please solve asap thanks ​

Please Solve Asap Thanks

Answers

Answer 1

I think..

A' =( -1,-4 )

B' = ( 3,-2 )

C'=( - 2, 2 )

Answer 2

Answer:

A' (-3, 12)

B' (9, 6)

C' (-6, -6)

Step-by-step explanation:

A (-1 , 4 ) , K = 3 => K * each with coordinate of A => (-1 * 3, 4 * 3)

B ( 3 , 2 ) , K = 3 => K * each with coordinate of B => (3 * 3, 2 * 3)

C ( -2 , -2 ) , K = 3 => K * each with coordinate of C => (-2 * 3, -2 * 3)


Related Questions

Rachael needs to rent a car while on vacation. The rental company charges $17.95, plus 19 cents for each
mile driven. If Rachael only has $40 to spend on the car rental, what is the maximum number of miles she
can drive?

Answers

Answer:

116 miles

Step-by-step explanation:

We can solve this by first writing an equation for the cost of the car rental. To begin, the base cost is $17.95, so any further costs must be added to that. Next, the car costs 19 cents (0.19 dollars) for each mile driven, so for each mile, we add 19 cents. This can be written as 0.19 *x if x represents the amount of miles driven. Therefore, we can add the two input costs of the car (the base cost and cost per mile) to get

17.95 + 0.19 * x = total cost.

After that, we want to maximize x/the number of miles with only 40 dollars. We can do this by setting this equal to the total cost, as going over the total cost is impossible and going under would be limiting the amount of miles (this because we are adding money for each mile, so more money means more miles). Therefore, we have

17.95 + 0.19 * x = 40

subtract 17.95 from both sides to isolate the x and its coefficient

22.05 = 0.19 * x

divide both sides by 0.19 to isolate x

22.05/0.19 = x = 116.05

The question asked us to round down, and 116.05 rounded down is 116 for our answer

What is the base and height of parallelogram S?

Answers

In a parallelogram, the term "base" refers to the length of one side and "height" to the length of a perpendicular segment between that side and the opposite side. Any side of a parallelogram can be a base. There are always two base-height pairs for a given parallelogram.

1) (1) The selling price (ii) The cost price (iii) Profit The marked price of an article is 15% above its selling price and the cost price is 25% less tha its marked price. Find the discount percent and gain percent.​

Answers

Answer: (iii) Profit The marked price of an article is 15% above its selling price and the cost price is 25% less tha its marked price. Find the discount percent and gain percent.​

Step-by-step explanation:

Kirk is ordering a cheeseburger for lunch. There are 9 cheeses and 7 buns to choose from. For the sauce, Kirk has 4 options. How many different hamburgers can Kirk order if he makes exactly one selection for each option?

Answers

Answer:

252 options

Step-by-step explanation:

Please let me know if you want an explanation for why this is the answer (comment on this answer). A lot of people don't actually read the explanations, so I wouldn't want to waste my time. However, if you would like it I would be more than happy to type one out for you. Thanks!

3. a) Why is X3 is a polynomial but
[tex] \frac{7}{x {}^{2} } [/tex]
, is not a polynomial? write in your words. ​

Answers

Answer:

because the power of variable is -2

Step-by-step explanation:

polynomials are a combination of constant and variable or only variable, being that power of variable is always positive natural no.

7/x^2 denotes 7x^-2

Use the divisibility test to determine if 2326 is divisible by 3. Explain your
answer.

