In an analysis of interhalogen reactivity, 0.350 mol ICl was placed in a 5.00 L flask and allowed to decompose at a high temperature.
2 ICl(g) I2(g) + Cl2(g)
Calculate the equilibrium concentrations of I2, Cl2, and ICl. (Kc = 0.110 at this temperature.)
I2 M
Cl2 M
ICl M

Answers

Answer 1

Answer:

[ICl] = 0.0420 M

[I₂]  = [Cl₂] = 0.0140 M

Explanation:

Step 1: Calculate the initial concentration of ICl

[ICl] = 0.350 mol / 5.00 L = 0.0700 M

Step 2: Make an ICE chart

        2 ICl(g) ⇄ I₂(g) + Cl₂(g)

I        0.0700     0         0

C        -2x          +x        +x

E    0.0700-2x      x          x

The concentration equilibrium constant (Kc) is:

Kc = 0.110 = [I₂] [Cl₂] / [ICl]² = x² / (0.0700-2x)² = (x/0.0700-2x)²

0.332 = x/0.0700-2x

x = 0.0140

The concentrations at equilbrium are:

[ICl] = 0.0700-2x = 0.0700-0.0280 = 0.0420 M

[I₂]  = [Cl₂] = x = 0.0140 M


Related Questions

Calculate the molarity of a solution consisting of 65.5 g of K2S0 4 in 5.00 L of solution. ​

Answers

Answer:

Molarity is 0.075 M.

Explanation:

Moles:

[tex]{ \tt{ = \frac{65.5}{RFM} }}[/tex]

RFM of potassium sulphate :

[tex]{ \tt{ = (39 \times 2) + 32 + (16 \times 4)}} \\ = 174 \: g[/tex]

substitute:

[tex]{ \tt{moles = \frac{65.5}{174} = 0.376 \: moles}}[/tex]

In volume of 5.00 l:

[tex]{ \tt{5.00 \: l = 0.376 \: moles}} \\ { \tt{1 \: l = ( \frac{0.376}{5.00} ) \: moles}} \\ { \tt{molarity = 0.075 \: mol \: l {}^{ - 1} }}[/tex]

The standard redox potentials of isolated components of an electron transport chain in a cyanobacterium are found to be as follows:
Complex A: standard redox potential: -100 mV
Complex B: standard redox potential: -780 mV
Complex C: standard redox potential: +510 mV
Complex D: standard redox potential: +310 mV
Plastocyanin: standard redox potential: +360 mV
Which complex will likely have a binding site with high affinity for reduced plastocyanin?
A. Complex A.
B. Complex B.
C. Complex C.
D. Complex D.

Answers

Answer:

B. Complex B.

Explanation:

Complex B will have binding site with high affinity for reduced plastocyanin due to greater redox potential. The high number of redox potential will will transport electron chain in cyanobacteria.

Redox potential is the measure of the electron gain or loss to the electrode. For reduced plastocyanin complex B will have the highest affinity.

What is electron affinity?

Electron affinity is the energy released when the atom gets attached to the atom or other molecule. The high number of redox potential increases the electron transport in the cell.

The greater the redox potential more will be its tendency to show electron affinity. To bond with reduced species, the oxidized species must have greater redox potential.

Therefore, option B. complex b will have the highest affinity.

Learn more about reduction potential here:

https://brainly.com/question/14437673

Which are the following exothermic or endothermic

Absorbs Energy

-Hrxn

+Hrxn

Feels Hot

Heat flows from surrounds to Reaction

Not Energetically Favorable

Energetically Favorable

Releases Energy

Feels Cold

Heat flows from the reaction to the surrounds

Answers

Answer:

Explanation:

Your mom

The products of nuclear reaction usually have a different mass than the reactants why?

Answers

Answer:

Explanation:

The best way to explain this is to use an example

[tex]I\frac{125}{53} + e \frac{0}{-1} ====> Te\frac{125}{52}[/tex]

You have to understand what happened. A electron was shot into the nucleus of the Iodine. That electron change the entire composition of the nucleus resulting in 52 protons. The mass remained the same (125) but the nucleus was altered. The chemical became 125 52 Tellurium.  But what is important is that it takes a tremendous amount of energy to disrupt a nucleus, and a new chemical is born from that disruption.

