what will happen when a wax candle burned in air with limited oxygen?​

Answers

Answer 1

Answer:

The molecules of carbon dioxide are heavier than air. When a result, as they descend over the flame and candle, they push the oxygen and other air molecules out of the path. The oxygen can no longer react with the wax when it is pushed away from the wick. The flame is put out as a result.

Answer 2

Answer:

if the candle is burned in air with limited oxygen supply the candle will go out of fire as the oxygen is reducing....

Explanation:

Hope It Helps!!!


Related Questions

what can we use to help us predict the results of reaction when we put metals into competition?

Answers

The activity series of metals as well as the electrode potential of metals can be used to compare the reactivity of metals.

What is used in comparing reactivity of metals?

The reactivity of metals can be compared using their electrode potentials which is a measures of the ability of the metal to donate electrons to another metal.

When comparing the reactivity of metals, the metal with the lesser negative electrode potential will be more reactive than another with a greater negative or positive electrode potential.

Therefore, the activity series of metals as well as the electrode potential of metals can be used to compare the reactivity of metals.

Learn more about activity series of metals at: https://brainly.com/question/17469010

#SPJ12

A 126.1-gram block of granite at 92.6°c is dropped into a tub of water at 24.7°c in an isolated system. the final temperature of both the granite and the water is 51.9°c. the specific heat capacity of granite is 0.795 joules/gram degree celsius, and the specific heat capacity of water is 4.186 joules/gram degree celsius. the granite block transferred of energy, and the mass of the water is .

Answers

The granite block transferred 4,080 joules of energy, and the mass of the water is 35.8 grams.

How we calculate heat transfer of any system ?

Heat transfer in any system can be calculated as follow:

q = mCΔT

Given ;

m = mass of granite = 126.1 g C = specific heat of granite = 0.795 joules/gram degree CelsiusΔT = change in temperature of granite = 51.9 °C - 92.6 °C = -40.7 °C

Putting all the values in folowing equation,

q = mCΔT

we get

q = 126.1 × 0.795 × -40.7 = -4080 J

Now by using same formula, we can also calculate the mass of water in the following way:

m = q / CΔT

where

C = specific heat of water = 4.186 joules/gram degree Celsius ΔT = change in temperature of water = 51.9 °C – 24.7 °C = 27.2 °C

Putting all these values ;

m = -4080 /  4.186 × 27.2 = 35.8 g.

Hence, 4,080 joules of energy is transferred by granite block and 35.8 g is the mass of water.

To learn more about heat transfer here ;

brainly.com/question/18980657

#SPJ1

What would cause a nucleus to be unstable?
A. An unequal number of protons and electrons
B. Too few quarks within the nucleus of the atom
C. An equal number of protons and neutrons
D. An imbalance between the electrostatic and strong nuclear forces
SUBMIT

Answers

D

I don’t know how to explain it, but when there are 8 outermost outer nuclear electrons, it’s the most stable time, lose e- will make it unstable

The instability of the nucleus is due to an imbalance between the electrostatic and strong nuclear forces, which is option D.

A nucleus can become unstable if there is an imbalance between the electrostatic repulsion between protons and the strong nuclear force that holds the nucleus together. The electrostatic repulsion between protons tends to push them apart, while the strong nuclear force acts to hold the protons and neutrons together.

If the number of protons in the nucleus is too large, the electrostatic repulsion becomes stronger, making the nucleus unstable. Similarly, if the number of neutrons is too large or too small compared to the number of protons, it can also lead to an imbalance in the forces and instability of the nucleus.

Therefore, the correct option is option d.

Learn more about the nucleus here:

https://brainly.com/question/11801308

#SPJ 7

Which type of electromagnetic wave has less energy than a microwave?
OA. Ultraviolet wave
OB. Radio wave
O C. An X-ray
OD. Infrared wave

Answers

Radio waves.

From lowest to highest it is radio wave, microwave, infrared, visible light, ultraviolet, x ray, and then gamma.