Answers

Answer:

It is not

Step-by-step explanation:

2326

Add the numbers in 2326

13

Determine if the number is divisible by 3

No

A rhombus has an area of 5 square meters and a side length of 3 meters. In another similar rhombus, the length of a side is 9 meters. What is the area of the second rhombus?
(A) 30 square meters
(B) 45 square meters
(C) 60 square meters
(D) 75 square meters

Answers

Hence the area of the second rhombus is 45 square meters

The area of a rhombus is expressed as

A = base * height

For the rhombus with an area of 5 square meters and a side length of 3 meters

Height = Area/length

Height = 5/3 metres

Since the length of a similar rhombus is 9meters, the scale factor will be expressed as;

k = ratio of the lengths = 9/3

k = 3

Height of the second rhombus = 3 * height of the first rhombus

Height of the second rhombus = 3 * 5/3

Height of the second rhombus = 5 meters

Area of the second rhombus = length * height

Area of the second rhombus = 5 * 9

Area of the second rhombus = 45 square meters

Hence the area of the second rhombus is 45 square meters

Learn more here: brainly.com/question/20247331

The correct option is option B;

(B) 45 square meters

The known parameters in the question are;

The area of the rhombus, A₁ = 5 m²

The length of one of the sides of the rhombus, a = 3 m

The length of a side in a similar rhombus, b = 9 m

The unknown parameter;

The area of the second rhombus

Strategy or method;

We have that two shapes are similar if their corresponding sides are proportional

From the above statement we get that the ratio of the areas of the two shapes is equal to the square of the ratio of the lengths of the corresponding sides of the two shapes of follows;

[tex]\begin{array}{ccc}Length \ Ratio&&Area \ Ratio\\\dfrac{a}{b} &&\left (\dfrac{a}{b} \right)^2 \\&&\end{array}[/tex]

Let the area of the second rhombus be A₂, we get;

[tex]Area \ ratio = \dfrac{A_1}{A_2} = \left( \dfrac{a}{b} \right)^2[/tex]

Where;

a = 3 m, b = 9 m, and A₁ = 5 m², we get;

[tex]Area \ ratio = \dfrac{5 \ m^2}{A_2} = \left( \dfrac{3 \, m}{9 \, m} \right)^2 = \dfrac{1}{9}[/tex]

Therefore;

9 × 5 m² = A₂ × 1

A₂ = 45 m²

The area of the second rhombus, A₂ = 5 m².

Learn more about scale factors here;

https://brainly.com/question/20247331

Your student is struggling with basic addition skills. you can help them by

Answers

You can help by making addition fun with colours and other things to engage the student, you can also spend one on one time with them to help them understand

Answer:

1) focus in the positive

2)keep thing in perspective

3) ask students where there fear is coming

4)help students create a study schedule

5) priotize classroom preparation efforts.

Find the fractal dimension of the object.

Answers

Answer:

maaqqqf aku ngak tau soal jawaban in

raise the difference of q and 5 to the 3rd power​

write as an expression

Answers

Answer:

(q-5)³

Step-by-step explanation:

the difference of q and 5 is written as q - 5

Then you add an exponent with the digit 3

(q-5)³

If my answer is incorrect, pls correct me!

If you like my answer and explanation, mark me as brainliest!

-Chetan K

_+3=-9 pls help I will give branlyiest

Answers

Answer:

-12

Step-by-step explanation:

? + 3 = -9

Subtract 3 from -9

-9 - 3 = -12

? = -12

Consider the line y = 4x + 9. If a second line is perpendicular to this one, what is its slope?

Answers

Answer:

Step-by-step explanation:

slope of line perpendicular to y=mx+c is -1/m

so here reqd. slope=-1/4

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

Find the value of x.
A. 65
B. 32.5
C. 118
D. 130

Answers

Answer:

D. 130

Step-by-step explanation:

The lines are tangent to the circle therefore 90º which makes 65º + 25º.  The small triangle with C is iso so the angle of C would be 130 and equivalent to x

Answer:

[tex]D.\ \ 130[/tex]

Step-by-step explanation:

1. Approach

Refer to the attached diagram of the figure for further explanation. In this problem, one is asked to solve for the degree measure of arc (x). The easiest method to do so is to use the triangle (CAB). One can solve for the measure of angle (<CBA) by using the tangent to radius theorem. Then one can solve for the measure of angle (CAB) by using the base angles theorem. Then one can use the sum of angles in a triangle theorem to solve for angle (<BCA). Finally, one can use the central angles theorem to solve for the arc (x).

