Answer:
d) II and IV only.
Explanation:
A catalyst increases the kinetic energy of reactant molecules which increases the magnitude of collision. These then decreases the activation energy . A catalyst is not consumed by reaction because it is neither reactant nor a product, hence has no effect on equilibrium constant.
[tex].[/tex]
Answer:
A
Explanation:
it speed up a chemical reaction without being consumed by the reaction and increases the reaction rate by lowering the activation energy for a reaction but the average kinetic energy of the molecules remains the same well the required energy decreases
Which substance will sublimate when in the solid phase at room temperature and pressure?
Select the correct answer below:
A) carbon dioxide
B) water
C) mercury
D) helium
Answer:
I think carbon dioxide is right answer
The ion with a +3 charge 28 electrons and mass number of 71
Answer:
gallium
Explanation:
Ga +++ as it is the only ion with that features
Are acids harmful to work with.
Answer:
yes it is
Explanation:
because there are some acid which really harm skin.
Which of the following has the greatest effect on colligative properties?
A. Calcium chloride (CaCl2)
B. Sodium chloride (NaCl)
C. Aluminum Nitrate (Al(NO3)3)
D. Epsom salt (MgSO4)
Answer:
C. Aluminum Nitrate (Al(NO3)3)
Explanation:
This is because, when Aluminium nitrate dissolves in water, it dissociates to form four ions ( one aluminium ion and three nitrate ions ). Since colligative property depends on number of particles or ions present ( roult's law ), this will create much effect.
[tex]Al(NO _{3} )_{3(aq)} → Al {}^{3 + } _{(aq)} + 3NO {}^{ - } _{(aq)}[/tex]
Answer:
aluminum nitrate (Al(NO3)3)
it has the greatest effect on collimation properties .
Explanation:
(c) is correct option
Name the following alkane molecule:
A. methylpentane
B. 2-methylpentane
C. 2-ethylpentane
Answer:
B
Explanation:
its upside down but I'm 99% sure
At a constant temperature, a sample of gas occupies 1.5 L at a pressure of 2.8 ATM. What will be the pressure of this sample, in atmospheres, if the new volume is 0.92 L?
Using boyles law
[tex]\boxed{\sf v\propto \dfrac{1}{p}}[/tex]
[tex]\\ \sf\longmapsto P_1V_1=P_2V_2[/tex]
[tex]\\ \sf\longmapsto P_2=\dfrac{P_1V_1}{V_2}[/tex]
[tex]\\ \sf\longmapsto P_2=\dfrac{2.8\times 1.5}{0.92}[/tex]
[tex]\\ \sf\longmapsto P_2=\dfrac{4.2}{0.92}[/tex]
[tex]\\ \sf\longmapsto P_2=4.56atm[/tex]
[tex]\\ \sf\longmapsto P_2\approx 4.6atm[/tex]
Answer:
[tex]\boxed {\boxed {\sf 4.6 \ atm}}[/tex]
Explanation:
We are asked to find the new pressure given a change in volume. We will use Boyle's Law, which states the volume of a gas is inversely proportional to the pressure. The formula for this law is:
[tex]P_1V_1= P_2V_2[/tex]
Initially, the gas occupies 1.5 liters at a pressure of 2.8 atmospheres.
[tex]1.5 \ L * 2.8 \ atm = P_2V_2[/tex]
The volume is changed to 0.92 liters, but the pressure is unknown.
[tex]1.5 \ L * 2.8 \ atm = P_2* 0.92 \ L[/tex]
We are solving for the final pressure, so we must isolate the variable P₂. It is being multiplied by 0.92 liters. The inverse operation of multiplication is division, so we divide both sides by 0.92 L.
[tex]\frac {1.5 \ L * 2.8 \ atm}{0.92 \ L} = \frac{P_2* 0.92 \ L}{0.92 \ L}[/tex]
[tex]\frac {1.5 \ L * 2.8 \ atm}{0.92 \ L}= P_2[/tex]
The units of liters cancel each other out.
