Will sodium iodide react with bromine to produce sodium bromide and iodine? Why or why not?

Question 10 options:

A) Yes, because bromine has lower activity than iodine

B) No, because bromine has higher activity than iodine

C) No, because bromine has lower activity than iodine

D) Yes, because bromine has higher activity than iodine

I believe its either B or D

Answers

Answer 1

Answer:

C

Explanation:

The higher the period the higher the activity of an element, therefore, since iodine is in period 6 and bromine is in period 5, the described reaction is not possible due to the fact that bromine is less active


Related Questions

The AP Biology teacher is measuring out 638.0 g of dextrose (C6H12O6) for a lab. How many moles of dextrose is this equivalent to?

Answers

The AP Biology teacher is measuring out 638.0 g of dextrose (C6H12O6) for a lab the moles of dextrose is this equivalent to is 3.6888 moles.

What are moles?

A mole is described as 6.02214076 × 1023 of a few chemical unit, be it atoms, molecules, ions, or others. The mole is a handy unit to apply due to the tremendous variety of atoms, molecules, or others in any substance.

To calculate molar equivalents for every reagent, divide the moles of that reagent through the moles of the restricting reagent. The calculation is follows:

655/12 x 6 + 12+ 16 x 6 = 655/ 180 = 3.6888 moles.

Read more about moles:

https://brainly.com/question/24322641

#SPJ1

It is the year 2040, and you are a research scientist. The amount of sunlight that reaches the earth has been drastically reduced due to a major event like pollution, fires, or volcanoes. Farmers are asking you for help to save their failing crops.

Answers

hhfgbuugucviibygtvhgyvybubbiinubuvycyuj

Which two protests evolved from symbolic relationships of organism which resulted in eukaryotic organisms chloroplast

Answers

Red algae and euglena evolved from a symbiotic relationship of organisms, which resulted in eukaryotic organisms containing chloroplasts

Theory of endosymbiosis:


Early eukaryotes developed by the symbiotic connection of prokaryotes, in accordance with the endosymbiosis idea. Which two protists underwent symbiotic evolution, leading to the development of eukaryotic creatures with chloroplasts.

-Symbiotic relationships between two or more prokaryotic cells led to the evolution of the first eukaryotic cells. Greater prokaryotic cells invaded or devoured smaller prokaryotic cells. The connection provided a secure home and nourishment for the tiny cells. By absorbing part of the organic molecules or energy generated by the endosymbionts, the bigger cells (now referred to as hosts) profited.

To learn more about endosymbiosis refer : https://brainly.com/question/1698852

#SPJ4

Which phrase describes a homogeneous catalyst?

Answers

Answer:

It is in the same phase as the reactants.

Explanation:

i took the test

How many atoms are present in 2.1 moles of Fe

Answers

Answer:

1.3 x 10²⁴ atoms Fe

Explanation:

To convert moles to atoms, you need to multiply your given value by Avogadro's Number. This causes the conversion to occur because Avogadro's Number exists as a ratio. It is the ratio that allows for the cancellation of units during multiplication. This is why atoms should be in the numerator of your conversion. The final answer should have 2 sig figs to reflect the given value.

Avogadro's Number:

1 mole = 6.022 x 10²³ atoms

2.1 moles Fe          6.022 x 10²³ atoms
---------------------  x  -------------------------------  =  1.3 x 10²⁴ atoms Fe
                                        1 mole

An educated guess which explains observations is called:  

a a law  
b an experiment
 c a hypothesis  
d a variable​

Answers

The answer is C. a hypothesis

Answer:

c. a hypothesis  is the correct answer

Explanation:

Only certified electricians are allowed to work on facility electrical system?

Answers

No that is incorrect definitely

Compare
Ion and Radical
Atom and molecule
Organic and inorganic compounds

Answers

Answer:

'An ion has a non-zero electric charge. A radical has an atom with unfilled electron shells and so is very reactive, but is electrically neutral.'

'Atoms are single neutral particles. Molecules are neutral particles made of two or more atoms bonded together.'

'The primary difference that lies between these organic compounds and inorganic compounds is that organic compounds always have a carbon atom while most of the inorganic compounds do not contain the carbon atom in them.'

Organic and inorganic compounds:

Similarities:::---

1) In both organic and inorganic compound, the elements joining in making compound complete their octet.

