Answer:
60π
Step-by-step explanation:
circumference of a circle = 2πr, where r = radius
given r = 60 in
2πr = 2×π×60
= 60π
= 188.5 (rounded to the nearest tenth)
Subtract the complex numbers: (–2 + 12i) – (–1 – 9i)
Question 18 options:
A)
–3 + 21i
B)
–1 + 21i
C)
–1 + 3i
D)
–3 + 3i
Answer:
B
Step-by-step explanation:
hope it is well understood
The increase in length of an aluminum rod is twice the increase in length of an Invar rod with only a third of the temperature increase. Find the ratio of the lengths of the two rods.
Answer:
the ratio of lengths of the two rods, Aluminum to Invar is 11.27
Step-by-step explanation:
coefficient of linear expansion of aluminum, [tex]\alpha _{Al} = 23 \times 10^{-6} /K[/tex]
Coefficient of linear expansion of Invar, [tex]\alpha _{Iv} = 1.2 \times 10^{-6}/K[/tex]
Linear thermal expansion is given as;
[tex]\Delta L = L_0 \times \alpha\times \Delta T\\\\where;\\\\L_0 \ is \ the \ original \ length \ of \ the \ metal\\\\\Delta L \ is \ the \ increase \ in \ length[/tex]
The increase in length of Invar is given as;
[tex]\Delta L_{Iv} = L_0_{Iv} \times \alpha _{Iv}\times \Delta T_{Iv}[/tex]
The increase in length of the Aluminum;
[tex]\Delta L_{ Al} = L_0_{Al} \times \alpha _{Al} \times \Delta T_{Al}\\\\from \ the\ given \ question, \ the \ relationship \ between \ the \ rods \ is \ given \ as\\\\ L_0_{Al} \times \alpha _{Al} \times \frac{1}{3} \Delta T_{Iv}= 2( L_0_{Iv} \times \alpha _{Iv} \times \Delta T_{Iv})\\\\ L_0_{Al} \times \alpha _{Al} \times \Delta T_{Iv}= 6( L_0_{Iv} \times \alpha _{Iv} \times \Delta T_{Iv})\\\\ L_0_{Al} \times \alpha _{Al} \times \Delta T_{Iv} = 6L_0_{Iv} \times 6\alpha _{Iv} \times 6 \Delta T_{Iv}\\\\[/tex]
[tex]\frac{L_0_{Al}}{6L_0_{Iv} } = \frac{6\alpha _{Iv} \ \times \ 6 \Delta T_{Iv}}{\alpha _{Al} \ \times \ \Delta T_{Iv}} \\\\\frac{L_0_{Al}}{6L_0_{Iv} } = \frac{6\alpha _{Iv} \ \times \ 6}{\alpha _{Al} \ } \\\\\frac{L_0_{Al}}{L_0_{Iv} } = 6^3(\frac{\alpha _{Iv} }{\alpha _{Al} } )\\\\\frac{L_0_{Al}}{L_0_{Iv} } = 6^3(\frac{1.2 \times 10^{-6} }{23\times 10^{-6} } )\\\\\frac{L_0_{Al}}{L_0_{Iv} } = 6^3(\frac{1.2}{23} )\\\\\frac{L_0_{Al}}{L_0_{Iv} } = \frac{259.2}{23} \\\\\frac{L_0_{Al}}{L_0_{Iv} } = 11.27[/tex]
Therefore, the ratio of lengths of the two rods, Aluminum to Invar is 11.27
The ratio of the lengths of the two rods which is length of aluminum to length of Invar rod is; 11.27
Formula for linear thermal expansion is;
ΔL = L × α × ΔT
Where;
ΔL is change in original length
L is original length
α is coefficient of linear expansion
ΔT is change in temperature
We are told that increase in length of aluminum rod is twice the increase in length of an Invar rod with only a third of the temperature increase.
Thus;
ΔL = 2ΔL
ΔT for the aluminum rod = ⅓ΔT for the Invar rod.
Thus, we have;
L_al × α_al × ⅓ΔT = 2L_in × 2α_in × 2ΔT
ΔT will cancel out to give;
⅓(L_al × α_al) = 2L_in × 2α_in × 2
Multiply both sides by 3 to get;
(L_al × α_al) = 6L_in × 6α_in × 6
From online tables, the linear coefficient of expansion of aluminum is 23 × 10^(-6) C¯¹
While the coefficient of thermal expansion for Invar rod is 1.2 × 10^(-6) K¯¹
Thus;
L_al × 23 × 10^(-6) = 6L_in × (6 × 1.2 × 10^(-6)) × 6
L_al/L_in = (6 × 6 × 1.2 × 10^(-6) × 6)/(23 × 10^(-6))
L_al/L_in = 11.27
Read more on coefficient of linear expansion at; https://brainly.com/question/6985348
Find the length of AB
Since this is a right triangle, we can use one of the three main trigonometric functions: sine, cosine, or tangent.