[tex]\frac {1.5 * 2.8 \ atm}{0.92 }=P_2[/tex]
[tex]\frac {4.2}{0.92} \ atm= P_2[/tex]
[tex]4.565217391 \ atm = P_2[/tex]
The original measurements of pressure and volume have 2 significant figures, so our answer must have the same. For the number we calculated, that is the tenths place. The 6 in the hundredth place tells us to round the 5 up to a 6.
[tex]4.6 \ atm \approx P_2[/tex]
The pressure is approximately 4.6 atmospheres.
how many atoms of hydrogen and oxygen are present in 5 gm of HNO3
ANSWER: note the amounts of atoms of all the component in HNO3, which are 1 atom of hydrogen, 1 atom of nitrogen and 3 atom of oxygen.
Compared to an atom of C-12, an atom of C-14 has
A) fewer protons
C) more neutrons
B) fewer neutrons
D) more protons
Explanation:
Carbon-12 atoms have stable nuclei because of the 1:1 ratio of protons and neutrons.
Carbon-14 atoms have nuclei which are unstable. C-14 atoms will undergo alpha decay and produce atoms of N-14. Carbon-14 dating can be used to determine the age of artifacts which are not more than 50,000 years old.
Sodium ethoxides are made by direct reaction of:
a. Sodium hydroxide and dry ethanol
b. Sodium metal and 70% ethanol
c. Sodium hydroxide and 70% ethanol
d. Sodium metal and dry ethanol
Answer:c
Explanation:
In water, a substance that ionizes completely in solution is called a
Answer:
please mark me brainliest
Explanation:
In water, a substance that ionizes completely in solution is called a weak electrolyte.
Answer: strong electrolyte.
Explanation: In water, a substance that ionizes completely in solution is called a. a. weak electrolyte.
In the reaction A + B + C + D, what are the reactants?
O A. Just B
B. Cand D
O c. A and B
O D. A and C
Answer:
C.
Explanation:
I believe that it should be A and B.
The reaction between NO2 and co to produce no and CO2 is thought to occur in two steps:
Step 1: NO2 + NO2 → + NO + NO3
Step 2: NO3 + CO → NO2 + CO2
The experimental rate law is rate = k[NO2]2.
Required:
a. Write the equation for the overall reaction. do not include phase abbreviations.
b. Identify the intermediate(s).
Answer:
Correct option is
A
Explanation:
The number of molecules of CO involves in the slowest step will be 0 because CO is not involve in the slowest step i.e. rate determing step.
Calculate the mass of naphthalene required to react stoichiometrically with the moles of 2-bromo-2-methylpropane that you have placed in the flask. Dispense that quantity of naphthalene into the weighing dish. There is some imprecision in delivering the powder onto the weigh boat, but a mass within 0.040 g of the calculated stoichiometric quantity will be sufficient for this experiment. Note that you can use a combination of the 1 g and the 0.1 g buttons to add the required mass. If you overshoot the goal, you can discard the weighing boat and get a new one. RECord the sample mass dispensed below. mass of naphthalene (g)
The reaction of 2-bromo-2-methylpropane and naphthalene is stoichiometrically in a mole ratio of 1:1.
Notice that in the question, the moles of 2-bromo-2-methylpropane placed in the flask wasn't mentioned. if I assume that it was 1.24 moles then;
1 mole of naphthalene reacts with 1 mole of 2-bromo-2-methylpropane
x moles of naphthalene reacts with 1.24 mole of 2-bromo-2-methylpropane
x = 1 * 1.24/1
= 1.24 moles of naphthalene
Molar mass of naphthalene = 128.2 g/mol
Mass of naphthalene = 128.2 g/mol * 1.24 moles of naphthalene
Mass of naphthalene =159 g
For more about how to solve stoichiometry problems:
https://brainly.com/question/1309057
Given the reactants of the chemical reaction that will take place in Part D (construction of a lead concentration cell) prior to the assembly of the cell, determine the type of chemical reaction it is. Hint: Determine the products of the reaction.