2) Organic compound shows isomerism (R/S , E/Z , cis/trans, enantiomers, diastereomers, etc), just as inorganic compound do (Δ/Λ, enantiomers, R/S enantiomers, cis/trans, fac/mer isomers, etc).

3) Organic compound and inorganic compounds can be very active in chemical reactions, e.g. organolithium reagents could be flammable or even pyrophoric (generally stored under 10°C), while inorganic reagents like in this paper are quite rapid...

Differences:::---

1) Organic compound are very long in size so they can make polymer but inorganic compound are not very long but its structure might me complex.

2) The boiling,melting point of organic compound is lass than inorganic compound.

3) Organic compound always contains carbon but inorganic compounds might not.

4) Organic compound

_____________________________

Ion and Radical Atoms:

In some sense they are a bit similar. The main difference is that a neutral radical has no charge imbalance between the protons and electrons, but the cation or anion does.

Ions are written with an explicit charge because of that charge imbalance, but radicals may or may not have an imbalance of charge. Just because a molecule is a radical doesn't mean it's neutral.

For example, if you shoot 2-pentanone with an electron beam for Electron "Impact" Mass Spectroscopy, where you essentially study molecules whose structures break into smaller pieces as a result of interacting with stray electrons to identify the molecules, you get a cationic radical (middle, or far right of the following diagram).

In 2007, the population of Canada was 1.26 × 108, the population of Mexico was 10.6 × 107, the population of Brazil was 13.6 × 107, and the population of China was 1.86 × 109. Which two countries have the highest population?

A. Canada and China
B. Mexico and China
C. China and Brazil
D. Brazil and Mexico

Answers

A do full go do by Gn no inns shoveling foreclosure

Grams in 1.083e+24
Molecules Na BR


Please help explain why

Answers

Answer:

185 gms o NaBr

Explanation:

Na Br  mole weight = 22.989 +79.904 = 102.893  gm/mole

1.083 x 10^24  molecules / 6.022 x 10^23 molecules / mole = 1.798 moles

102.893  *  1.798 = 185 gms

How can i calculate the concentration of 2.357g of sodium chloride in 75ml solution

Answers

Answer:

See below

Explanation:

Simply :    2.357 g / 75 ml = .03142  gm/ml   or  31.42  gm / liter

A 35. 0-l steel tank at 20. 0?c contains acetylene gas, c2h2, at a pressure of 1. 39 atm. Assuming ideal behavior, how many grams of acetylene are in the tank?.

Answers

52.66 grams of acetylene are in the tank.

PV=nRT is the formula for ideal gases, where P is the pressure and R is the constant and T is the temperature (P is 1.39 atm in this case)

Volume = 35.0 L

Gas constant = 0.08206 L.atm/K.mole

Temperature = 20.0 °C  = 293 °C

We also know that we can apply the formula ;

Number of mole(n) = [tex]\frac{MmPV}{RT}[/tex]

m = ( 26.04 × 1.39 × 35 )/ (0.08206 × 293.15)

m = 52.66 g

Thus, the mass is 52.66 grams.

Learn more about ideal gases here:

https://brainly.com/question/12281987

#SPJ4

What kind of air mass will bring cold, dry weather as it moves toward an area

Answers

Answer:

i think the answer is Continental polar air masses

Explanation:

An exergonic reaction __________ free energy, and an endergonic reaction __________ free energy.

Answers

Answer:

An exergonic reaction releases free energy, and an endergonic reaction absorbs free energy.

Explanation:

hope it helps

A 126.1-gram block of granite at 92.6°c is dropped into a tub of water at 24.7°c in an isolated system. the final temperature of both the granite and the water is 51.9°c. the specific heat capacity of granite is 0.795 joules/gram degree celsius, and the specific heat capacity of water is 4.186 joules/gram degree celsius. the granite block transferred of energy, and the mass of the water is .

Answers

The granite block transferred 4,080 joules of energy, and the mass of the water is 35.8 grams.

How we calculate heat transfer of any system ?

Heat transfer in any system can be calculated as follow:

q = mCΔT

Given ;

m = mass of granite = 126.1 g C = specific heat of granite = 0.795 joules/gram degree CelsiusΔT = change in temperature of granite = 51.9 °C - 92.6 °C = -40.7 °C

Putting all the values in folowing equation,

q = mCΔT

we get

q = 126.1 × 0.795 × -40.7 = -4080 J

Now by using same formula, we can also calculate the mass of water in the following way:

m = q / CΔT

where

C = specific heat of water = 4.186 joules/gram degree Celsius ΔT = change in temperature of water = 51.9 °C – 24.7 °C = 27.2 °C

Putting all these values ;

m = -4080 /  4.186 × 27.2 = 35.8 g.