2. Find the measure of angles in the triangle

A. Find the measure of angle (<CBE)

As per the given image, lines (BE) and (AE) are tangent. This means that they intersect the circle at exactly one point. A radius is the distance from the center of a circle to the circumference or outer edge of a circle. All radii in a single circle are congruent. The radius of tangent theorem states that, when a tangent intersects a circle at a point of tangency, and a radius also intersects the point of tangency, the angle between the radius and the tangent is a right angle. One can apply this here by stating the following:

[tex]m<CBE = 90[/tex]

Express angle (<CBE) as the sum of two other angles:

[tex]m<CBE = m<CBA + m<ABE[/tex]

Substitute with the given and found information:

[tex]m<CBE = m<CBA + m<ABE[/tex]

[tex]90 = m<CBA + 65[/tex]

Inverse operations,

[tex]90 = m<CBA + 65[/tex]

[tex]25= m<CBA[/tex]

B. FInd the measure of angle (<CAB)

As stated above all radii in a single circle are congruent. This means that lines (CB) and (CA) are equal. Therefore, the triangle (CAB) is an isosceles triangle. One property of an isosceles triangle is the base angles theorem, this theorem states that the angles opposite the congruent sides of an isosceles triangle are congruent. Applying this theorem to the given problem, one can state the following:

[tex]m<CBA = m<CAB = 25[/tex]

C. Find the measure of angle (<ACB)

The sum of angles in any triangle is (180) degrees. One can apply this theorem here to the given triangle by adding up all of the angles and setting the result equal to (180) degrees. This is shown in the following equation:

[tex]m<CAB + m<CBA + m<ACB = 180[/tex]

Substitute,

[tex]m<CAB + m<CBA + m<ACB = 180[/tex]

[tex]25 + 25 + m<ACB = 180[/tex]

Simplify,

[tex]25 + 25 + m<ACB = 180[/tex]

[tex]50 + m<ACB = 180[/tex]

Inverse operations,

[tex]50 + m<ACB = 180[/tex]

[tex]m<ACB = 130[/tex]

3. Find the measure of arc (x)

The central angles theorem states that when an angle has its vertex on the center of the circle, its angle measure is equivalent to the measure of the surrounding arc. Thus, one apply this theorem here by stating the following:

[tex]m<ACB = (x)\\130 = x[/tex]

Value of [(3/2)^(-2)] is *​

Answers

Answer:

[tex] { (\frac{3}{2} )}^{ - 2} \\ = { (\frac{2}{3}) }^{2} \\ = \frac{4}{9} \\ thank \: you[/tex]

Multiple Choice
Which statement is an example of the Identity Property of Multiplication?
A. 8.0 = 0
B. 8. 1 = 8
C. 8.-1 = -8
D. -8.-1 = 8

Answers

Answer:

I think that the answer is - 8.-1=8

A whitetail deer can sprint at speeds up to 30 miles per hour. American bison can run at speeds up to 3,520 feet per minute. Which animal is faster and by how many miles per hour? There are 5,280 feet in one mile.

Answers

Answer:

The Bison is faster by 10 miles per hour.

Step-by-step explanation:

The Bison runs at 3520 ft / min

= 3520/ 5280 miles / minute

= (3520/ 5280) * 60 miles per hour

= 40 miles per hour

Curtis purchased a bicycle on credit. When he received his credit card statement, he noticed several charges he did not make. What should he do?

Answers

Answer: He should call the card card company and discuss the charges and make it known that he did not make those charges. He should address each charge by the amount shown.  Once he has finished, the credit card company will call the company that sent in the request for payment and inform the company there are questions about the charges and request that the charges be removed.

.

Step-by-step explanation:

At any given time about 5.5% of women (age 15-45) are pregnant. A home pregnancy test is accurate 99% of the time if the woman taking the test is actually pregnant and 99.5% accurate if the woman is not pregnant. If the test yields a positive result, what is the posterior probability of the hypothesis that the woman is pregnant?

