world populations. That is why statisticians make every effort to ensure their samples chosen as free from bias as is possible, that is, as randomly as possible under real world conditions.

Step-by-step explanation:

It says what each of them are in each paragraph, you just need to match them up.

Hope this helps :)

Can anyone help? It’s due in the morning

Answers

21) Angle 4

Angle 5

Angle GVH

Angle GVI

Angle HVI

22) Area of parallelogram = [tex]bh[/tex]

     A = 9 × 4 = [tex]36mi^2[/tex]

23) Area of a triangle = [tex]\frac{1}{2} bh[/tex]

     A =    [tex]\frac{1}{2} (12)(7.3)[/tex]

     A = [tex]43.8m^2[/tex]

24) Distance between each pair of point:

Distance between two points = [tex]\sqrt{(x_{B}-x_{A} )^2+(y_{B}-y_{A} )}[/tex]

Add the values in the formula & solve:

[tex]=\sqrt{(-2-0)^2+(2--4)^2}[/tex]

[tex]=\sqrt{(-2)^2+6^2}[/tex]

[tex]=\sqrt{4+36}[/tex]

[tex]=\sqrt{40}=6.3246[/tex]

25) Midpoint [tex](x_{M},y_{M} )=(\frac{x_{A} -x_{B} } {2} ,\frac{y_{A}+y_{B} }{2} )[/tex]

                                    [tex]=(\frac{10+0}{2},\frac{6+7}{2} )[/tex]

                                    [tex]=(\frac{10}{2} ,\frac{13}{2} )[/tex]

Midpoint of a line segment [tex](x_{M},y_{M} )=(5,6.5)[/tex]

I hope this helps....

in a box of 80 glasses,3 are broken.workout percentage of broken glasses​

Answers

Answer:

3.75%

Step-by-step explanation:

The percent that are broken is the number broken over the total * 100%

3/80 * 100%

.0375 * 100%

3.75%

Answer:

3.75% of the glass are broken

Step-by-step explanation:

3/80 × 100 = 3.75

I hope this helps.

Yet another calculus question :)


Given [tex]y = x^3 - 2x[/tex] for [tex]x \geq 0[/tex], find the equation of the tangent line to y where the absolute value of the slope is minimized.

I have tried taking both the first and second derivatives and setting them equal to 0 and using that as the answer, but they're incorrect. Could somebody please explain how to complete the question correctly? Thank you so much!

Answers

Answer:  y = (-4/3)*sqrt(2/3)

This is the same as writing [tex]y = -\frac{4}{3}\sqrt{\frac{2}{3}}[/tex]

============================================================

Explanation:

The phrasing "where the absolute value of the slope is minimized" is an interesting way of saying "the tangent slope is 0". This is because absolute values are never negative, so the smallest it can get is 0.

Your teacher has given you

y = x^3 - 2x

which differentiates into

dy/dx = 3x^2 - 2

after using the power rule

The derivative function lets us determine the slope of the tangent. The slope is the dy/dx value. Since we want a slope of 0, we'll set 3x^2-2 equal to zero and solve for x. So you have the correct idea, but you won't involve the second derivative.

dy/dx = 0

3x^2 - 2 = 0

3x^2 = 2

x^2 = 2/3

x = sqrt(2/3)

Notice how I'm ignoring the negative version of this root. This is due to the fact that [tex]x \ge 0[/tex]

-------------------------

Now plug this x value back into the original equation to find its corresponding y coordinate.

y = x^3 - 2x

y = x(x^2 - 2)

y = sqrt(2/3)*( 2/3 - 2 )

y = sqrt(2/3)*( -4/3 )

y = (-4/3)*sqrt(2/3)

Note that x = sqrt(2/3) leads to x^2 = 2/3 after squaring both sides.

-------------------------

Therefore, the equation of this tangent line is y = (-4/3)*sqrt(2/3)

All horizontal lines are of the form y = k, for some constant k. This constant value is basically what number you want the horizontal line to go through on the y axis. That number would be (-4/3)*sqrt(2/3).

convert 72° into grades.