Kevin's supervisor, Jill, has asked for an update on today's sales. Jill is pretty busy moving back and forth between different store locations. How can Kevin most effectively deliver an update to her? a) Send a detailed email Send a detailed text message Oc) Book a one-hour meeting for tomorrow morning O d) Call with a quick update

Answers

Kevin can effectively deliver an update by sending a detailed EMAIL to Jill

Email, which means electronic mail is a technological advanced way of passing information from persons to persons without physical contact. Sending emails are also official ways of passing vital information regarding business, work to and fro.

According to this question, Jill is a very busy supervisor who hardly. The best way for Kevin to deliver any update concerning the store he is managing is to send Jill an updated email that can even be assessed outside work hours. Learn more: https://brainly.com/question/7098974

Arrange the following ions in order of increasing ionic radius.

a. sulfide ion
b. calcium ion
c. phosphide ion
d. potassium ion

Answers

Answer:

Ca 2+ <K  +  <Ar<Cl  −  <S  2−

Explanation:

Ar,K  + ,Cl  − ,S  2− ,Ca  2+

 have the same number of electrons. Their radii would be different because of their different nuclear charges. The cation with the greater positive charge will have a smaller radius because of the greater attraction of the electrons to the nucleus. Anion with the greater negative charge will have the larger radius. In this case, the net repulsion of the electrons will outweigh the nuclear charge and the ion will expand in size. Hence the correct order will be Ca  

2+  <K +  <Ar<Cl  −  <S  2−

 

If ionization energy of hydrogen atom is 13.6 eV then its ionization potential will be

Answers

Ionization potential and ionization energy are two terms used to describe the same thing.

The ionization potential of hydrogen atom is 13.6 eV

The ionization potential is the energy that is required to remove an electron from the neutral atom. It is the same as the ionization energy.

From the question, we can see that the ionization energy of the hydrogen atom is 13.6 eV, it also means that the ionization potential of the hydrogen atom is also 13.6 eV.

Therefore, If ionization energy of hydrogen atom is 13.6 eV then its ionization potential will be 13.6 eV

For more information see:

https://brainly.com/question/16243729

Which one of these statements is/are true: I. All redox reactions with positive emfs are spontaneous. II. If a redox reaction is spontaneous, it must be fast. III. A spontaneous redox reaction will have a cathode reaction that has a more negative reduction potential than the anode. III only. I and III are true. I only. II only. All of I, II, and III are true.

Answers

Answer:

yea all the answers are true

Redox reaction is the transfer of the electron from one species to another. All of the three statements are true about the redox reaction.

What is a redox reaction?

A redox reaction is a type of chemical reaction in which the electrons are gained and lost by a species. The positive EMF of the cell results in spontaneous and will move the reaction in the forward direction.  

In a redox reaction, the cathode reaction is comparatively more negative than the reduction potential present at the anode.

Therefore, option E. All I, II, and III are true.

Learn more about redox reaction here:

https://brainly.com/question/13076860

An equilibrium mixture of PCl5(g), PCl3(g), and Cl2(g) has partial pressures of 217.0 Torr, 13.2 Torr, and 13.2 Torr, respectively. A quantity of Cl2(g) is injected into the mixture, and the total pressure jumps to 263.0 Torr at the moment of mixing. The system then re-equilibrates. The chemical equation for this reaction is

Answers

Answer:

p'PCl3 =  6.8 torr

p'Cl2 =26.4 torr

p'PCl5 =223.4 torr

Explanation:

An equilibrium mixture of PCl5(g), PCl3(g), and Cl2(g) has partial pressures of 217.0 Torr, 13.2 Torr, and 13.2 Torr, respectively. A quantity of Cl2(g) is injected into the mixture, and the total pressure jumps to 263.0 Torr at the moment of mixing. The system then re-equilibrates. The chemical equation for this reaction is