Answers

Answer:

0.99%

Step-by-step explanation:

PLEASE gelp me with this, gelp me please oh please gelp me!

Answers

Answer:

V = 2143.57 cm^3

Step-by-step explanation:

The volume of a sphere is

V = 4/3 pi r^3

The diameter is 16 so the radius is 1/2 of the diameter or 8

V = 4/3 ( 3.14) (8)^3

V =2143.57333

Rounding to the nearest hundredth

V = 2143.57 cm^3

Answer:

2143.57 cm^3

Step-by-step explanation:

V = 4/3 * 3.14 * r^3

r = 1/2 * 16 = 8

So V = 4/3 * 3.14 * 8^3

= 2143.57 cm^3.

A homeowner needs two loads of gravel for the driveway to their new house. One loads weighs 8 tons and the second load
weighs 1,200 pounds. What is the total weight of the gravel, in tons, used for the driveway?

Answers

Total weight of the gravel, in tons used for the driveway is 8.6 tons

Weight of first load = 8 tons

Weight of second load = 1200 pounds

Convert pounds to tons:

1 pound = 0.0005 ton

1200 pounds = 0.6 ton

Then,

Weight of second load = 0.6 ton

Total weight of the gravel, in tons = Weight of first load + Weight of second load

= 8 tons + 0.6 tons

= 8.6 tons

https://brainly.com/question/24370065

Find the midpoint of the line segment joining (–4, –2) and (2,8)
Show all work

Answers

Answer:

Mid- point =(-4+2/2, -2+8/2)

=(-2/2,6/2)

=(-1,3)

The mid point of the line segment joining  (–4, –2) and (2,8) is (-1, 3)

Mid point formula

mid point = (x₁ + x₂ / 2, y₁ + y₂ / 2)

Therefore,

(-4, -2)(2, 8)

x₁= -4

x₂ = 2

y₁ = -2

y₂ = 8

Hence,

mid point = (-4 + 2 / 2, -2 + 8 / 2)

mid point = (-2 / 2, 6 / 2)

mid point = (-1, 3)

learn more on mid point here: https://brainly.com/question/1501820

A vehicle purchased for $20700 depreciates at a constant rate of 6%.
Determine the approximate value of the vehicle 14 years after purchase.
Round to the nearest whole number.
Question Help: Viden M Message instructor
n Post to forum

Answers

Answer:

$22,000

Step-by-step explanation:

The sides of a triangle are in the ratio of 4:5:7 and its perimeter is 64. Find its sides

Answers

Answer:

16,20,28

Step-by-step explanation:

64 /(4+5+7)

64/16= 4

sides of triangle=4×4 :5×4: 7×4

                         =16:20:28

Ratios are usually good to set up like this:
4x+7x+5x=64 in this case. 4x = the shortest side, 7x = the longest side, and 5x = the middle side. Then solve for x.
16x+64
x=4
Then plug 4 back in for x to see what the individual side lengths are.
4*4=16 for the shortest side.

what is the HCF of 216 ​

Answers

Answer:

The answer for this question is 1

Harrison has 20 tasks on to do list he has completed 5%. How many tasks has he completed?

Answers

Answer:

1 task

Step-by-step explanation:

100%=20 tasks

5%=1 task

Reduce 20/60 to its lowest common denominator

Answers

Answer:

it is 1/4

Step-by-step explanation:

20/60=10/30=1/3

Answer:

20/60=1/3

Step-by-step explanation:

20/60

HCF=20,

20*1=20, 20*3=60

1/3

or,

Remove the zeros,

2/6

Divide by 2 on both,

1/3

or divide by any common factor on both and keep dividing until u cant no more

20/60=1/3

A number is multiplied by 8, and that product is added to 2. The sum is equal to the product of 2 and 25. Find the number.

Answers

Answer: the number = 6

Step-by-step explanation:

Let x be the number.