Hence, 4,080 joules of energy is transferred by granite block and 35.8 g is the mass of water.

To learn more about heat transfer here ;

brainly.com/question/18980657

#SPJ1

Which type of electromagnetic wave has less energy than a microwave?
OA. Ultraviolet wave
OB. Radio wave
O C. An X-ray
OD. Infrared wave

Answers

Radio waves.

From lowest to highest it is radio wave, microwave, infrared, visible light, ultraviolet, x ray, and then gamma.

The cutoff frequency for a certain element is 1.22 x 1015 Hz. What is its work function in eV?
Hint: 1 eV 1.60 x 10-19 J
=[?] eV

someone please teach me how to solve this its gonna make me cry

Answers

The work function of the metal is obtained as 5.1 eV

What is the cutoff frequency?

The cutoff frequency is the frequency below which photo electric effect can not occur as electrons are not removed from the metal surface.

Now;

fo = 1.22 x 10^15 Hz

Wo = hfo

Wo = 6.6 * 10^-34 * 1.22 x 10^15

Wo = 8.1 * 10^-19 J

If 1 eV = 1.60 x 10-19 J

x eV = 8.1 * 10^-19 J

x = 8.1 * 10^-19/ 1.60 x 10-19

x = 5.1 eV

Learn more about cutoff frequency:https://brainly.com/question/14378802

#SPJ1

In photosynthesis, plants use energy from the sun to produce glucose, c6h12o6 , and oxygen from the reaction of carbon dioxide and water.
6co2 + 6h2o --> c6h12o6 + 6o2
what mass, in grams, of glucose is produced when 3.00 mol of water react with carbon dioxide?

Answers

Answer: 324 g (to 3 sf)

Explanation:

Based on the coefficients of the equation, we know that when 3.00 mol of water is consumed, 3.00 mol of carbon dioxide is also consumed.

The atomic mass of carbon is 12.011 g/mol.The atomic mass of oxygen is 15.9994 g/mol.

Thus, the formula mass of carbon dioxide is:

[tex]6(15.9994)+12.011=108.0074[/tex] g/mol.

Thus, 3.00 mol has a mass of (108.0074)(3.00)=324 g (to 3 sf)

The molecular structure of water has an asymmetrical arrangement of hydrogen atoms causing.

Answers

Answer:

the asymmetrical arrangement of hydrogen atoms in a molecule of water causes the molecule to be polar, with the hydrogen atoms having a slightly positive charge, and the oxygen atom having a slightly negative charge.

There are 8.421 g of dry ZnSO4 and
6.579 g H₂O in the sample.

Step 2: Determine the moles of water and anhydrous compound.

Zn = 65.38 g/mol, S = 32.07 g/mol,
H = 1.01 g/mol, O = 16.00 g/mol

How many moles of ZnSO4 are present?

[?] mol ZnSO4

Answers

The number of moles of H₂O is  0.36 mol.

The number of moles of LiClO₄ is  0.0521  mol.

What are moles?

Mole is an important standard unit used for the measurement of large quantities of atoms, molecules, or other particles. One mole is equal to 6.022×10²³ units.

The number of moles of a substance is calculated by:

Moles =[tex]\frac{mass}{molar \;mass}[/tex]

To find the number of moles of H₂O:

Mass of H₂O in the sample = 6.579 g

The molecular weight of H₂O = 18.02g

Moles = [tex]\frac{mass}{molar \;mass}[/tex]

Moles = [tex]\frac{6.579 g}{18.02g}[/tex]

Moles = 0.36

To find the number of moles of [tex]ZnSO_4[/tex]:

Mass of [tex]ZnSO_4[/tex] in the sample = 8.421 g

The molecular weight of [tex]ZnSO_4[/tex]= 161.47 g/mol

Moles =[tex]\frac{mass}{molar \;mass}[/tex]

Moles = [tex]\frac{8.421 g}{161.47 g/mol}[/tex]

Moles = 0.0521 moles

Learn more about moles here:

https://brainly.com/question/8455949

#SPJ1

Which of the following species of fish have cartilaginous skeletons?