Remember: SOH-CAH-TOA
Looking from the given angle, we know the opposite side and want to know the hypotenuse. Therefore, we should use the sine function.
sin(54) = 16/AB
AB = 16/sin(54)
AB = 19.78 units
Hope this helps!
Which of the following describes a positive correlation?
As the number of hours spent on homework increases, the tests scores increase.
As the number of apples eaten per year increases, the number of times visiting the doctor every year remains the same.
As the number of times going to bed early increases, the number of times waking up late decreases.
The amount of time a team spent practicing increases, the number of games lost in a season decreases.
THIS IS A MULTIPLE CHOICE QUESTION
Answer:
First Choice: As the number of hours spent on homework increases, the tests scores increase.
Step-by-step explanation:
The definition of a positive correlation is a relationship between two given variables, in which both variables are moving in the same direction. This can mean when one variable increases and the other variable increases, too, or one variable decreases and the other decreases as well.
The first choice is a positive correlation because both variables are changing (increasing) in the same direction. As you spend more time on homework, you're likely to get a higher test score.
The second choice cannot be a positive correlation because only one variable is having some kind of change (increasing). The doctor visits amount remains the same, so we can call this a zero-correlation relationship because the number of apples eaten yearly doesn't affect the amount of doctor visits. An apple a day keeps the doctor a way is just a proverb, not to be taken literally.
The third choice cannot be a positive correlation because the two variables are going different directions. Even though the number of times going to bed early is increasing, the number of times waking up late decreases, which is not moving in the same direction as the other variable.
The fourth choice cannot be a positive correlation because, similarly to the third choice, the two variables are going different directions. One variable is increasing, which is the amount of practice time. Meanwhile, the other variable is decreasing (going in the opposite direction), which is the number of games lost in a season.
Suppose X has an exponential distribution with mean equal to 16. Determine the following:
(a) P(x >10) (Round your answer to 3 decimal places.)
(b) P( >20) (Round your answer to 3 decimal places.)
(c) P(x < 30) (Round your answer to 3 decimal places.)
(d) Find the value of x such that P(X 〈 x) = 0.95. (Round your answer to 2 decimal places.)
In what quadrant would the triangle be if rotated 90 degrees
I strongly believe the answer is 2, if it isnt that it must be 3.
"Rotated around the origin", as the question actually says, puts it in Quadrant-II (2).
But the way you put the question, just saying the triangle is rotated 90°, leaves it right where it is, in Quadrant-I, with vertex-H on the bottom.
I NEED HELP PLEASE!!!
A researcher wants to better understand the health benefits of eating vegetables. In a study he finds 300 adults aged 45-60 who eat at least 3 servings of vegetables a day on average. He finds another 200 adults who eat less than 3 servings of vegetables a day on average. The researcher looks at rates of cancer and heart disease in each group and compares both groups. In another study, the researcher finds 500 adults aged 45-60 who eat less than 3 servings of vegetables a day on average, and are willing to participate in a study. The researcher randomly assigns 250 of these adults to a diet which includes 4 servings of vegetables a day. The other 250 continue their usual habits. After 4 years, the rates of cancer and heart disease between the two groups are compared
Identify the statement that correctly states the reason for considering the first study as an observational study and second study as an experiment.
a. In the first study, the treatment is not imposed on the subjects, whereas in the second study the treatment is imposed on the subjects.
b. In the first study, the treatment is not imposed on every subject, whereas in the second study the treatment is imposed on every subject.
c. In the first study, the subjects were not randomly chosen, whereas in the second study the subjects were randomly assigned.
Answer:
a. In first study, the treatment is not imposed on the subjects, whereas in the second study the treatment is imposed on subjects.
Step-by-step explanation:
In the first study, observation are made on 300 adults who eat 3 servings of vegetables a day on average. The second study has further intensified the research which imposed treatment on the subjects. The random samples of adults are observed in both studies.
find the area of the semi circle plss
Answer:
Step-by-step explanation:
Factor this polynomial expression.
3x^2 - 12x+ 12
A. (3x - 2)(x-6)
B. 3(x-2)(x + 2)
C. 3(x-2)(x-2)
D. 3(x + 2)(x + 2)
The problem solving plan identifies steps to organize your information. Which of the following answer choices are included in the steps to organize your information?