Answers

Answer:

80 grades is the answer.

Step-by-step explanation:

72° into grades

1° = 10/9 grades

72° = 10/9 × 72grades

= 720/9 grades

= 80 grades

Answer:

80 grades

Step-by-step explanation:

72° into grades  

=>1° = 10/9 grades

=>72° = 10/9 × 72 grades  

=>72° = 720/9 grades

=>72° = 80 grades

The minimum mark to obtain a Grade A is 75. Cheryn managed to achieve an average of Grade A for three of her English quizzes. What is the minimum mark she scored in her first quiz if scored 76 and 89 marks in her second and third quiz, respectively?​

Answers

9514 1404 393

Answer:

  60

Step-by-step explanation:

Let m represent the mark Cheryn scored on her first quiz. Then her average is ...

  (m +76 +89)/3 ≥ 75

  m +165 ≥ 225 . . . . . . . . multiply by 3

  m ≥ 60 . . . . . . . . . . . . subtract 165

Cheryn scored a minimum of 60 marks on her first quiz.

I'm Timed
Which situation could this expression represent?
6 + 15 ÷ 3

Michael has 6 stamps in his collection. He adds 15 more stamps to the collection. He divides the collection into 3 piles. How many stamps are in each pile?

Walter has 6 stamps in his collection. He divides the stamps evenly into 3 piles and adds 15 new stamps to one of the piles. How many stamps are in this pile?

Andy has 15 stamps in his collection. He divides the stamps evenly into 3 piles and adds 6 stamps to one of the piles. How many stamps are in this pile?

Brycen has 15 stamps in his collection. He adds 6 more stamps to the collection. He divides the collection into 3 piles. How many stamps are in each pile?

Answers

It would be C. Because PEMDAS. Division goes first in this equation. So it’d be 15 divided by 3 plus 6

Answer:

It's Micheal because he started with 6 and added 15 and he divided them into 3 piles

(2.75 x 107) + (1.23 x 108) simplify

Answers

Answer:

427.09

Step-by-step explanation:

(2.75 x 107) + (1.23 x 108)

294.25 + 132.84 = 427.09

Erica recently invested in gold that is growing in value 4% annually. She invested $4000 initially. Find the value of her investment after 6 years.

Answers

Answer:

4%  = 0.04

4000 = 0.04

6 years = 0.04

Step-by-step explanation:

Hope this helps!

help me please I need
[tex] {x}^{2} + 2x + 6 \\ {x}^{2} + 4x + 2[/tex]

Answers

Step-by-step explanation:

SEE THE IMAGE FOR SOLUTION..

hey, can i please get your intro? would you like to be my friend?

Myself Ojasvi

Class 8, 13

India

b) 2x (x - y) + 3y (x - y)​

Answers

Use distributive law

[tex]\boxed{\sf a(b+c)=ab+ac}[/tex]

Now

[tex]\\ \sf\longmapsto 2x(x-y)+3y(x-y)[/tex]

[tex]\\ \sf\longmapsto 2x^2-2xy+3xy-3y^2[/tex]

[tex]\\ \sf\longmapsto 2x^2-3y^2-2xy+3x^2[/tex]

[tex]\\ \sf\longmapsto 2x^2-3y^2+xy[/tex]

Taking common

Answer: 2x (x-y) + 3y (x-y)

             = ( x-y ) ( 2x-3y )

Shaded areas ( What is the area of the shaded region? )

Answers

Answer:

119.43 cm²

Step-by-step explanation:

The shaded area (A) is calculated as

A = area of rectangle - area of circle

   = (11 × 12) - π × 2²

  = 132 - 4π

  ≈ 119.43 cm² ( to the nearest hundredth )

TRIGONOMETRY
Could someone please help me with 5.2 please...it would really help alot:)​

Answers

sin(x+y) - sin(x-y) - 1 = cos(2x)

sin(90) - sin(x-y) - 1 = cos(2x)

1 - sin(x-(90-x)) - 1 = cos(2x)

-sin(2x-90) = cos(2x)

-1*(sin(2x)cos(90) - cos(2x)sin(90)) = cos(2x)

-1*(sin(2x)*0 - cos(2x)*1) = cos(2x)

-1*(0 - cos(2x)) = cos(2x)

-1*(-cos(2x)) = cos(2x)

cos(2x) = cos(2x)

This confirms the identity is true.