PCl3(g) + Cl2(g) ---> PCl5(g)

Calculate the new partial pressures after equilibrium is reestablished. [in torr]

pPCl3

pCl2

pPCl5

Step 1: Data given

Partial pressure before adding chlorine gas:

Partial pressure of PCl5 = 217.0 torr

Partial pressureof PCl3 = 13.2 torr

Partial pressureof Cl2 = 13.2 torr

A quantity of Cl2(g) is injected into the mixture, and the total pressure jumps to 263.0 Torr at the moment of mixing

Step 2: The equation

PCl3(g)+Cl2(g) ⇔ PCl5(g)

Step 3: The expression of an equilibrium constant before adding chlorine gas

Kp = pPCl5 / (pPCl3 * pCl2)

Kp = 217.0 / (13.2 * 13.2)

Kp =  1.245

Step 4:  The expression of an equilibrium constant after adding chlorine gas

Partial pressure of PCl5 = 217.0 torr

Partial pressure of PCl3 = 13.2

Partial pressure of Cl2 = TO BE DETERMINED

Step 5: The total pressure of the system

Ptotal = pPCl5 + pPCl3 + pCl2

263.0 torr = 217.0 torr + 13.2 torr + pCl2

pCl2 = 263.0 - 217.0 -13.2 = 32.8 torr

Step 6: The initial pressure

The equation: PCl3(g)+Cl2(g) ⇔ PCl5(g)

pPCl3 = 13.2 torr

pCl2 = 32.8 torr

pPCl5 = 217.0 torr

Step 7: The pressure at the equilibrium

p'PCl3 = (13.2 -x) torr

p'Cl2 = (32.8 - x) torr

p'PCl5 = (217.0 + x) torr

Step 8: The equilibrium constant

'Kp =  p'PCl5 / (p'PCl3 * p'Cl2)

1.245 = (217.0+x) / ((13.2-x)(32.8-x)

x = 6.40 torr

p'PCl3 = 13.2 -6.40 = 6.8 torr

p'Cl2 = 32.8 - 6.40 =26.4 torr

p'PCl5 = 217.0 + x) 6.4 = 223.4 torr

I don’t know what Ksp and Kf are stand for?

Answers

Answer:

Sorry but I know only what ksf stand for

Explanation:

Ksf stand for solubility product constant

Answer:

ksp stands for solubility product constant .

kf stands for molal freezing point depression constant ..

Explanation:

KSP = The solubility product constant, Ksp​, is the equilibrium constant for a solid substance dissolving in an aqueous solution. It represents the level at which a solute dissolves in solution. The more soluble a substance is, the higher the Ksp value it has .

KF = Kf is a constant for a given solvent. Kf is called the molal freezing point depression constant and represents how many degrees the freezing point of the solvent will change when 1.00 mole of a nonvolatile nonionizing (nondissociating) solute dissolves in one kilogram of solvent.

When the equation,
O2 + __C 10H 22 →
CO2 +
H2O is balanced, the coefficient of O2 is?

Please help!

Answers

(10)O_2+C_10 H_22-->(10)CO_2+(11)H_2 O

This is the correct balanced equation

The coefficient would be (20) when you multiply 10 by 2

What is the molecular formula of following show how it is done.1 nitric acid 2 Sulphuric acid 3 Methane 4 Potassium oxide 5 Silver chloride 6 Limestone . Answer it ASAP.Thank u​

Answers

Answer:

1.HNO₃

Nitric acid is a nitrogen oxoacid of formula HNO3 in which the nitrogen atom is bonded to a hydroxy group and by equivalent bonds to the remaining two oxygen atoms.

2.H₂SO₄

3.CH₄

Methane (US: , UK: ) is a chemical compound with the chemical formula CH4 (one atom of carbon and four atoms of hydrogen). It is a group-14 hydride and the simplest alkane and is the main constituent of natural gas.