A. Organize the problem and find the question.
B. Solve the problem and change your strategy if necessary.
C. Write the facts, organize your thoughts and define your strategy.
D. Organize the steps and underline the question.
c.write the fact,organize your thoughts and define your strategy.
Answer:
c
Step-by-step explanation:
Hi! I'd appreciate it if you could help me on this question. The question I need help with is question 42. Thank you If you could help me!!
9514 1404 393
Answer:
19 hours
Step-by-step explanation:
Add up the numbers:
3×3.5 +2×2.0 +4.5 = 19
Jacob trains 19 hours per week.
is y=x^2 a proportional relationship?
is y=2+x a proportional relationship?
is y=2/x a proportional relationship?
is y=2x a proportional relationship?
Answer:
is y=x^2 a proportional relationship?
[tex]{ \sf{yes. \: constant \: of \: proportionality = 1}}[/tex]
is y=2+x a proportional relationship?
[tex]{ \sf{no. \: unless \: y \: is \: proportinal \: to \: (2 + x)}}[/tex]
is y=2/x a proportional relationship?
[tex]{ \sf{yes. \: where \: proportianality \: constant \: is \: 2}}[/tex]
is y=2x a proportional relationship?
[tex]{ \sf{yeah. \: constant \: is \: 2}}[/tex]
x^ 3 +x^ 2 +4x/x^ 2 +x-2
into partial
fractions
Answer:
x + (4/ x-2) + (2/ x-1)
Step-by-step explanation:
x + (6x/ x^2 + 2x - x -2)
x + (6x/ (x + 2) X (x - 1))
(6x/ (x + 2) X (x - 1))
(A/ x+2) + (B/ x-1)
(6x/ (x + 2) X (x - 1)) = (A/ x+2) + (B/ x-1)
6x = Ax + Bx - A + 2B
6x = (A+B)x + (-A+2b)
{0 = -A+2B
{6 = A+B
(A,B) = (4, 2)
(4/ x+2) + (2/ x-1)
x + (4/ x-2) + (2/ x-1)
A lawyer commutes daily from his suburban home to his midtown office. The average time for a one-way trip is 24 minutes, with a standard deviation of 3.8 minutes. Assume the distribution of trip times to be normally distributed.
(a) What is the probability that a trip will take at least ½ hour?
(b) If the office opens at 9:00 A.M. and he leaves his house at 8:45 A.M. daily, what percentage of the time is he late for work?
(c) If he leaves the house at 8:35 A.M. and coffee is served at the office from 8:50 A.M. until 9:00 A.M., what is the probability that he misses coffee?
(d) Find the length of time above which we find the slowest 10% of trips.
(e) Find the probability that 2 of the next 3 trips will take at least one half
1/2 hour.
Answer:
Step-by-step explanation:
a) Probability-Above 30 min = 5.72% = .0572
b) Probability-Above 15 min = 99.11% = .9911
c) *Probability-Between 1 - 59.49% = .4051
d) 19.136 minutes z = -1.28
a) The probability that trip will take at least 1/2 hour will be 0.0606.
b) The percentage of time the lawyer is late for work will be 99.18%.
c) The probability that lawyer misses coffee will be 0.3659.
d) The length of time above which we find the slowest 10% of trips will be 0.5438.
e) The probability that exactly 2 out of 3 trips will take at least one half
1/2 hour is 0.0103.
What do you mean by normal distribution ?
A probability distribution known as a "normal distribution" shows that data are more likely to occur when they are close to the mean than when they are far from the mean.
Let assume the time taken for a one way trip be x .
x ⇒ N( μ , σ ²)
x ⇒ N( 24 , 3.8 ²)
a)
The probability that trip will take at least 1/2 hour or 30 minutes will be :
P ( x ≥ 30)
= P [ (x - μ) / σ ≥ (30 - μ) / σ ]
We know that , (x - μ) / σ = z.
= P [ z ≥ (30 - 24) / 3.8)]
= P [ z ≥ 1.578 ]
= 1 - P [ z ≤ 1.578 ]
Now , using the standard normal table :
P ( x ≥ 30)
= 1 - 0.9394
= 0.0606
b)
The percentage of the time the lawyer is late for work will be :
P ( x ≥ 15)
= P [ z ≥ -2.368 ]
= P [ z ≤ 2.368]
= 0.9918
or
99.18%
c)
The probability that lawyer misses coffee :
P ( 15 < x < 25 ) = P ( x < 25 ) - P ( x < 15)
= P [ z < 0.263] - P ( z < -2.368)
or
= 0.3659
d)
The length of time above which we find the slowest 10% of trips :
P( x ≥ X ) ≤ 0.10
= 0.5438
e)
Let's assume that y represents the number of trips that takes at least half hour.