An educated guess which explains observations is called:  

a a law  
b an experiment
 c a hypothesis  
d a variable​

Answers

The answer is C. a hypothesis

Answer:

c. a hypothesis  is the correct answer

Explanation:

How can i calculate the concentration of 2.357g of sodium chloride in 75ml solution

Answers

Answer:

See below

Explanation:

Simply :    2.357 g / 75 ml = .03142  gm/ml   or  31.42  gm / liter

An exergonic reaction __________ free energy, and an endergonic reaction __________ free energy.

Answers

Answer:

An exergonic reaction releases free energy, and an endergonic reaction absorbs free energy.

Explanation:

hope it helps

There are 8.421 g of dry ZnSO4 and
6.579 g H₂O in the sample.

Step 2: Determine the moles of water and anhydrous compound.

Zn = 65.38 g/mol, S = 32.07 g/mol,
H = 1.01 g/mol, O = 16.00 g/mol

How many moles of ZnSO4 are present?

[?] mol ZnSO4

Answers

The number of moles of H₂O is  0.36 mol.

The number of moles of LiClO₄ is  0.0521  mol.

What are moles?

Mole is an important standard unit used for the measurement of large quantities of atoms, molecules, or other particles. One mole is equal to 6.022×10²³ units.

The number of moles of a substance is calculated by:

Moles =[tex]\frac{mass}{molar \;mass}[/tex]

To find the number of moles of H₂O:

Mass of H₂O in the sample = 6.579 g

The molecular weight of H₂O = 18.02g

Moles = [tex]\frac{mass}{molar \;mass}[/tex]

Moles = [tex]\frac{6.579 g}{18.02g}[/tex]

Moles = 0.36

To find the number of moles of [tex]ZnSO_4[/tex]:

Mass of [tex]ZnSO_4[/tex] in the sample = 8.421 g

The molecular weight of [tex]ZnSO_4[/tex]= 161.47 g/mol

Moles =[tex]\frac{mass}{molar \;mass}[/tex]

Moles = [tex]\frac{8.421 g}{161.47 g/mol}[/tex]

Moles = 0.0521 moles

Learn more about moles here:

https://brainly.com/question/8455949

#SPJ1

Grams in 1.083e+24
Molecules Na BR


Please help explain why

Answers

Answer:

185 gms o NaBr

Explanation:

Na Br  mole weight = 22.989 +79.904 = 102.893  gm/mole

1.083 x 10^24  molecules / 6.022 x 10^23 molecules / mole = 1.798 moles

102.893  *  1.798 = 185 gms

In 2007, the population of Canada was 1.26 × 108, the population of Mexico was 10.6 × 107, the population of Brazil was 13.6 × 107, and the population of China was 1.86 × 109. Which two countries have the highest population?

A. Canada and China
B. Mexico and China
C. China and Brazil
D. Brazil and Mexico

Answers

A do full go do by Gn no inns shoveling foreclosure

A 35. 0-l steel tank at 20. 0?c contains acetylene gas, c2h2, at a pressure of 1. 39 atm. Assuming ideal behavior, how many grams of acetylene are in the tank?.

Answers

52.66 grams of acetylene are in the tank.

PV=nRT is the formula for ideal gases, where P is the pressure and R is the constant and T is the temperature (P is 1.39 atm in this case)

Volume = 35.0 L

Gas constant = 0.08206 L.atm/K.mole

Temperature = 20.0 °C  = 293 °C

We also know that we can apply the formula ;

Number of mole(n) = [tex]\frac{MmPV}{RT}[/tex]

m = ( 26.04 × 1.39 × 35 )/ (0.08206 × 293.15)

m = 52.66 g

Thus, the mass is 52.66 grams.

Learn more about ideal gases here:

https://brainly.com/question/12281987

#SPJ4

1s22s²2p63s23p64s²3d104p5
Which element is this?