Answers

You can attach a picture so I can help you

Answer:

sharks have cartilaginous skeletons

Explanation:

Sharks are an example

Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please

Answers

Answer:

1-bromo-6-chloro-5-methylheptane

Explanation:

There are 3 substituents, 1 chlorine, 1 bromine, and 1 methyl group.

The longest carbon chain consists of 7 carbons.

There are no double bonds, based on the saturation and substituents.

So you have a 1-bromo-6-chloro-5-methylheptane.

Hope that was the brainliest answer!

what is the approximate distance from the far edge of one lobe to the far edge of the other?

Answers

The approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.

What is distance between far edge of  two lobes in solar system?

This distance measures the outer space between the edges of the two lobes in a given time.

The approximate distance from the far edge of one lobe to the far edge of the other in a solar system is about 2,100,000 light-years.

Thus, the approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.

Learn more about distance here: https://brainly.com/question/2854969

#SPJ11

A 2. 75-l container filled with co2 gas at 25°c and 225 kpa pressure springs a leak. When the container is re-sealed, the pressure is 185 kpa and the temperature is 10°c. How many moles of gas were lost?.

Answers

Answer:

Moles Lost = 0.0335 moles

Explanation:

This type of question requires the Ideal Gas Law equation. The equation looks like this:

PV = nRT

In this formula,

-----> P = pressure (kPa)

-----> V = volume (L)

-----> n = number of moles

-----> R = constant (8.314 L*kPa/mol*K)

-----> T = temperature (K)

(Step 1)

To find how many moles were lost, you first need to find how many moles you had to begin with. This can be done by plugging the starting values into the equation and solving for "n". But first, you need to convert Celsius to Kelvin (by adding 273.15).

P = 225 kPa                  R = 8.314 L*kPa/mol*K

V = 2.75 L                     T = 25°C + 273.15 = 298.15 K

n = ?

PV = nRT

(225 kPa)(2.75 L) = n(8.314 L*kPa/mol*K)(298.15 K)

618.75 = n(2478.8191)

0.250 = n

(Step 2)

Next, you need to find the number of moles in the container after it has been re-sealed. The volume is the same because the container did not change. The process should be the same as above.

P = 185 kPa                   R = 8.314 L*kPa/mol*K

V = 2.75 L                     T = 10°C + 273.15 = 283.15 K

n = ?

PV = nRT

(185 kPa)(2.75 L) = n(8.314 L*kPa/mol*K)(283.15 K)

508.75 = n(2354.1091)

0.216 = n

(Step 3)

Finally, you can find the number of moles lost by subtracting the final amount of moles from the original amount. When doing this calculation, I used the value of the moles saved in my calculator (with more decimal places) to get a more accurate number.

Moles Lost = Initial Moles - Final Moles

Moles Lost = 0.250 moles - 0.216 moles

Moles Lost = 0.0335 moles

What is the mass in grams of 4.85 x 10^22 Al atoms? (Report your answer to two places past the decimal

Answers

Answer:

2.17 gm Al

Explanation:

First, find the number of moles .   Then multiply by the mole weight of aluminum.

# moles =   4.85 x 10^22 / 6.022 x 10^23 = .08053 moles

.0805 moles * 26.981 gm/mole  = 2.173 gm

what can we use to help us predict the results of reaction when we put metals into competition?

Answers

The activity series of metals as well as the electrode potential of metals can be used to compare the reactivity of metals.

What is used in comparing reactivity of metals?

The reactivity of metals can be compared using their electrode potentials which is a measures of the ability of the metal to donate electrons to another metal.

When comparing the reactivity of metals, the metal with the lesser negative electrode potential will be more reactive than another with a greater negative or positive electrode potential.

Therefore, the activity series of metals as well as the electrode potential of metals can be used to compare the reactivity of metals.

Learn more about activity series of metals at: https://brainly.com/question/17469010

#SPJ12

1s22s²2p63s23p64s²3d104p5
Which element is this?

Answers

Answer: bromine

Explanation:

There are a total of 2+2+6+2+6+2+10+5=35 electrons, meaning there are 35 protons. The element with atomic number 35 is bromine

Which best explains why a firework being ignited is an example of an exothermic reaction and not an endothermic
reaction ?
O The fireworks produce colors.
O The fireworks give off heat.
O Igniting the fireworks requires energy.
O Igniting the fireworks makes an odor.