y ⇒ B ( n , p)
y ⇒ B ( 3 , 0.0606)
So , the probability that exactly 2 out of 3 trips will take at least one half
1/2 hour is :
P ( Y = 2 )
= 3C2 × (0.0606)² × ( 1 - 0.0606)
= 0.0103
Therefore , the answers are :
a) The probability that trip will take at least 1/2 hour will be 0.0606.
b) The percentage of time the lawyer is late for work will be 99.18%.
c) The probability that lawyer misses coffee will be 0.3659.
d) The length of time above which we find the slowest 10% of trips will be 0.5438.
e) The probability that exactly 2 out of 3 trips will take at least one half
1/2 hour is 0.0103.
Learn more about normal distribution here :
https://brainly.com/question/26822684
#SPJ2
(4x^5)^3 what is the equivalent?
[A] 4x^5+3
[B] 4x^5*3
[C] 4^3x^5+3
[D] 4^3x^5*3
Answer:
A
Step-by-step explanation:
They are different exponents but they have the same bas so you add them up.
4x^5+3 = 4x^8
[tex] \pink{ \boxed{\boxed{\begin{array}{cc} \maltese \bf \: \: as \: we \: know \: that \\ \\ \bf\: \: \rightarrow \: {(xy)}^{n} = {x}^{n} . {y}^{n} \\ \\ \bf \rightarrow \: {( {a}^{m} })^{n} = {a}^{m \times n} \\ \\ \bf \: now \\ \: \\ \blue{ {\boxed{\begin{array}{cc} \maltese \bf\: \: \: {(4 {x}^{5} })^{3} \\ \bf = {4}^{3} \times ({x}^{5} )^{3} \\ \bf = {4}^{3} \times {x}^{5 \times 3} \end{array}}}}\end{array}}}}[/tex]
So option D) is the correct answer
The principle
P=6000 A=6810 T=3 years
Answer:
incomplete question
Step-by-step explanation:
that is what is wrong with your question
Answer:
r = 4.3%
Step-by-step explanation:
6810= 6000(x)^3
6810/6000= (x)^3
x = 1.043114431
r = 043114431
What is the area of a trapezoid.. base 14in and 7in height is 5in?
if the formula is [tex]\frac{(B+b)}{2} .h[/tex] we just need to plug in the values
21/2 = 10.5 x 5 = 52.5
hope it helps :)
Answer:
A = 52.5 in^2
Step-by-step explanation:
The area of a trapezoid is
A = 1/2 (b1+b2)h
where b1 and b2 are the bases and h is the height
A = 1/2 ( 14+7)*5
A = 105/2
A = 52.5 in^2
Lấy ngẫu nhiên 25 lọ thuốc Vitamin tổng hợp do một máy tự động đóng chai ta thu được s'2 =0,012(l2).Máyđượcgọilàđạtchuẩnnếuđộphântántheoquyđịnhlà2 =0,005(l2). Với mức ý nghĩa 0,05 hãy kiểm định máy đóng chai có đạt chuẩn không? Biết lượng thuốc trong chai là biến ngẫu nhiên có phân phối chuẩn.
Answer:
I really can't read this
Step-by-step explanation:
Diego made the shape on the left and Elena made the shape on the right. Each shape uses 5 circles.
Answer:
a
Step-by-step explanation:
I need help please guys thank you
Answer:
Option A, the parent function has been translated up
Option B, the parent function has been compressed
Option C, the parent function has been translated to the right
There are two machines available for cutting corks intended for use in wine bottles. The first produces corks with diameters that are normally distributed with mean 3 cm and standard deviation 0.08 cm. The second machine produces corks with diameters that have a normal distribution with mean 3.04 cm and standard deviation 0.04 cm. Acceptable corks have diameters between 2.9 cm and 3.1 cm.
1. What is the probability that the first machine produces an acceptable cork?
2. What is the probability that the second machine produces an acceptable cork?
3. Which machine is more likely to produce an acceptable cork?
Answer:
Step-by-step explanation:
I NEED HELP PLEASE ASAP!!
Answer:
Option B, 1
Step-by-step explanation:
tan 45° = 1/1 = 1
How many women must be randomly selected to estimate the mean weight of women in one age group? We want 90% confidence that the sample mean is within 3.7 lbs of the populations mean, and population standard deviation is known to be 28 lbs.
Answer:
155 women must be randomly selected.
Step-by-step explanation:
We have that to find our [tex]\alpha[/tex] level, that is the subtraction of 1 by the confidence interval divided by 2. So:
[tex]\alpha = \frac{1 - 0.9}{2} = 0.05[/tex]
Now, we have to find z in the Z-table as such z has a p-value of [tex]1 - \alpha[/tex].