4.K₂O

5.AgCl

6.CaCO3

Limestone consists of calcium carbonate, which has the chemical formula CaCO3. Limestone exists in sedimentary and crystalline form.

Explanation:

hello .

Don't Forget To Follow, Brainliest, And Give Me Heart :)

Two flasks are connected by a closed valve. One contains gas particles and the other contains a vacuum. If the valve is opened such that the particles move until they fill both flasks, the process by which the particles can reconvene entirely in one of the flasks is:

Answers

Answer: The process by which the particles can reconvene entirely in one of the flasks is: NONSPONTANEOUS.

Explanation:

The spontaneity of a process can affect the distribution of energy and matter within the system. Different chemical or physical processes have the natural tendency to occur in one direction under a given set of conditions. For example:

--> when water is pour down a hill it naturally flows down but it requires outside energy maybe from a water pump to flow up the hill and ,

--> during an iron rust, iron that is exposed to atmosphere will corrode, but rust is not converted to iron without intentional chemical treatment.

Therefore, a spontaneous process is one that occurs naturally under certain conditions. While a NONSPONTANEOUS process, on the other hand, will not take place unless it is initiated by the continual input of energy from an outside source. A process that is spontaneous in one direction under a particular set of conditions is nonspontaneous in the REVERSE direction.

From the two flasks that where connected through a valve, once the valve was opened, the gas spontaneously becomes evenly distributed between the flasks. To reverse this, it would require an external energy making the reconvening of the particles back to the first flask a NONSPONTANEOUS PROCESS .

The graph below shows how the temperature and volume of a gas vary when
the number of moles and the pressure of the gas are held constant. What
happens to the
temperature of a gas as its volume increases?
A. The temperature decreases
B. The temperature increases
C. The temperature remains the same.
D. The temperature doubles.

Answers

Answer:

C

Explanation:

because it remains the same

State the different radiations emitted by radioactive elements.

Answers

The emissions of the most common forms of spontaneous radioactive decay are the alpha (α) particle, the beta (β) particle, the gamma (γ) ray, and the neutrino.

Answer: Alpha, beta, and gamma after the first three letters of the Greek alphabet. Alpha and beta particles consist of matter, and gamma rays are bursts of energy. The type of radiation emitted depends on the radioactive substance; cesium-137, for example, produces beta and gamma radiation but not alpha particles.

Avogradro's number is the number of particles in one gram of carbon- 12 atom true or false?​

Answers

Answer:

True

Explanation:

The value of the mole is equal to the number of atoms in exactly 12 grams of pure carbon-12. 12.00 g C-12 = 1 mol C-12 atoms = 6.022 × 1023 atoms • The number of particles in 1 mole is called Avogadro's Number (6.0221421 x 1023).

12.39 HBr can be added to alkenes in either the absence or presence of peroxides (producing either the Markovnikov or the anti-Markovnikov addition product). What intermediates leading to the formation of the major product are observed when 1-butene is treated with 1) HBr or 2) HBr/peroxides

Answers

Answer:

See explanation and image attached

Explanation:

The reaction of HBr with 1-butene is an addition reaction. The HBr adds across the double bond to yield a saturated halogenoalkane.

In the absence of peroxides, the reaction proceeds in accordance with Markovnikov rule which states that;''the negative part of the addendum, is attached to the carbon atom with the least number of hydrogen atoms attached.'' This occurs in the first reaction shown in the image.

In the presence of peroxides, the reaction proceeds in an anti-Markovnikov manner to yield the product shown in the second reaction.

Which chemical can remove color of red/Pink phenol and make it clear like water transparent?

Answers

Lethal of skin by absorption

Calculate the mass of water produced when 7.49 g of butane reacts with excess oxygen.

Answers

Answer:

[tex]m_{H_2O}=12.9gH_2O[/tex]

Explanation:

Hey there!