Answers

the fireworks give off heat

The best explanation for why a firework being ignited is an example of an exothermic reaction and not an endothermic reaction is:

The fireworks give off heat.

Heat is emitted into the environment in an exothermic reaction. When a firework is lit, it undergoes a number of chemical processes inside the firework combination, which produces gases and produces a great deal of heat. Fireworks' distinctive visual display and audible effects are produced when heat is released as light and sound.

In contrast, heat is taken from the environment during an endothermic reaction. If a reaction were endothermic, it would need an outside energy source to continue, and because it would be absorbing heat from its environment, it would feel chilly to the touch.

However, because they release heat and energy and brighten the night sky, fireworks are instances of exothermic reactions.

To know more about heat:

https://brainly.com/question/32136211

#SPJ2

Please check the photo! I will award brainliest ONLY FOR PERSON WHO GIVES A LEGITIMATE ANSWER!!! Thank you :)

Answers

From the calculations, the percentage of the mineral left is 6.25%.

What is half life?

The term half life refers to the time that it takes for only half of the number of radioactive isotopes to remain.

From;

N/No = (0.5)^t/t1/2

N = ?

No = ??

t = 2000

t1/2 = 500

N/No =(0.5)^(2000/500)

N/No = 0.0625

Thus the percent left = 0.0625 * 100 = 6.25%

Learn more about half life of a nucleus:https://brainly.com/question/23518766

#SPJ1

What conditions make AG always positive?

Answers

Answer: when a reaction absorbs heat or decreases the entropy of the system,

Explanation: :)

Other Questions
Georgia was indented to be the second chance for what group pictures Samantha invests $11,000 at 6% simple interest for 25 years.Round your answers to the nearest cent. What is the final temperature of 0.1 kg of water initially at 22 *C after 10 kj of heat is added Imagine an instance where there are two parents, and both have polydactyly, a trait which is determined in this example by a singel gene. They have four children, one of hwom have polydactyly. what is the probailty their next child witll have polydactyly who is responsible for determining the safety and efficacy of any dietary supplement? The expression caco3 cao co2 is an example of a reactant. product. chemical equation. chemical progression. Please help me with this question The Onandaga creation story explains the origin of which one of the following? what's the answer??? Bendernet Corporation budgeted production at 6,000 units and charged $42,000 to its factory overhead account. Bendernet applies variable overhead at $3.00 per direct labor hour and assumes that each unit takes one direct labor hour to produce. The company applied $40,000 of its overhead to work-in-process based on 5,000 hours. If the company actually required 5,500 hours to produce 5,000 units, what was the total overhead variance and to what extent did volume variances contribute to or offset that variance What is one function of the introduction paragraph of a historical essay?A. To grab readers' attentionB. To make a prediction about the futureC. To provide evidence for one specific claimD. To persuade readers to take actionUBM PLS HELP!!!!!..... WILL MARK BRAINLIEST!!!!!What can you conclude from the graph? Select all that apply.Higher chick survival leads to smaller clutch sizes.Higher clutch sizes increase the parents' fitness.Large clutch size is strongly correlated with lower chick survival.Large clutch size causes lower chick survival.Smaller clutch sizes increase the parents' fitness. Abigail works as a salesperson at an electronics store and sells phone: accessories. Abigail earns a $12 commission for every phone she sells commission for every accessory she sells. On a given day, Abigail mad $258 in commission and sold 6 more accessories than phones. Write a equations that could be used to determine the number of phones sold a number of accessories sold Define the variables that you use to write thigail works as a salesperson at an electronics store and sells phones and phone cessories. Abigail earns a $12 commission for every phone she sells and a $3 mmission for every accessory she sells. On a given day, Abigail made a total of 258 in commission and sold 6 more accessories than phones. Write a system of quations that could be used to determine the number of phones sold and the umber of accessories sol Define the variables that you use to write the system. Whats the first app to ever come out ? what was the first computer system that used color display? match each form of government with the correct characteristic ____________________ disorders all have unrealistic, irrational fears or anxieties of disabling intensity as their principal and most obvious manifestation. How does the intracellular fluid compartment differ from the extracellular fluid compartment?. Which term describes this reaction? What is the area of triangle ABC?