Answers

Answer: bromine

Explanation:

There are a total of 2+2+6+2+6+2+10+5=35 electrons, meaning there are 35 protons. The element with atomic number 35 is bromine

lighting is more likely to strike a metal tower than a rubber hose because:
A. metal is a conductor and rubber is an insulator
B. the light from the tower attracts the electrons
C. the tower is negatively charged and will accept electrons
D. metal is an insulator and subnet is a conductor

Answers

A. Metal is a conductor and rubber is an insulator

Please check the photo! I will award brainliest ONLY FOR PERSON WHO GIVES A LEGITIMATE ANSWER!!! Thank you :)

Answers

From the calculations, the percentage of the mineral left is 6.25%.

What is half life?

The term half life refers to the time that it takes for only half of the number of radioactive isotopes to remain.

From;

N/No = (0.5)^t/t1/2

N = ?

No = ??

t = 2000

t1/2 = 500

N/No =(0.5)^(2000/500)

N/No = 0.0625

Thus the percent left = 0.0625 * 100 = 6.25%

Learn more about half life of a nucleus:https://brainly.com/question/23518766

#SPJ1

The cutoff frequency for a certain element is 1.22 x 1015 Hz. What is its work function in eV?
Hint: 1 eV 1.60 x 10-19 J
=[?] eV

someone please teach me how to solve this its gonna make me cry

Answers

The work function of the metal is obtained as 5.1 eV

What is the cutoff frequency?

The cutoff frequency is the frequency below which photo electric effect can not occur as electrons are not removed from the metal surface.

Now;

fo = 1.22 x 10^15 Hz

Wo = hfo

Wo = 6.6 * 10^-34 * 1.22 x 10^15

Wo = 8.1 * 10^-19 J

If 1 eV = 1.60 x 10-19 J

x eV = 8.1 * 10^-19 J

x = 8.1 * 10^-19/ 1.60 x 10-19

x = 5.1 eV

Learn more about cutoff frequency:https://brainly.com/question/14378802

#SPJ1

What is the mass in grams of 4.85 x 10^22 Al atoms? (Report your answer to two places past the decimal

Answers

Answer:

2.17 gm Al

Explanation:

First, find the number of moles .   Then multiply by the mole weight of aluminum.

# moles =   4.85 x 10^22 / 6.022 x 10^23 = .08053 moles

.0805 moles * 26.981 gm/mole  = 2.173 gm

Compare
Ion and Radical
Atom and molecule
Organic and inorganic compounds

Answers

Answer:

'An ion has a non-zero electric charge. A radical has an atom with unfilled electron shells and so is very reactive, but is electrically neutral.'

'Atoms are single neutral particles. Molecules are neutral particles made of two or more atoms bonded together.'

'The primary difference that lies between these organic compounds and inorganic compounds is that organic compounds always have a carbon atom while most of the inorganic compounds do not contain the carbon atom in them.'

Organic and inorganic compounds:

Similarities:::---

1) In both organic and inorganic compound, the elements joining in making compound complete their octet.

2) Organic compound shows isomerism (R/S , E/Z , cis/trans, enantiomers, diastereomers, etc), just as inorganic compound do (Δ/Λ, enantiomers, R/S enantiomers, cis/trans, fac/mer isomers, etc).

3) Organic compound and inorganic compounds can be very active in chemical reactions, e.g. organolithium reagents could be flammable or even pyrophoric (generally stored under 10°C), while inorganic reagents like in this paper are quite rapid...

Differences:::---

1) Organic compound are very long in size so they can make polymer but inorganic compound are not very long but its structure might me complex.

2) The boiling,melting point of organic compound is lass than inorganic compound.

3) Organic compound always contains carbon but inorganic compounds might not.

4) Organic compound

_____________________________

Ion and Radical Atoms:

In some sense they are a bit similar. The main difference is that a neutral radical has no charge imbalance between the protons and electrons, but the cation or anion does.

Ions are written with an explicit charge because of that charge imbalance, but radicals may or may not have an imbalance of charge. Just because a molecule is a radical doesn't mean it's neutral.

For example, if you shoot 2-pentanone with an electron beam for Electron "Impact" Mass Spectroscopy, where you essentially study molecules whose structures break into smaller pieces as a result of interacting with stray electrons to identify the molecules, you get a cationic radical (middle, or far right of the following diagram).

