Answer:
124800
Step-by-step explanation13
130,000 * 2% = 2,600
2,600*2= 5,200
130,000-5,200= 124800
Set up a linear system and solve
A $2,000 principal is invested in two accounts, one earning 4% interest and another
earning 7% interest. If the total interest for the year is $101, then how much is invested
in each account
Answer:
1300 and 700 respectively.
Step-by-step explanation:
Let x be invested in first account and y be invested in second account.
ATQ, x+y=2000 and 101=(4)*x/100+7*y/100. Solving it will give us x=1300 and y=700
what is the HCF of 216
Answer:
The answer for this question is 1
The sum of a number x and
eleven
Answer:
what is the sum.
Step-by-step explanation:
Take the sum - 11 =x
Reduce 20/60 to its lowest common denominator
Answer:
it is 1/4
Step-by-step explanation:
20/60=10/30=1/3
Answer:
20/60=1/3
Step-by-step explanation:
20/60
HCF=20,
20*1=20, 20*3=60
1/3
or,
Remove the zeros,
2/6
Divide by 2 on both,
1/3
or divide by any common factor on both and keep dividing until u cant no more
20/60=1/3
2012
Descriptive Answer Questions
Attempt FIVE questions.
11.
Show the Fisher's ideal index number satisfies both time reversal test and factor
reversal test from the following information
Commodities
2010
Price Expenditure
Price
Expenditure
5
4
32
72
х
6
50
5
28
Y
4
3
18
40
Z
8
40
50
3 XN
10
._. Help me please I’m putting my faith in this app.
HELLPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPP
Answer:
Q. 2 (d)
Step-by-step explanation:
4/3 x + 4 2/3
2(2/3)(x) + 14/3
2(2/3)(x) + 7(2/3)
take (2/3) common
2/3 (2x + 7)
ANSWER!
(All yes or no questions). Determine whether each of the following pairs of angles have equal measures:
a. KJLand LJM
b. MJP and PJR
C. LJP and NJR
d. MJK and PJR
9514 1404 393
Answer:
a) no
b) yes
c) yes
d) no
Step-by-step explanation:
Angle LJM is complementary to KJL, so is ...
angle LJM = 90° -42° = 48°
Angle NJP is marked as congruent to angle PJQ, so is also 48°.
__
a) ∠KJL = 42° ≠ 48° = ∠LJM . . . . NO
b) ∠MJP = 46°+48° = 48° +46° = ∠PJR . . . . YES
c) ∠LJP = 48° +46° +48° = 48° +48° +46° = ∠NJR . . . . YES
d) ∠MJK = 90° ≠ 48° +46° = ∠PJR . . . . NO
A certificate of deposit offers a nominal interest rate of 2.5 percent annually.
If inflation is 1 percent, what is the real rate of return?
To solve this question, the real rate of return formula is used, and we apply the data given in the exercise into the formula to find the real rate of return.
Formula for the real rate of return:
[tex]R = \frac{1 + N}{1 + i} - 1[/tex]
In which N is the nomial rate and i is the inflation rate, as decimals.
A certificate of deposit offers a nominal interest rate of 2.5 percent annually.
This means that [tex]N = 0.025[/tex]
Inflation is 1 percent
This means that [tex]i = 0.01[/tex]
What is the real rate of return:
Now we apply the formula:
[tex]R = \frac{1 + 0.025}{1 + 0.01} - 1[/tex]
[tex]R = 1.0149 - 1[/tex]
[tex]R = 0.0149[/tex]
0.0149*100% = 1.49%
Thus, the real rate of return is of 1.49%.
