Determine the number of hydrogen atoms connected to each carbon atom: The bond-line structure of a compound has a SMILES string of CC1CCN(CC1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N. All the carbon atoms of the compound are highlighted and labeled a through p.

Answers

Answer 1

Answer:

dsgsdfd

Explanation:


Related Questions

1. Explain the test for unsaturation.
2. Write down the balanced chemical equations for the complete and incomplete
combustion of octene
3. Explain how propanol, an alcohol, is formed from propene..
4. How is margarine formed?

Answers

Answer:

1)In organic chemistry, the bromine test is a qualitative test for the presence of unsaturation (carbon-to-carbon double or triple bonds), phenols and anilines. ... The more unsaturated an unknown is, the more bromine it reacts with, and the less coloured the solution will appear.

2)The equation for incomplete combustion of propane is: 2 C3H8 + 9 O2 → 4 CO2 + 2 CO + 8 H2O + Heat. If not enough oxygen is present for complete combustion, incomplete combustion occurs. The result of incomplete combustion is, once again, water vapour, carbon dioxide and heat. But it also produces carbon monoxide.

Explanation:

3)Propene, also known as propylene, is an unsaturated organic compound with the chemical formula {\displaystyle {\ce {CH3CH=CH2}}}. It has one double bond, and is the second simplest member of the alkene class of hydrocarbons. It is a colorless gas with a faint petroleum-like odor. 

Formula: C3H6

IUPAC ID: Propene

4)Margarines are chemically created during hydrogenation which, until January 1, 2006, relied upon trans fats to solidify their vegetable oils. Food companies have been exploring options for replacing trans fat in partially hydrogenated margarine.

Razak uses 70 W fan and a 40 w lamp for eight hours a day, Calculate the amount of energy he used in a month. NORS Analysing​

Answers

Answer:

70 W and 40 w

there are 28 days in a month

Add those 2 together and get 110

then mutlpy by 28

3,080 amount of energy

Which of the following could be considered a scientific statement?

(A) I believe there is life on other planets.
(B) I observed that bees prefer red flowers.
(C) I think cake tastes much better than cookies.
(D) I consider yellow a cheerful color.

Answers

B. Science is based off of evidence and factual statements. Things that can be observed. Whereas the other answers someone can believe something different. But if 10 people are in a room, they can observe that bees prefer red flowers.

Hãy cho biết giá trị và ý nghĩa của số lượng tử n, l, m, ms khi mô tả trạng thái của electron trong nguyên tử?

Answers

Yes beautiful language

PLEASE HELP!!
this is on USAtestprep
a)
b)
c)
d)

Answers

D is the one or Na and MG
I’m pretty sure it’s d

During a reaction with solids generally the _______ the size of each piece, the larger the total surface area. This means _______ collisions and a greater chance of reaction.

A. smaller, more
B. larger, more
C. larger, less
D. smaller, less

Answers

Answer:

A

Explanation:

I'm assuming this question implies that the surface area is in relation to the volume of the pieces. In that case, the SMALLER the size of each piece, the larger the surface area. This is because more particles are able to fit into the container if they are smaller, leading to more surface area. Since more pieces can fit into the container, MORE collisions happen according to collision theory. I cannot add a link, but for a helpful analogy, look up "How To Speed Up Chemical Reactions (and get a date) - Aaron Sams.

Answer: A. smaller, more

Explanation: Founders Educere answer

An unknown compound has the following chemical formula:
Co(OH),
where x stands for a whole number.
Measurements also show that a certain sample of the unknown compound contains 5.1 mol of oxygen and 2.59 mol of cobalt.
Write the complete chemical formula for the unknown compound.

Answers

since we are given the moles for Co and O, we'll divide both of those moles by the lowest mole quantity, which is, in this case, 2.59. After dividing, we see that the ratio of O to Co is 2:1. So, for every 1 Co atom, there has to be 2 O atoms. we can then insert the 2 in for OH to satisfy this ratio.

How to distinguish between ethanol and 2 -methyl-2-propanol

Answers

Answer:

There are many reagents.

1. Use acidified potassium permanganate solution

2. Use acidified potassium dichromate solution

3. Fehling solution.

4. Silver/ oxygen at 500°C

5. Copper/ oxygen at 300°C

6. Lucas reagent ( anhydrous zinc and conc. hydrochloric acid)

Explanation:

Observations:

[with acidified potassium permanganate solution]

» Ethanol : The purple solution turns colourless.

» 2-methyl-2-propanol : no observable change.