Set equation according to the information given

2 + 8x = 2 × 25

Simplify by multiplication

2 + 8x = 50

Subtract 2 on both sides

2 + 8x - 2 = 50 - 2

8x = 48

Divide 8 on both sides

8x / 8 = 48 / 8

[tex]\boxed {x=6}[/tex]

Hope this helps!! :)

Please let me know if you have any questions

14 cm 8 cm 10cm 5 cm.
find the area and the perimeter of the above figures ​

Answers

Perimeter means distance around a figure or curve.

Perimeter = Sum of all sides

Perimeter = 14cm + 8cm + 10cm + 5cm

Perimeter = 22cm + 15cm

Perimeter = 37cm

Step-by-step explanation:

hope it helps you

...

........

Julie wanted to find out the approximate percentage of non-traditional female college students at public universities. She decided to randomly select 25 females from each university in her state and collect and analyze the data.

Select the statement that is TRUE.


The 25 females that Julie interviews are the sample, and the females that Julie does not interview are the population.


The 25 females that Julie interviews are the sample, and all female college students at state universities are the population.


All female college students at state universities are the sample, and the 25 females that Julie interviews are the population.


The female college students at state universities are the sample, and the female college students at all universities in the United States are the population.

Answers

To solve this question, we need to understand sample and population concepts.

From this, the answer is:

The 25 females that Julie interviews are the sample, and all female college students at state universities are the population.

Example:

I want to estimate the proportion of New York state residents who are Buffalo Bills fans. So i ask, lets say, 1000 randomly selected New York state residents whether they are Buffalo Bills fans, and expand this to the entire population of New York State residents, which is the population of the study.

The sample will be: 1000 randomly selected New York state residents

The population will be: All New York state residents

In this question:

Sample: 25 females from each university in her state.

Population: All female college students in her student.

Thus, the correct statement is:

The 25 females that Julie interviews are the sample, and all female college students at state universities are the population.

For a similar example, you can check https://brainly.com/question/24331410

Other Questions
los tipos de historias Hello pls Asap plsssss The coastal ocean zone and estuaries are alike in that both are important as breeding and nesting areas for birds. True or fualse? The Junior class has raised4/7of the amount of money that is needed for the Junior-SeniorProm, and the Senior class has raised 3/11 of the amount of money that is needed. Estimatewhat portion of the money the two classes have already raised of the moneyA.1/4 of the moneyB.all of the moneyC.1/2 of the moneyD.3/4 of the money Please help me find what type of chemical reaction takes place from numbers 1-5. In which type of economy do the forces of supply and demand typically drive prices?A. a market economyB. a traditional economyC. a planned economyD. a command economy explain why USA and Russia were not part of the league complete explanation please Glucose is soluble in water. Why is cellulose, which is made up of glucose, insoluble in water? The equation of the line in this graph. how is the profession of the the gandharvas falling at risk ? suggest ways how it could be revived. What is the difference between glucose and ATP? (1 point)ATP is only a usable form of energy, but glucose can be used and stored.Glucose is only a storable form of energy, but ATP can be used and stored.ATP is a storable form of energy, while glucose is a usable form of energy.o Glucose is a storable form of energy, while ATP is a usable form of energy. what would the equation, slope, and point be for this graph? Gena wants to estimate the quotient of 21.87 divided by 4.79. Which expression shows the estimate using front-end estimation? Describe an English lesson that you reallyenjoyed.You should say:where and when it took placewho the teacher waswhat you did in the lessonand explain why you enjoyed it so much Why was adapting the Articles of Confederation difficult?A there was no Supreme Court B partisan differences made rulings difficult C there were not specific rules outlining how to making adaptationsD it required approval from each state What are the zeros of the polynomial function f(x) = x3 10x2 + 24x? name at least three other neurotransmitters and state the roles of theese neurotransmitters in human body. Write equation of a line in slope intercept form with the given information p=(1,2) m=4 9 is subtracted grom 3 times the sum of 4 and 2