For another example of a similar problem, you can check https://brainly.com/question/20164190
Find the midpoint of the line segment joining (–4, –2) and (2,8)
Show all work
Answer:
Mid- point =(-4+2/2, -2+8/2)
=(-2/2,6/2)
=(-1,3)
The mid point of the line segment joining (–4, –2) and (2,8) is (-1, 3)
Mid point formulamid point = (x₁ + x₂ / 2, y₁ + y₂ / 2)
Therefore,
(-4, -2)(2, 8)
x₁= -4
x₂ = 2
y₁ = -2
y₂ = 8
Hence,
mid point = (-4 + 2 / 2, -2 + 8 / 2)
mid point = (-2 / 2, 6 / 2)
mid point = (-1, 3)
learn more on mid point here: https://brainly.com/question/1501820
8. If 30 cents out of every 1 dollar goes to taxes and the rest is net income, what's the
ratio of taxes to net income?
d
A. 30 : 7
B. 3:10
C. 30 : 1
D. 3:7
Answer:
D. 3:7Step-by-step explanation:
1 dollar = 30 cents tax + 70 cents net income
The ratio of taxes to net income:
30 : 70 = 3 : 7Correct choice is D
If 30cents are out then net income=100-30=70
ratio:-
[tex]\\ \rm\Rrightarrow \dfrac{30}{70}[/tex]
[tex]\\ \rm\Rrightarrow \dfrac{3}{7}[/tex]
[tex]\\ \rm\Rrightarrow 3:7[/tex]
PLEASEEEE HELP I WILL GIVE BRAINLIEST
choose the equation for the graph.
Answer:
c
Step-by-step explanation:
plz gimme brainliest
i promise u its c
Answer:
c
Step-by-step explanation:
The highest mountain in earth is 29,028 ft. The lowest under sea trench is -35,840ft. Which has the highest absolute value
Answer:
undersea trench
Step-by-step explanation:
Absolute value is the distance from zero
The highest mountain trench is |29028| or 29028 ft from zero
The lowest under sea trench is | -35840| of 35840 ft from zero
The highest absolute value is the undersea trench
Height always be positive .
Highest mountain in earth=29028ftAbsolute value:-
[tex]\\ \sf\longmapsto |29028|=29028ft[/tex]
Lowest undersea trench=-35840ftAbsolute value:-
[tex]\\ \sf\longmapsto |-35840|=35840ft[/tex]
find the equation of the sides of an isosceles right angled triangle whose vertex is (-2,-3) and the base is on the line x=0
Answer:
AC:y=x-1 CB:y=-x-5 AB:x=0
Step-by-step explanation:
Consider the triangle. The base AB is on the line x=0, the vertex C is (-2,-3)
The side AC is equal to BC. The angle ACB is 90 degrees. If the base is on the line x=o, it is on the axis Y.Explore the distance from the point C to the AB
c(-2,-3), the distance to the axis Y is equal to the modul of the coordinate x (-2), it is 2. The coordinates of point projected by the point C to the axis Y is N(0,-3). The modul of the height is 2, the height of the isosceles triangle to the base is the bisectrix, so the angle BCA is 90/2=45degrees, CBA is 180-90-45=45 degrees too
the heigt CN is equal to side NB, NB=2
Suppose B is (0,y) (x=0 because the base is on this line)
THe modul of the vector NB is equal to sqrt ((0-0)^2+(y+3)^2)= 2
modul (y+3)= 2
y=-1 or y=-5
(0,-1), (0,-5) - two points, one of them (suppose B) is (0,-5) when A is (0,-1) (A is remote from the point N on the same distance with B, because AB is the median too)
Find CB and AC
Use the equation for AC
(x-0)/(-2-0)= (y+1)/(-3+1)
x/-2= (y+1)/-2
x=y+1
y=x-1
For CB
(x-0)/ (-2-0)= (y+5)/ (-3-(-5))
x/-2= (y+5)/2
-x=y+5
y=-x-5
Factorize the following: cos²B + 5cosB - 6
Answer:
(cosB-1)(cosB+6)
Step-by-step explanation:
use u substitution . u = cosB
u^2+5u-6
factor
(u-1)(u+6)
put cosB back in for u
(cosB-1)(cosB+6)
Find the slope of the line passing through the points (9, 1) and (9,-4).
Answer:
slope is undefined
Step-by-step explanation:
(9, 1 ) and (9, - 4 )
Since the x- coordinates of the 2 points are 9, then the line is vertical and parallel to the y- axis with slope being undefined.
Slope is the change in y over the change in x.