[with acidified potassium dichromate solution]

» Ethanol : orange solution turns green

» 2-methyl-2-propanol : no observable change.

[Fehling solution]

» Ethanol : a white precipitate is formed

» 2-methyl-2-propanol : no observable change

Which of the following is an example of an optional deduction ? " a ) Medicare Ob ) Social Security c ) Retirement plan d ) State tax

Answers

Medicare  

United states program for people who are older than 60

A/An is a type of blood cell that's also called a red blood cell. a) Jeukocyte O b) thrombocyte c) plasma d) erythrocyte

Answers

Answer:

option a

Explanation:

pls mark me as brainliest

what are the biochemical properties of water​

Answers

Answer:

The biochemical properties of water are 1) chemical structure of water 2) water is a good solvent 3) hydrogen bonding. 4) sticky, wet water 5)the density of ice and water

1) Chemical Structure of Water.
2) Water is a good solvent.
3) Hydrogen Bonding.
4) Sticky, Wet Water.
5) The Density of Ice and Water.

Ortho and para hydrogen are....... a). molecular form. b). Nuclear form. c) allotropic form. d). All​

Answers

Ortho and para hydrogen are nuclei forms

difference between symbol and molecular formula in 3 points.​

Answers

symbol

i) A symbol is an abbreviation form for the full name of the element

what is the mass of cerrusite would contain 35g of lead?​

Answers

Answer:

i believe its 42

Explanation:

Given the following balanced reaction: 2Na(s) + F2(g) --> 2NaF(s)
a) How many moles of NaF will be made from 2.6 moles of F2?

b) How many moles of NaF will be made from 4.8 moles of Na?

Answers

Answer:

yes it is corrwect iyt is absolitle correct

Explanation:

Question 6
Which compound is more soluble in water?
O 3-propyl-2-octanol
1-methyl-3-pentanol
O2-methyl-1-ethanol
02-ethyl-3-heptanol
mouthing

Answers

Answer:

ethyl - 3- heptanol mouthing

2 ethyl and 3 heptanol I think just check the textbook

1. A
a stiff structure that surrounds and
protects a coll: found in plant, fungus, and some bacteria cells.
2.
is living things consisting of many cells.
3.
a green pigment that traps energy
from the sun.
the process in which plants and
some other organisms use the energy in sunlight to make food.
5. A
found in the nucleus of a cell,
a long nucleic acid molecule containing the genetic instructions
for the development and functioning of all living organisms.

Answers

Answer:

1 cell wall

2 yes

3 chloroplast

4 photosynthesis

5 Deoxyribonucleic acid (I believe)

hope this helped a little and pls mark brainiest if it did :)

Explanation:

The cell wall is a rigid layer that is found outside the cell membrane and surrounds the cell, providing structural support and protection.

NEED ANSWER FAST 50 POINTS
A mixture of copper sulfate and water is heated, leaving a residue of copper sulfate in the container. Which method was used to separate the mixture?

A. chromatography

B. evaporation

C. filtration

D. distillation

Answers

The method used to separate copper sulfate and water mixture was evaporation.

Explanation:

Chromatography is a separation technique used in labs. In this technique, there are two phases, the mobile phase, and the stationary phase. The phase in which the mixture is dissolved is termed as mobile phase and the phase which serves as a carrier through the system like, sheet, capillary, etc. is termed as mobile phase.Evaporation is a process in which the action of heat is employed to separate dissolved solids from liquid. Due to heat liquid gets evaporated leaving the solid behind.Filtration is a process in which insoluble particles are separated from the liquid by allowing them to pass through a porous substance such as filter paper. Distillation is a process used in the separation of the mixture of liquids with different boiling points.

So, from this, we can conclude that the method used to separate copper sulfate and water mixture was evaporation.

Learn more about separation techniques here

brainly.com/question/625109?referrer=searchResults

brainly.com/question/16774902?referrer=searchResults

Answer:

Just did this on my test the answer is evaportion.

Explanation:

PLEASE HELP!!
this is on USAtestprep
a)
b)
c)
d)

Answers

The answer is A!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!

compared to an atom of C-14, an atom of C-12 has a lesser

atomic number

number of protons

number of electrons

number of neutrons

Answers

Answer:

mass number

Explanation:

because the mass

number is the number of protons plus the number of neutron and the number of proton in an elements is always the same , therefore and atom of C-14 has greater mass number

1. What is uncertainty in measurements?

Answers

Answer:

In metrology, measurement uncertainty is the expression of the statistical dispersion of the values attributed to a measured quantity.By international agreement, this uncertainty has a probabilistic basis and reflects incomplete knowledge of the quantity value. It is a non-negative parameter.