That is z with a pvalue of [tex]1 - 0.05 = 0.95[/tex], so Z = 1.645.
Now, find the margin of error M as such
[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]
In which [tex]\sigma[/tex] is the standard deviation of the population and n is the size of the sample.
The population standard deviation is known to be 28 lbs.
This means that [tex]\sigma = 28[/tex]
We want 90% confidence that the sample mean is within 3.7 lbs of the populations mean. How many women must be sampled?
This is n for which M = 3.7. So
[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]
[tex]3.7 = 1.645\frac{28}{\sqrt{n}}[/tex]
[tex]3.7\sqrt{n} = 1.645*28[/tex]
[tex]\sqrt{n} = \frac{1.645*28}{3.7}[/tex]
[tex](\sqrt{n})^2 = (\frac{1.645*28}{3.7})^2[/tex]
[tex]n = 154.97[/tex]
Rounding up:
155 women must be randomly selected.
sin(180+0).cos(180+0)/cos(180+0).sin(180-0)
hlo anyone free .... im bo r ed
d
Step-by-step explanation:
Excuse me! Who r u? where r u frm? tell me tht frst.
Answer:
Oop
Step-by-step explanation:
I’m bored
Issac put $5 in a shoe box every day for the months of april, may, and june. He then spent 75% of the money on baseball cards. How much money is left in his shoe box.
A survey asked 25 students about their favorite sport. A frequency table of their responses is below.
Basketball, 4; football, 7; lacrosse, 3; soccer, 8; volleyball, 3.
Which of the following is the correct relative frequency table for the students’ favorite sport?
Answer: The second one
Step-by-step explanation:
response/25=x/100 and then you solve for x
A percentage is a way to describe a part of a whole. The correct table is B.
What are Percentages?A percentage is a way to describe a part of a whole. such as the fraction ¼ can be described as 0.25 which is equal to 25%.
To convert a fraction to a percentage, convert the fraction to decimal form and then multiply by 100 with the '%' symbol.
Given the number of students who play different sports as,
Basketball = 4
Football = 7
Lacrosse = 3
Soccer = 8
Volleyball = 3
Now, the percentage of students for each sport can be written as,
Basketball = 4/25 = 0.16
Football = 7/25 = 0.28
Lacrosse = 3/25 = 0.12
Soccer = 8/25 = 0.32
Volleyball = 3/25 = 0.12
Hence, the correct table is B.
Learn more about Percentages here:
https://brainly.com/question/6972121
#SPJ2
Complete the statement. A critical value is _____________. Choose the correct answer below. A. A critical value is how far away our sample statistic can be from the true population parameter with a certain level of confidence. B. A critical value is the probability of obtaining a sample statistic like the one obtained from the sample or something more unusual if the null hypothesis is true. C. A critical value is the number of standard errors (or standard deviations) to move from the mean of a sampling distribution to correspond to a specified level of confidence. D. A critical value is the value that best estimates a population parameter.
Answer:
A. A critical value is how far away our sample statistic can be from the true population parameter with a certain level of confidence.
Step-by-step explanation:
Test of a hypothesis:
When we are testing a hypothesis, we have a null hypothesis and an alternative hypothesis, and the conclusion depends on the test statistic, given by:
[tex]z = \frac{X - \mu}{\frac{\sigma}{\sqrt{n}}}[/tex]
In which X is the sample mean, [tex]\mu[/tex] is the value tested at the null hypothesis, [tex]\sigma[/tex] is the standard deviation and n is the size of the sample.
The test statistic measures the number of standard errors that we have to move away from the sample mean, and the critical value is how much we can be far from the population parameter with a certain level of confidence, that is, before a certain value we do not reject the null hypothesis, after the value we reject, and this value is the critical value, and thus the correct answer is given by option a.
find the surface area of the triangular prism below.
Step-by-step explanation:
At first you need to take its lateral surface area by using the perimeter of base of the triangle and the height of prism.
Then after calculating it you need to find out its total surface area which is asked in the question and that is calculated by adding the area of both triangles of the prism in the lateral surface area.
Then that's your answer.
9514 1404 393
Answer:
544 square units
Step-by-step explanation:
The surface area is the sum of the area of the two triangular bases and the three rectangular faces. The relevant area formulas are ...
A = 1/2bh . . . . area of a triangle with base b and height h
A = LW . . . . . are of a rectangle of length L and width W
__
SA = 2(1/2)(12)(8) + (10 +10 +12)(14)
SA = 96 +448 = 544 . . . square units