In this case, according to the given information, it turns out possible for us to solve this problem by firstly writing out the reaction whereby butane is combusted in the presence of excess oxygen:

[tex]2C_4H_{10}+13O_2\rightarrow 8CO_2+10H_2O[/tex]

Thus, we can evidence a 2:10 mole ratio of butane to water, and thus, the stoichiometric setup to calculate the mass of produced water is:

[tex]m_{H_2O}=7.49gC_4H_{10}*\frac{1molC_4H_{10}}{52.12gC_4H_{10}} *\frac{10molH_2O}{2molC_4H_{10}}*\frac{18.02gH_2O}{1molH_2O}\\\\m_{H_2O}=12.9gH_2O[/tex]

Regards!

You are titrating 24.3 mL of 2.00 M HCl with 1.87 M NaOH. How much NaOH do you expect to have added when you reach the equivalence point?

26.0 mL

15.4 mL

13.4 mL

Answers

Answer:

26mL

Explanation:

NaOH+HCl= NaCl+H2O

nHCl=0.0243*2=0.0486

nNaOh=nHCl

VNaOH=0.0486/1.87=0.026l=26ml

Answer:

26.0 mL

Explanation:

What is alkaline and what is acidic pH

Answers

Answer:

An alkaline is a substance that dissolves in water to produce hydroxyl ions (OH-)

Explanation:

The pH range of an alkaline is from 8–14.

Acidic pH ranges from 0–6.9.

calculate the hydrogen ion concentration of a solution who's pH is 2.4​

Answers

Answer:

I don't know sorry yyyyyyy6yyyyyyyyyyyyyyyyyyyyyyyyyyy

he FAA restricts how much lithium to carry on an airplane. The rule-of-thumb is a battery has 0.3 g of lithium per Ampere-hour (Ah). A laptop battery is rated as 5 Ah per cell and contains 4 cells. Find the lithium content in grams. (compare with the FAA limit of 8 grams)

Answers

Answer:

The right answer is "6 gm".

Explanation:

Given:

Amount of Li,

= 0.3 gm

Battery rated,

= 5 Ah per cell

Total number of cells,

= 4

The total power limit will be:

= [tex]5\times 4[/tex]

= [tex]20 \ Ah[/tex]

hence,

The amount of Li in battery will be:

= [tex](0.3)\times 20[/tex]

= [tex]6 \ gm[/tex]

(Allowed for transportation).

A reaction rate increases by a factor of 500. in the presence of a catalyst at 37oC. The activation energy of the original pathway is 106 kJ/mol. What is the activation energy of the new pathway, all other factor being equal

Answers

Answer:

[tex]E_2=999984KJ/mole[/tex]

Explanation:

From the question we are told that:

Factor [tex]dK=500[/tex]

Temperature [tex]T=37 C=310k[/tex]

Activation energy [tex]E=10^6kJ/mol[/tex]

Generally the Arhenius equation is mathematically given by

[tex]ln \frac{K_2}{K_1}=\frac{ E_1-E_2}{RT}[/tex]

Where

[tex]\frac{K_2}{K_1}=500[/tex]

[tex]ln 500=\frac{ 10^6-10^3-E_2}{8.314*310}[/tex]

[tex]E_2=999984KJ/mole[/tex]

The activation energy of the new reaction is 105.99 kJ/mol.

Using the Arrhenius equation;

ln(k2/k1) = -Ea2/RT2 +  Ea1/RT1

Now, from the information in the question;

k2/k1 = 500

Ea = ?

R = 8.314 JKmol-1

T2 = 37oC + 273 = 310 K

T1 = 37oC + 273 = 310 K

Substituting values;

ln (500) =- Ea2 + Ea1

6.2 = -Ea2 + 106 × 10^3 J

Ea = 106 × 10^3 J - 6.2

Ea = 105.99 × 10^3 J  or 105.99 kJ/mol

Learn more about activation energy: https://brainly.com/question/11334504

At what velocity (m/s) must a 20.0g object be moving in order to possess a kinetic energy of 1.00J

Answers

Answer:

10 ms-1

Explanation:

Kinetic energy = 1/2 × m × v^2

1 = 1/2× 20 ×10^ -3 × v^2

v ^ 2 = 100

v = 10 ms-1

note : convert grams in to kg before substitution as above

The velocity will be "10 m/s".