Answer:
hi
Explanation:
What is the Equation of Reduction in Mg+F2 gives MgF2, I WILL MARK YOU AS BRAINLIST
Answer:
Mg+F2= Mgf2
Explanation:
F 2 is an oxidizing agent, Mg is a reducing agent. ; Pale-yellow to greenish gas with a pungent, irritating odor.
What is the mass grams that are in 3.52 × 10²⁵ molecules of I₂
Answer:
As you know, one mole of any substance contains exactly
6.022
⋅
10
23
molecules of that substance - this is known as Avogadro's number.
Notice that you're dealing with more than
6.022
⋅
10
23
molecules of carbon dioxide, which means that you'll also be dealing with more than one mole of the compound.
More specifically, you'll have
1.5
⋅
10
26
molecules
⋅
1 mole CO
2
6.022
⋅
10
23
molecules
=
2.491
⋅
10
2
moles CO
2
Now, a substance's molar mass tells what the mass of one mole of that substance is. In carbon dioxide's case, its molar mass is equal to
44.01 g/mol
, which means that every mole of
CO
2
will have a mass of
44.01 g
.
In your case,
2.491
⋅
10
2
moles of
CO
2
would have a mass of
2.491
⋅
10
2
moles CO
2
⋅
44.01 g
1
mole CO
2
=
109.63 g
Rounded to two sig figs, the number of sig figs you have for the number of molecules of
CO
2
, the answer will be
m
C
O
2
=
110 g
Convert the concentration of 0.700 M Na2SO4 to g/mol
To convert from mass concentration to molar concentration we use the formula;
Mass concentration = molar concentration * molar mass
Molar concentration of Na2SO4 = 0.700 M
Molar mass of Na2SO4 = 2(23) + 32 + 4(16) = 142 gmol-1
Hence;
Mass concentration = 0.700 M * 142 gmol-1
Mass concentration = 99.4 g/mol
To know more about concentration, see
https://brainly.com/question/23437000
ort
Which is a primary alcohol?
0 3-pentanol
2-propanol
1-ethanol
4-octanol
urvey
Lig A Moving to another question will save this response.
Answer:
1 ethanol is right answer
Explanation:
CH3- CH2-OH
How many shapes contains the same text: KTKEIHLPEQMKJAPDEK
In this figure, four shapes contains the same text as in the red oval. The text given in the red oval is KTKEIHLPEQMKJAPDEK.
What is shape?Shape is "the form of an object or its outline, outer boundary or outer surface".
What is text?Text is "a collection of words or letters that are understandable by the reader".
What is an oval?Oval is a rounded and slightly elongated outline or shape like that of an egg.
Hence, four shapes contains the same text as in the red oval.
To learn more about oval here
https://brainly.com/question/24323155
#SPJ2
Which of the following is an example of a scientific theory?
Matter can be neither created nor destroyed.
Force equals mass times acceleration.
Matter behaves the way it does because it is made of atoms.
There is probably life on Mars.
C. Matter behaves the way it does because it is made of atoms.
Answer:
Matter can neither be created nor destroyed
Explanation:
Mark me. as brainliest
Heating water makes most solids in it
soluble, and it makes gases
soluble.
Increasing the pressure on a gas above water makes the gas
soluble. Compounds with comparatively stronger ionic bonds are
soluble.
Answer:
1. more
2. less
3. more
4. less
Explanation:
1. Consider the following thermochemical reaction for kerosene:
2 C12H26(l) + 37 O2(g) 24 CO2(g) + 26 H2O(l) + 15,026 kJ
(a) When 21.3 g of CO2 are made, how much heat is released?
(b) If 500.00 kJ of heat are released by the reaction, how grams of C12H26 must have been consumed ?