Slope = (-4 - 1) / (9 -9) = -5/0 you cannot divide by 0,so the slope is undefined. This means it is a vertical line
square root 12 is ___ greater than square root 7
Answer:0.8
Step-by-step explanation:
E
Homework: Practice
Exam 3
Question 7
Find the standard deviation for the group of data items.
14, 15, 16, 16, 17, 18
The standard deviation is
(Simplify your answer. Round to two decimal places as needed.)
9
Answer:
Step-by-step explanation:
A homeowner needs two loads of gravel for the driveway to their new house. One loads weighs 8 tons and the second load
weighs 1,200 pounds. What is the total weight of the gravel, in tons, used for the driveway?
Total weight of the gravel, in tons used for the driveway is 8.6 tons
Weight of first load = 8 tons
Weight of second load = 1200 pounds
Convert pounds to tons:
1 pound = 0.0005 ton
1200 pounds = 0.6 ton
Then,
Weight of second load = 0.6 ton
Total weight of the gravel, in tons = Weight of first load + Weight of second load
= 8 tons + 0.6 tons
= 8.6 tons
https://brainly.com/question/24370065
Curtis purchased a bicycle on credit. When he received his credit card statement, he noticed several charges he did not make. What should he do?
Answer: He should call the card card company and discuss the charges and make it known that he did not make those charges. He should address each charge by the amount shown. Once he has finished, the credit card company will call the company that sent in the request for payment and inform the company there are questions about the charges and request that the charges be removed.
.
Step-by-step explanation:
The concentration of a drug in the body decreases exponentially after a dosage is given. In one clinical study, adult subjects averaged 14 micrograms/milliliter (mcg/mL) of the drug in their blood plasma 1 hr after a 1000-mg dosage and 3 micrograms/milliliter 4 hr after dosage.
a) Find the value k, and write an equation for an exponential function that can be used to predict the concentration of the drug, in micrograms/milliliter, t hours after a 1000-mg dosage.
b) Estimate the concentration of the drug 3 hr after a 1000-mg dosage.
c) To relieve a fever, the concentration of the drug should go no lower than 4 mcg/mL. After how many hours will a 1000-mg dosage drop to that level?
k = ________(Round to three decimal places as needed.)
Answer:
Step-by-step explanation:
14 = 1000 [tex]e^{ k*1}[/tex]
.014 = [tex]e^{k*1}[/tex]
ln(.014) = k ln(e)
k = -4.268
~~~~~~~~~~~~~~~~~~
after 3 hrs
1000 [tex]e^{ -4.268*3}[/tex]
0.00274
~~~~~~~~~~~~~~~
4 = 1000 [tex]e^{ -4.268*t}[/tex]
.004 = [tex]e^{ -4.268*t}[/tex]
ln(.004)/-4.268 = t
t = 1.29368 hrs
pamela is 8 years older that jiri. the sum of their age is 102. What is jiris age?
There are two different ways we can solve this problem. We could use brute force, or we can use some equations to solve the problem. We can start by defining Pamela and Jiri's ages differently. If Jiri is j, and Pamela is p, we can say that p = j + 8, because Jiri + 8 years is Pamela's age.
Now, using our values for Pamela and Jiri, we can say that (j + 8) + j = 102. Now we just solve like a normal equation, so 2j = 94, and j = 47, so Jiri is 47 years old.
Answer:
J = 47
Step-by-step explanation:
P = Pamela
J = Jiris
P = 8 + J ;- Equation 1
P + J = 102 ;- Equation 2
Substitute equation 1 into 2 to get:
J + 8 + J =102
2J = 102 - 8
2J = 94
J = 47
So Jiris is 47 years old
Lament has a jar containing 6 red chips, 10 blue chips, and 4 yellow chips. If he removes one chip at random, what is the probability that it will not be red?
The probability of not getting red is 7/10
What is probability?The area of mathematics known as probability deals with numerical representations of the likelihood that an event will occur or that a statement is true. An event's probability is a number between 0 and 1, where, roughly speaking, 0 denotes the event's impossibility and 1 denotes certainty.
Given
Your bowl has 20 chips. (4+10+6).