Given:

Kinetic energy,

K.E = 1.00 J

Mass,

m = 20.0 g

We know the formula,

→ [tex]K.E = \frac{1}{2} mv^2[/tex]

By putting the values, we get

       [tex]1 = \frac{1}{2}\times 20\times 10^{-3}\times (v)^2[/tex]

     [tex]v^2 = 100[/tex]

       [tex]v = \sqrt{100}[/tex]

       [tex]v = 10 \ m/s[/tex]

Thus the above response is correct.

Learn more about K.E here:

https://brainly.com/question/24997625

Determine the value of the equilibrium constant for the following reaction, where the following amounts of each species are present at equilibrium in a 5.00 L container: 1.34 mol HCl, 4.30 mol O2, 30 g H2O, and 2.42 mol Cl2.
4 HCl(g) O2(g) ----> 2 H2O(l) 2 Cl2(g)

Answers

Explanation:

here's the answer to your question about

How is the rate of a reaction affected when the temperature increases?
A. The rate decreases because the reactant particles move too
quickly to react.
B. The rate increases because the equilibrium constant increases.
C. The rate increases because the reactant particles collide more
often.
D. The rate decreases because the products reform the reactants more quickly
more quickly.

Answers

D the rate decreases because the products reform the reactants more quickly more quickly.

The rate of reaction increases when the temperature increases because the reactant particles collide more often and the correct option is option C.

What is Rate of reaction?

The rate of reaction refers to the speed at which the products are formed from the reactants in a chemical reaction. It gives some insight into the time frame under which a reaction can be completed.

The rate or speed of reaction can be defined as the change in the concentration of any one of the reactants or products per unit time.

The rate is higher at higher temperatures because colliding particles will have the required activation energy at high temperature and more successful collisions will take place.

Therefore, The rate of reaction increases when the temperature increases because the reactant particles collide more often and the correct option is option C.

Learn more about Rate of reaction, here:

https://brainly.com/question/30546888

#SPJ7

You need to make an aqueous solution of 0.182 M aluminum sulfate for an experiment in lab, using a 250 mL volumetric flask. How much solid aluminum sulfate should you add

Answers

Answer:

Hence, 15.99 g of solid Aluminum Sulfate should be added in 250 mL of Volumetric flask.

Explanation:

To make 0.187 M of Aluminum Sulfate solution in a 250 mL (0.250 L) Volumetric flask  

The molar mass of Aluminum Sulfate = 342.15 g/mol  

Using the molarity formula:-  

Molarity = Number of moles/Volume of solution in a liter  

Number of moles = Given weight/ molar mass  

Molarity = (Given weight/ molar mass)/Volume of solution in liter  

0.187 M = (Given weight/342.15 g/mol)/0.250 L  

Given weight = 15.99 g  

Given the following reaction:
CO (g) + 2 H2(g) <==> CH3OH (g)
In an experiment, 0.42 mol of CO and 0.42 mol of H2 were placed in a 1.00-L reaction vessel. At equilibrium, there were 0.29 mol of CO remaining. Keq at the temperature of the experiment is ________.
A) 2.80
B) 0.357
C) 14.5
D) 17.5
E) none of the above

Answers

Answer:

Option D. 17.5

Explanation:

Equiibrium is: CO + 2H₂  ⇄  CH₃OH

1 mol of CO is in equibrium with 2 moles of hydrogen in order to make, methanol.

Initially we have 0.42 moles of CO and 0.42 moles of H₂

If 0.29 moles of CO remained, (0.42 - 0.29) = 0.13 moles have reacted.

So in the equilibrium we may have:

0.29 moles of CO, and (0.42 - 0.13 . 2) = 0.16 moles of H₂

Ratio is 1:2, if 0.13 moles of CO haved reacted, (0.13 . 2) moles have reacted of hydrogen

Finally 0.13 moles of methanol, are found after the equilibrium reach the end.