Hope it helps you.

which of the followong would change the element represented in the electron module?
a. adding 1 proton
b. adding 1 electron
c. adding 1 neutron
d. removing the electron​

Answers

Answer:

removing the electron.

The term that would change the element represented in the electron module is removing the electron​. The correct option is d.

What are elements?

Chemical elements are the elements that are represented in the periodic table. There are 118 chemical elements discovered and represented in the periodic table. There are many more to be discovered.

The model is of an element. Elements are made up of atoms, and atoms contain charged particles. Out of these particles, electrons are revolved around the nucleus, which determined the atomic number of the element, and different elements have different numbers of electrons.

Removing the electron from the element, will change the element or change its atomic number.

Thus, the correct option is d. removing the electron​.

To learn more about Chemical elements, refer to the link:

https://brainly.com/question/11064416

#SPJ2

Select all of the following statements that represent the differences between a voltaic cell and an electrolytic cell. Group of answer choices The electrodes will change in mass for only the electrolytic cell Reduction happens at the cathode for only the electrolytic cell The redox reaction is spontaneous for only voltaic cell Electrode with the lowest reduction potential is reduced in an electrolytic cell A potential is generated when the voltaic cell runs

Answers

Answer:

The electrodes will change in mass for only the electrolytic cellElectrode with the lowest reduction potential is reduced in an electrolytic cellA potential is generated when the voltaic cell runs

The following statements represent the differences between a voltaic cell and an electrolytic cell -

The redox reaction is spontaneous for only voltaic cell potential is generated when the voltaic cell runsThe process occurs spontaneously in the voltaic cells due to chemical reactions.electrolytic cell electrical energy is needed for the chemical reactions to occur.

A potential is generated by a chemical reaction and for electrolytic cells, a potential is needed.

there is definitely an exchange of mass in a voltaic cellthe species with lower reduction potential always gets reduced and in any electrochemical cell reduction occurs at the cathode.

The following statements represent the differences between a voltaic cell and an electrolytic cell -

The redox reaction is spontaneous for only voltaic cell potential is generated when the voltaic cell runs

Thus, The following statements represent the differences between a voltaic cell and an electrolytic cell -

The redox reaction is spontaneous for only voltaic cell potential is generated when the voltaic cell runs

Learn more:

https://brainly.com/question/3614785

Another method for creating a buffer, in situ, is to add an appropriate amount of a strong base, e.g., NaOH, to a weak acid OR add an appropriate amount of a strong acid, e.g., HNO3, to a weak base. As an example, mixing 1.0 mol of acetic acid with 0.5 mol of NaOH will result in a buffer solution with 0.5 mol of acetic acid and 0.5 mol of acetate. The acetate is created by the reaction of acetic acid and the strong base, hydroxide. Given this information, which of the following, when mixed with the appropriate amount of HCl, would create a buffer solution?

a. HNO3
b. HClO2
c. LiCl
d. NH3

Answers

Answer:

As an example, mixing 1.0 mol of acetic acid with 0.5 mol of NaOH will result in a buffer solution with 0.5 mol of acetic acid and 0.5 mol of acetate. The acetate is created by the reaction of acetic acid and the strong base, hydroxide.

When HClO2 is mixed with the appropriate amount of HCl it would create a buffer solution. That is option B.

Methods used to form buffer solution

A buffer solution is the solution that resists a change in pH of a solution when acid or base is added because it is made up of weak acid and the conjugate base or weak base and the conjugate acid.

The methods that can be used to form a buffer solution include:

Adding a strong base to a weak acid: For example, mixing 1.0 mol of acetic acid with 0.5 mol of NaOH will result in a buffer solution with 0.5 mol of acetic acid and 0.5 mol of acetate.

Adding a weak acid to a conjugate base: For example HCl is a strong acid which will react with a conjugate base such as HClO2.

Although HCl is a strong acid, it can be converted to a weak acid through dilution with water. It is in this context that it can be used to form a buffer solution.

Learn more about buffer solution here:

https://brainly.com/question/26416276

write any four characties of vertebratas?​

Answers

Answer:

1. to bend

2. to sit

3. to walk

4. To stand

Explanation:

Which of the following is true of solutes dissolving in water?
a) C2H4 will dissolve because it is able to hydrogen bond.
b) CH3CH2OH will dissolve because it contains a polar bond.
c) HCI will not dissolve because it connot hydrogen bond.
d) KBr will not dissolve because it contains all ionic bonds.