Notice that throughout this proof, I only changed the left hand side.

On the 5th line, I used the identity sin(A-B) = sin(A)cos(B)-cos(A)sin(B).

Given: In Parallelogram ABCD,
• mA = (7y+13)º
• m2B = (106 - 2x)º
• mC = (10y - 32)º
• m2D = (3x – 4)º

What are the values of x and y

Answers

Answer:

x = 110

y = 15

Step-by-step explanation:

AB is parallel to CD

angle B and angle D are alternate and they are equal

106-2x = 3x-4

106 + 4 = 3x - 2x

110 = x

same goes for y

7y + 13 = 10y - 32

13 + 32 = 10y - 7y

45 = 3y divide both sides by 3

15 = y

Other Questions
is inevitable a noun Kylie is comparing the cost of two housekeeping companies, DoItRight and CleanIt. The table describes the costs for DoItRight.Hours, x 1.5 3 3.5 4.5Total Cost, f(x) $26 $44 $50 $62The cost of CleanIt Housekeeping is represented by g(x) = 10x + 16, where x represents the number of hours and g(x) represents the total cost in dollars.Determine which company has the greater initial cost. Plot a point on the graph to represent the initial cost of that company. ABC D PICK ONE Correct answer will get you brainiest Joshua is trying to find the product of 38 12. Which expression shows how Joshua could use place value to break up this problem and solve it?(32 + 6) (10 + 2)(30 + 8) (10 + 2)(31 + 7) (11 + 1)(30 + 8) (11 + 1) Algebra Piecewise functions!!!Can someone help with number 1? I got some of it but I dont know what to do next! Jose swims 3 laps in a pool every 2 minutes. How long would it take him to swim 27 laps?A.8B.9O c.16oD.18 Why don't Americans get much information on the news about what is happening in other countries, unless it's a tragedy; yet everyone else in the world gets news updates about America constantly ? What is the value of x? hello could you please help me with this math problem with full explanation which I am unable to solve? Thank you. PLZ ANSWER!!! IF YOU ANSWER U GET 20 POINTSFind |-65|.065-65 Floyd tells his daughter Glenda that she can have his Harley Davidson when he dies, but he does not add this to his will, and he is not on his deathbed. This is Which profession do you prefer ro choose for your career?Engineer or Architect? Why? Three children are riding on the edge of a merry-go-round that is a solid disk with a mass of 102 kg and a radius of 1.53 m. The merry-go-round is initially spinning at 9.71 revolutions/minute. The children have masses of 31.7 kg, 29.0 kg and 31.9 kg. If the child who has a mass of 29.0 kg moves to the center of the merry-go-round, what is the new angular velocity in revolutions/minute What is the three hundred and twenty six to the nearest ten Write your answer as a polynomial or a rational function in simplest form Point C is on the midpoint of a section of highway, represented by AB. If AB = 32 miles,AC = 4x miles, and CB = 12 + x miles, explain three different waysthatyoucouldsolve for x. A broker followed the instructions in an escrow disbursement order. However, one of the parties to the contract sued the broker and a judgment was filed against the broker that resulted in $8,000 in money damages plus $3,500 in court costs. The broker incurred $4,500 in attorney's fees associated with his defense. The FREC is authorized to disburse what amount associated with this case Please answer this and show the work/explain.2/7m - 1/7 = 3/14 What is the least common multiple of 70, 60, and 50? What is sound energy?A. A wave transmitted by the vibration of particles bumping into each other.B. Energy stored in the chemical bonds between atoms.C. A wave of photons carry the energy.D. Transfer of energy from waves to particles.