What kind of air mass will bring cold, dry weather as it moves toward an area

Answers

Answer:

i think the answer is Continental polar air masses

Explanation:

3.the three major types of radioactive decay of an unstable nucleus are alpha particles, beta particles, and gamma rays.

explain how alpha decay works and how it causes a transmutation. be sure to note all changes to the nucleus in your explanation.


write the equation for the alpha decay of uranium-234.


explain how beta decay works and how it causes a transmutation. be sure to include all changes to the nucleus in your explanation.


write the equation for the beta decay of iodine-131.

Answers

a) Alpha decay occurs when an unstable nuclide emits an alpha particle, (which is just a helium-4 atom), which contains 2 protons and 4 neutrons. This means that transmutation has occurred (since a nuclide of a different element will be produced), and this newly produced nuclide will have 2 fewer protons and 4 fewer neutrons than the original nuclide.

b) [tex]^{234}_{92} \text{U} \longrightarrow ^{4}_{2} \text{He}+^{230}_{90} \text{Th}[/tex]

c) Alpha decay occurs when an unstable nuclide emits a beta particle, (also known as an electron). This causes transmutation (since a nuclide of a different element will be produced), and this newly produced nuclide will have 1 more proton than the original nuclide.

d) [tex]^{131}_{53} \text{I} \longrightarrow ^{0}_{-1} \beta+^{131}_{54} \text{Xe}[/tex]

It is the year 2040, and you are a research scientist. The amount of sunlight that reaches the earth has been drastically reduced due to a major event like pollution, fires, or volcanoes. Farmers are asking you for help to save their failing crops.

Answers

hhfgbuugucviibygtvhgyvybubbiinubuvycyuj

Which best explains why a firework being ignited is an example of an exothermic reaction and not an endothermic
reaction ?
O The fireworks produce colors.
O The fireworks give off heat.
O Igniting the fireworks requires energy.
O Igniting the fireworks makes an odor.

Answers

the fireworks give off heat

The best explanation for why a firework being ignited is an example of an exothermic reaction and not an endothermic reaction is:

The fireworks give off heat.

Heat is emitted into the environment in an exothermic reaction. When a firework is lit, it undergoes a number of chemical processes inside the firework combination, which produces gases and produces a great deal of heat. Fireworks' distinctive visual display and audible effects are produced when heat is released as light and sound.

In contrast, heat is taken from the environment during an endothermic reaction. If a reaction were endothermic, it would need an outside energy source to continue, and because it would be absorbing heat from its environment, it would feel chilly to the touch.

However, because they release heat and energy and brighten the night sky, fireworks are instances of exothermic reactions.

To know more about heat:

https://brainly.com/question/32136211

#SPJ2

How many atoms are present in 2.1 moles of Fe

Answers

Answer:

1.3 x 10²⁴ atoms Fe

Explanation:

To convert moles to atoms, you need to multiply your given value by Avogadro's Number. This causes the conversion to occur because Avogadro's Number exists as a ratio. It is the ratio that allows for the cancellation of units during multiplication. This is why atoms should be in the numerator of your conversion. The final answer should have 2 sig figs to reflect the given value.

Avogadro's Number:

1 mole = 6.022 x 10²³ atoms

2.1 moles Fe          6.022 x 10²³ atoms
---------------------  x  -------------------------------  =  1.3 x 10²⁴ atoms Fe
                                        1 mole

what is the approximate distance from the far edge of one lobe to the far edge of the other?

Answers

The approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.

What is distance between far edge of  two lobes in solar system?

This distance measures the outer space between the edges of the two lobes in a given time.

The approximate distance from the far edge of one lobe to the far edge of the other in a solar system is about 2,100,000 light-years.

Thus, the approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.

Learn more about distance here: https://brainly.com/question/2854969

#SPJ11

A 2. 75-l container filled with co2 gas at 25°c and 225 kpa pressure springs a leak. When the container is re-sealed, the pressure is 185 kpa and the temperature is 10°c. How many moles of gas were lost?.