Answers

B is the answer to your question.

C2H4 is not capable of hydrogen bonding because the H's are attached to the Carbon, and the charge is 0.

Although HCl cannot hydrogen bond, that aspect does not hinder it's ability to dissolve. Because HCl is polar and so is water, the positive side of H2O will be attracted to the negative side of HCl, thus "tearing" the molecule apart. (Like dissolves like - polar dissolves polar)

Based on the Solubility rule, KBr is soluble because it contains a group 1 metal.

What would happened to the mass of the copper II carbonate when you heated it in the reaction ?

Answers

there will be no chemical reaction

which is used in pencils​

Answers

Answer:

What are you trying to find out explain a bit more. Also what are the answer choices?

Explanation:

how many moles of H2 and N2 can be formed by the decomposition of 0.145 mol of ammonia, NH3 ?​

Answers

Answer:

Explanation:

The moles of H2 and N2 are as follows respectively, 0.3915mol of H2 and 0.1305 mol of N2.

0.2175,0.0725 moles of [tex]H_2[/tex] and [tex]N_2[/tex] can be formed by the decomposition of 0.145 mol of ammonia, [tex]NH_3[/tex]

The reaction for the decomposition of ammonia is as follows:-

[tex]N_2+3H_2 \rightarrow 2NH_3[/tex]

Calculate the mole  of [tex]H_2[/tex] and [tex]N_2[/tex] as follows:-

[tex]Mole\ of \ H_2=0.145\ mol\ NH_3\times\frac{3\ mol\ H_2}{2\ mol\ NH_3} \\\\=0.2175\ mol\ H_2[/tex]

[tex]Mole\ of \ N_2=0.145\ mol\ NH_3\times\frac{1\ mol\ N_2}{2\ mol\ NH_3} \\\\=0.0725\ mol\ H_2[/tex]

Hence, the number of moles of [tex]H_2[/tex] and [tex]N_2[/tex]  are 0.2175 mol, and 0.0725 mol.

To know more about:-

https://brainly.com/question/12996575

PLEASE HELP!!
this is on USAtestprep
a)
b)
c)
d)

Answers

The answer is D!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!
Other Questions
Which function represents the graph below? 8a^3-36a^2+54a-27-64p^3 C. It foreshadows Kaddo's death. An atom has mass number 23 and atomic number 11.a) How many electrons are revolving around the nucleus?b) How many electron shells are there in the atom? Which of the following items is an example of an overhead expense?: (A)Rent on a factory. (B)Electricity, most of which is used to power a plant's machinery. (C)Raw materials used in manufacturing. (D)Shipping costs on goods sold. (Hint: Remember that overhead expenses are fixed costs, which must be paid regardless of the amount of business done.) Write a letter to Letter to your Headmaster and ask permission to absent yourself from school for two days. In water, a substance that ionizes completely in solution is called a Given the reactants of the chemical reaction that will take place in Part D (construction of a lead concentration cell) prior to the assembly of the cell, determine the type of chemical reaction it is. Hint: Determine the products of the reaction. meaning of hatred in grammar Chris drives 240 miles from his home in Atlanta, Georgia, at 60 miles per hour. How many minutes longer would the return trip take if he travels at 50 miles per hour You need to include more of which nutrient in your diet as compared to yourgrandmother and why ? 4. Find the index of algebraic expression 4x^6 . What was the point of difference between the two sects of Jainism? Which of the following forced Jean-Bertrand Aristide out of power in Haiti? Primary source: Zimmermann Telegram1.) What can you infer from the primary source about the purpose of this piece of literature?2.) How did the author intend for his work to be taken and used?3.) Was he trying to be controversial or calming?4.) How does it all influence the meaning of the piece? Geometry, please answer question ASAP An operation manager at an electronics company wants to test their amplifiers. The design engineer claims they have a mean output of 331331 watts with a variance of 144144. What is the probability that the mean amplifier output would be greater than 332.8332.8 watts in a sample of 4949 amplifiers if the claim is true 14. What is the measure of angle w? Show all work. How to study can anyone tell me Some fruit flies have orange eyes and others have red eyes.If two orange-eyed fruit flies are crossed, their offspring always have orange eyes.If two red-eyed fruit flies are crossed, their offspring sometimes include both orange-eyed and red-eyed flies.What can be concluded from these observations?