6 of them are red. 6/20 = 3/10
so the odds of getting a red chip are 3/10 ,
meaning the odds against getting red are 1-(3/10) = 7/10
To learn more about probability refer to:
https://brainly.com/question/13604758
#SPJ2
14 cm 8 cm 10cm 5 cm.
find the area and the perimeter of the above figures
Perimeter = Sum of all sides
Perimeter = 14cm + 8cm + 10cm + 5cm
Perimeter = 22cm + 15cm
Perimeter = 37cm
Step-by-step explanation:
hope it helps you
...
........
The sum of 'n' terms of an arithmetic sequence is 4n^2+3n. What is the first term, the common difference, and the sequence?
Answer:
The sequence has first term 7 and common difference is 8.
So the sequence is f(n)=7 + 8(n-1)
Step-by-step explanation:
Let a be the first term.
Let a+d be the second term where d is the common difference.
Then a+2d is the third....
And a+(n-1)d is the nth term.
Adding these terms we get:
an+(n-1)(n)/2×d
For the first term of this sum I seen we had n amount of a's and for the second term I used the well known identity sum of the first n positive integers is n(n+1)/2.
Let's simplify:
an+(n-1)(n)/2×d
Distribute:
an+(n^2d/2)-(nd/2)
Find common denominator:
(2an/2)+(n^2d/2)-(nd/2)
Combine terms into one:
(2an+n^2d-nd)/2
Reorder terms:
(n^2d+2an-nd)/2
Regroup terms:
(n^2d+(2a-d)n)/2
We want the following sum though:
4n^2+3n
This means d/2=4 (so d=8) and (2a-d)/2=3.
So plug d=8 into second equation to solve for a.
(2a-8)/2=3
2a-8=6
2a=14
a=7
The sequence has first term 7 and common difference is 8.
So the sequence is f(n)=7 + 8(n-1).
r-(-4x - (y + y)); use x = -4, and y = -3 evaluate
Answer:
insert values of x and y
r - ( -4(-4) - ( -3-3))
r - ( 16 +6 )
r - 22
Doneeeeeeeeeeeeeeeeee3
what percent of 70 is 35
Answer:
50%
Step-by-step explanation:
35 is halve of 70 therefore it is 50%
hope it helps u...........
Fill in the blank with the correct number.
The number
is divisible by 2, 3, 4, 6, and 10.
OA) 44
B) 180
C) 280
OD) 385
Answer:
385
Step-by-step explanation:
prove that 2^n+1>(n+2).sin(n)
Step-by-step explanation:
F(n)=|sin(n)|+|sin(n+1)|
then
F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)
and
F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)
so we must prove when n∈(0,π), have
F(n)>2sin12
when n∈(0,π−1),then
F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn
and n∈(π−1,π),then
F(n)=sinn−sin(n+1)
How prove it this two case have F(n)>2sin12? Thank you
and I know this well know inequality
|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R
Rachael needs to rent a car while on vacation. The rental company charges $17.95, plus 19 cents for each
mile driven. If Rachael only has $40 to spend on the car rental, what is the maximum number of miles she
can drive?
Answer:
116 miles
Step-by-step explanation:
We can solve this by first writing an equation for the cost of the car rental. To begin, the base cost is $17.95, so any further costs must be added to that. Next, the car costs 19 cents (0.19 dollars) for each mile driven, so for each mile, we add 19 cents. This can be written as 0.19 *x if x represents the amount of miles driven. Therefore, we can add the two input costs of the car (the base cost and cost per mile) to get
17.95 + 0.19 * x = total cost.
After that, we want to maximize x/the number of miles with only 40 dollars. We can do this by setting this equal to the total cost, as going over the total cost is impossible and going under would be limiting the amount of miles (this because we are adding money for each mile, so more money means more miles). Therefore, we have
17.95 + 0.19 * x = 40
subtract 17.95 from both sides to isolate the x and its coefficient
22.05 = 0.19 * x
divide both sides by 0.19 to isolate x
22.05/0.19 = x = 116.05
The question asked us to round down, and 116.05 rounded down is 116 for our answer