(c) If this reaction were being used to generate heat, how many grams of C12H26 would have to be reacted to generate
enough heat to raise the temperature of 750g of liquid water from 10oC to 90oC?
2. Consider the reaction: NaNO3(s) + H2SO4(l) → NaHSO4(s) + HNO3(g) ΔH° = 21.2 kJ
How much heat must absorbed by the reaction system to convert 100g of NaNO3 into NaHSO4(s)?
3. What is the enthalpy change when 49.4 mL of 0.430 M sulfuric acid reacts with 23.3 mL of 0.309 M potassium
hydroxide?
3.
H2SO4(aq) + 2KOH(aq) → K2SO4(aq) + 2H2O(l) ΔH° = –111.6 kJ/mol
do you have the specific heat for part 2?
What best describes the goals of scientific investigation and technological development?
Both scientific investigation and technological design aim to solve problems by making more cost-effective and affordable products.
Both scientific investigation and technological design aim to conduct experiments to uncover new information and share the results.
Scientific investigation aims to design products that can make use of new information, whereas technological development aims to conduct experiments to improve affordability and availability.
Scientific investigation aims to design and implement an experiment to learn new information, whereas technological development aims to design a product to solve a problem.
Answer: D. Scientific investigation aims to design and implement an experiment to learn new information, whereas technological development aims to design a product to solve a problem.
Explanation:
Gimme the sandmeyer's reaction!!!
Explanation:
HERE IS YOUR ANSWER.....
The surface of silver metal, Ag(s), became tarnished when it was exposed to oxygen, producing Ag2O. In Ag2O, the oxidation state of silver is 1. According to this information, silver metal was _____. Please choose the correct answer from the following choices, and then select the submit answer button. Answer choices reduced
Answer: The silver metal was OXIDIZED.
Explanation:
OXIDATION is defined as loss of electrons and increase in oxidation number of an atom.
Oxidation number is the charge on an ion in an ionic compound or the charge that an atom in a covalent compound would have it it were ionic. There are basic rules governing oxidation number, they include:
--> the oxidation number of elements in their free states is ZERO. Example O2, Cl2,Na, Al, Ag.
-->The oxidation number for an ion is the same as the size and sign of the charge on the ion. For example the oxidation number of Zn2+ is +2.
--> the sum of all the oxidation numbers of the elements in a compound is zero.
--> oxidation numbers are always written with either a positive or a negative sign.
On the other hand, reduction is the opposite of oxidation. As oxidation is taking place, reduction is also taking place. Reduction involves:
--> Gain of electron and
--> decrease in oxidation number
From the question, the silver metal had ZERO as it's oxidation number because it's in free state. After being exposed to oxygen to form silver oxide, the oxidation number became +1.
Since there is an increase in the oxidation number, the silver metal was OXIDIZED
Determine the number of hydrogen atoms connected to each carbon atom: The bond-line structure of a compound has a SMILES string of CC1CCN(CC1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N. All the carbon atoms of the compound are highlighted and labeled a through p.
Answer:
dsgsdfd
Explanation:
Help please due tomorrow
Answer:
3rd option - humans chose the potential parents for crosses based on desired characteristics.
Explanation:
Artificial selection is the identification by humans of desirable traits in plants and animals, and the steps taken to enhance and perpetuate those traits in future generations.
PLEASE HELP!!
this is on USAtestprep
a)
b)
c)
d)
Draw Lewis structures to show how H+ is transferred when HNO₂ and NH₃ react with each other. The Lewis structure of HNO₂ is:
Attached are the Lewis structures:
Hope it helps...
[tex] \: \: \: [/tex]
cuales son las caracteristicas de el livermorio
Answer:
Livermorium is a radioactive, artificially produced element about which little is known. It is expected to be a solid and classified as a metal. It is a member of the chalcogen group. Livermorium has four isotopes with known half-lives, all of which decay through alpha decay