Answers

Answer:

Moles Lost = 0.0335 moles

Explanation:

This type of question requires the Ideal Gas Law equation. The equation looks like this:

PV = nRT

In this formula,

-----> P = pressure (kPa)

-----> V = volume (L)

-----> n = number of moles

-----> R = constant (8.314 L*kPa/mol*K)

-----> T = temperature (K)

(Step 1)

To find how many moles were lost, you first need to find how many moles you had to begin with. This can be done by plugging the starting values into the equation and solving for "n". But first, you need to convert Celsius to Kelvin (by adding 273.15).

P = 225 kPa                  R = 8.314 L*kPa/mol*K

V = 2.75 L                     T = 25°C + 273.15 = 298.15 K

n = ?

PV = nRT

(225 kPa)(2.75 L) = n(8.314 L*kPa/mol*K)(298.15 K)

618.75 = n(2478.8191)

0.250 = n

(Step 2)

Next, you need to find the number of moles in the container after it has been re-sealed. The volume is the same because the container did not change. The process should be the same as above.

P = 185 kPa                   R = 8.314 L*kPa/mol*K

V = 2.75 L                     T = 10°C + 273.15 = 283.15 K

n = ?

PV = nRT

(185 kPa)(2.75 L) = n(8.314 L*kPa/mol*K)(283.15 K)

508.75 = n(2354.1091)

0.216 = n

(Step 3)

Finally, you can find the number of moles lost by subtracting the final amount of moles from the original amount. When doing this calculation, I used the value of the moles saved in my calculator (with more decimal places) to get a more accurate number.

Moles Lost = Initial Moles - Final Moles

Moles Lost = 0.250 moles - 0.216 moles

Moles Lost = 0.0335 moles

Which of the following species of fish have cartilaginous skeletons?

Answers

You can attach a picture so I can help you

Answer:

sharks have cartilaginous skeletons

Explanation:

Sharks are an example

What conditions make AG always positive?

Answers

Answer: when a reaction absorbs heat or decreases the entropy of the system,

Explanation: :)

Only certified electricians are allowed to work on facility electrical system?

Answers

No that is incorrect definitely

Which phrase describes a homogeneous catalyst?

Answers

Answer:

It is in the same phase as the reactants.

Explanation:

i took the test

Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please

Answers

Answer:

1-bromo-6-chloro-5-methylheptane

Explanation:

There are 3 substituents, 1 chlorine, 1 bromine, and 1 methyl group.

The longest carbon chain consists of 7 carbons.

There are no double bonds, based on the saturation and substituents.

So you have a 1-bromo-6-chloro-5-methylheptane.

Hope that was the brainliest answer!

The AP Biology teacher is measuring out 638.0 g of dextrose (C6H12O6) for a lab. How many moles of dextrose is this equivalent to?

Answers

The AP Biology teacher is measuring out 638.0 g of dextrose (C6H12O6) for a lab the moles of dextrose is this equivalent to is 3.6888 moles.

What are moles?

A mole is described as 6.02214076 × 1023 of a few chemical unit, be it atoms, molecules, ions, or others. The mole is a handy unit to apply due to the tremendous variety of atoms, molecules, or others in any substance.

To calculate molar equivalents for every reagent, divide the moles of that reagent through the moles of the restricting reagent. The calculation is follows:

655/12 x 6 + 12+ 16 x 6 = 655/ 180 = 3.6888 moles.

Read more about moles:

https://brainly.com/question/24322641

#SPJ1

Other Questions
Question 3(Multiple Choice Worth 5 points)(06.03 LC)Determine the equation of the graph, and select the correct answer below.(-1, 3) X+1/2y=5 What is the rate of change of y with respect to x? Translate each description into an algebraic expression. Then, evaluate the expressionusing the value shown in the box for the variable.EXAMPLE: the quotient of 112 and a added to 25 = (112 + a) + 25 = 53a = 4w = 10b=3x = 11c = 9y = 7 d=2z = 51. the difference of 100 and the product of y and 12 =2. b times the sum of 15 and 37 =3. 27 added to the product of z and 12 =4. 135 divided by the product of c and 5 =5. w to the second power times the quotient of 12 and 4 =6. 12 times d divided by the difference of 25 and 19 =7. the product of x and 5 added to 13 = The heights of adult men in the united states are approximately normally distributed with a mean of 70 inches and a standard deviation of 3 inches. use this information together with the 68-95-99.7 rule to make three statements about the height of adult men in the united states. Question 1(Multiple Choice Worth 6 points) (LC) A Brief Study of Guts You may not know this, but you are home to a colony of bacteria. You may also not know it, but the health and happiness of that colony of bacteria have a direct effect on your own health and happiness. In short, if we are what we eat, then we may need to make bacteria part of our balanced breakfast. Microbes are single-celled organisms. They are literally everywhere. Microbes are in the air we breathe, on the surfaces of everything we touch, and inside our bodies. Microbes can be bacteria, fungi, protozoa, or viruses. A few years ago, scientists began studying the microbial life of our stomachs. Called The American Gut project, this study aims to understand the life of the bacteria that live in our digestive system. According to an article in the New York Times by Michael Pollan, the goal is to gather information on the types and amounts of bacteria in the human gut. Scientists want to describe what a normal healthy microbe and human relationship should look like inside our digestive system. While the research is still in the very early stages, scientists have learned the following: The strongest and healthiest microbe systems are those with a lot of variety. The guts of Americans have much less variety than the guts of other populations. Diets that include a lot of processed foods support less variation in bacteria. Studying the makeup of our individual bacteria communities will help scientists get a better idea of which bacteria help human bodies. We used to think that bacteria in our bodies were invaders. This new research suggests that bacteria are part of the protective army that keeps us healthy. In fact, our bodies have a hard time recovering from medicines like antibiotics because they disrupt the balance of helpful bacteria. It seems clear from the early evidence that living with bacteria helps us resist invasion from things that make us sick. Scientists have also learned that microbes might help our guts do things like process v Put each verb in brackets into either the present perfect, past simple or present simple.5 points1. I (never eat)2. I (hope).3. Recently a lot of young people (take up).4. When we (reach)..some squid.octopus, but once on holiday I (eat)you aren't a vegetarian. I (cook)you some lamb chops.Any tickets left.the cinema, there (not be)kite surfing. What is an advantage of using renewable energy resources?A. They can be converted directly into electric energy.B. They do not waste energy in heat.C. They can be replenished in a human lifetime.D. They do not produce greenhouse gases. Credit was made much more available through the installment plan, margin buying and other methods during the 1920s. Which of the following was true regarding the easy availability of credit?Select one:a.The installment plan made it more difficult for people to buy goods that they could not afford.b.Americans were not interested in taking advantage of these new opportunities and continued to live within their means.c.The availability of credit had little economic impact.d.Many people, businesses and investors spent beyond what they could afford which had negative effects on the economy. the cheap foreign ______ argument says that trade protection is required to ensure that cheap imports do not flood u.s. markets, dragging down prices of goods and u.s. wages. (11-8)x3+7+27-3(183)+6+(14-8)x5(11-7)x6+4+32-4 What will most likely happen if a person does not consume the minimum daily requirement of carbohydrates? Need help with this geometry question The New England Primer was the standard text throughout the colonial period. true or false Having curved or straight thumbs is thought to be a Mendelian trait, and thestraight allele is thought by many geneticists to be dominant. Assuming this iscorrect, how would you expect the thumbs of someone with two curved-thumballeles to look? which best explains why music moved across international lines between 1945 and 1963? A study of 5,000 participants from dozens of countries found that when ostracized during a Web-based game, players were ________ to conform to others' incorrect judgments. A chain of length L has a mass of m which is uniformly distributed. When it is placed on a smooth horizontal table, 1/4 of its length hangs over the edge of the table (as shown in the figure). Then the chain slides away from the table freely, how much gravitational potential energy has changed from the beginning to the chain just sliding away from the table? (The height of the table from the ground is much greater than L) Before opening night, the cast of Wicked put on a matinee and evening dress rehearsal at the Gershwin Theatre. At the Saturday matinee, 350 people attended the show. For the Saturday evening performance, 40% more people attended the performance. If the average cost of tickets was $182, how much money did the Gershwin Theatre collect from ticket sales of the Saturday performance? Given the functions below, find g(5) + h(2).g(x) = 2x - 5h(x) = 4x + 5 Groundwater Activity: Properties of Water Lab ReportIntroductionWater is an essential part of processes on Earth. In this lab, you will investigate the properties of water and explain how they affect Earth material and surface processes.Investigative Phenomenon: What are the connections between the properties of water and their effects on Earth materials and surface processes?Materials: water stopwatch a clean penny food coloring vegetable oil clear plastic cups dropper or pipette ice cube black pepper a bowl dish soap sponge or cloth a heating source (sunlight, lamp, etc.) or a cooling source (refrigerator) one balloon measuring tape or string and a ruler thermometerActivity One: Investigating CohesionCohesion is the ability of molecules to bind together. One way to test this is by investigating how the droplets of a particular liquid stick together compared to other liquids. Use the materials you have to determine waters relative cohesion on a particular surface.Describe the plan you will follow to determine this:Record your data and observations:Phenomena Reflective Question: How does the cohesive property of water come into play with it interacts with Earth materials?Activity Two: Investigating Surface Tension Surface tension is a property of a liquid that allows the surface to resist force. This means the surface of a liquid resists the weight of objects.Procedures:1. Fill a bowl full with tap water.2. Sprinkle about a teaspoon of ground black pepper in the bowl. DO NOT STIR! Observe what happens to the black pepper.3. Gently place your finger into the water and observe what happens.4. Put two drops of dish soap on your finger. Gently use your finger to touch the surface of the water and observe what happens.Data and observations: ObservationsBlack pepper in water Touching water without soap Touching water with soap Phenomena Reflective Question: How does the surface tension of water allow for it to interact with Earth materials?Activity Three: Investigating Solubility A liquid is polar, which means a substance can easily dissolve in it. How can you test waters polarity compared to other substances? To measure solubility, it is necessary to compare initial and final results using your visual observations.Describe the plan you will follow to determine this:Record your data and observations: Add food coloring to each liquid. Observe each reaction and record your observations in the table below. Time Water Vegetable Oil0 seconds 5 seconds 10 seconds 15 seconds 20 seconds Phenomena Reflective Question: Explain why water is called a universal solvent. How does this polarity allow for water to interact with Earth materials?Activity Four: Investigating Specific Heat CapacitySpecific heat is the amount of heat energy needed to change the temperature of 1 gram of the substance one degree Celsius. Some objects' specific heat allows them to heat up or cool down faster than others of equal mass. How can you compare waters specific heat to other substances? How does the specific heat of water affect how other objects, such as a damp cloth, warm up or cool down? To measure specific heat, it is necessary to compare initial and final results.Describe the plan you will follow to determine this:Record your data and observations: Observe the temperature of the damp sponge/cloth after being placed under a heat source. Caution: do not set the damp sponge or cloth to close to the heat source. Record your observations. Time Damp Sponge/Cloth0 seconds 5 seconds 10 seconds 15 seconds 20 seconds Phenomena Reflective Question: How does waters specific heat capacity come into play when it interacts with Earth materials or affect surface processes?Activity Five: Investigating Expansion and DensityDensity of an object can be found by calculating mass divided by volume. If two objects have the same mass, but one has a greater volume, the object with more volume is less dense. Does waters density change when it is frozen? Describe the plan you will follow to determine this:Record your data and observations:Phenomenon Reflective Question: Did the density of water change when it changed from solid to liquid? How do you think the density of water has an effect on Earth materials and surface processes?Evaluating the Design:Part of an investigation is to evaluation how well your investigation gave you the data you needed. In this report, include the following:1. an evaluation of the plan you made for the various activities and how the data was collected2. a description of how well the data allowed you to infer the effect of water on materials and processes in the world3. a description of how to further investigate the effects of water and collect more accurate and precise data