Let's make expression for KC: [Methanol] / [CO] . [Hydrogen]²

0.13 / (0.29 . 0.16²)

Kc = 17.5

1. Metallic strontium crystallizes in a face-centered cubic lattice, with one Sr atom per lattice point. If the edge length of the unit cell is found to be 608 pm, what is the metallic radius of Sr in pm?
2. The substance beta manganese is found to crystallize in a cubic lattice, with an edge length of 630.0 pm. If the density of solid beta manganese is 7.297 g/cm3, how many Mn atoms are there per unit cell?

Answers

Answer:

[tex]r=215pm[/tex]

[tex]N_{Mn}=20[/tex]

Explanation:

From the question we are told that:

Edge length of the unit cell [tex]l=608pm[/tex]

a)

Generally the equation for The relationship between edge length and radius is mathematically given by

[tex]4r=\sqrt{2a}[/tex]

Therefore

[tex]4r=\sqrt{2*608}[/tex]

[tex]r=\frac{\sqrt{2*608}}{4}[/tex]

[tex]r=215pm[/tex]

b)

From the question we are told that:

Density [tex]\rho=7.297[/tex]

Edge length of [tex]l=630.0 pm=>630*10^-{10}[/tex]

Therefore Volume  is given as

[tex]V=l^3[/tex]

[tex]V=630*10^-{10}^3[/tex]

[tex]V=2.50047*10^{−22}[/tex]

Generally the equation for Mass is mathematically given by

[tex]m=Volume*density[/tex]

[tex]m=V*\rho[/tex]

[tex]m=2.50047*10^{−22}*7.297[/tex]

[tex]m=1.83*10^{-21}g[/tex]

Therefore Molarity is given as

[tex]n=\frac{M}{Molar M}[/tex]

[tex]n=\frac{1.83*10^{-21}g}{55}[/tex]

[tex]n=3.32*10^{-23}[/tex]

Finally The atoms in a unit cell is

[tex]N_{Mn}=Moles*Avogadro\ constant[/tex]

[tex]N_{Mn}=3.32*10^{-23}*6.023*10^{23}[/tex]

[tex]N_{Mn}=20[/tex]

Other Questions
A 20kg patient requires a 500 mg dose of a particular drug solution contains 100 mg/tsp. How many milliliters of the solution should be given to the patient to deliver the required dose? Determine the coefficient of x^3 in the expansion of (1 x)^5(1 + 1/x)^5 a two-digit number is 5 times as large as the sum of its digits. What number is it? 17. Write an equation in slope-intercept form for the line that passes through (0,6) andis parallel to the line described by y = 2x +3. What is the sum of the greatest number and least number formed by the digits 4,7,0and 9 Complete the sentences by identifying the correct missing words. Alph and beta particles originate from the Choose... . Protection from radiation is necessary because if radiation passes through the body it can damage Choose... . Exposure to radiation can be limited by increasing the Choose... from the radioactive source. In a right angle triangle ABC angle B=90 and AB+BC= 31cm AB-BC=17 cm the find sinA,cosA,sinC,cosC. I need help please guys thank you Where is the center of mass of homogeneous body which has a regular Which of the following is equivalent to (16^3/2)^1/2 Which of the following describes a positive correlation?As the number of hours spent on homework increases, the tests scores increase.As the number of apples eaten per year increases, the number of times visiting the doctor every year remains the same.As the number of times going to bed early increases, the number of times waking up late decreases.The amount of time a team spent practicing increases, the number of games lost in a season decreases.THIS IS A MULTIPLE CHOICE QUESTION Any point on the budget constraint Multiple Choice Gives the consumer the highest level of utility. Represent a combination of two goods that are affordable. Represents combinations of two goods that yield the same utility. Reflects the price of one good divided by the price of another good. Trousers are sold at $40. During a clearance sale, the trousers are sold for $30. What is the markdown rate?A.20%B.25%C.30%D.33% hey I'm trying to reachout for someone and that person knows who it is and if you see this message please, comment below and my question is Misdemeanors do not include any violent crimes or crimes with the potential to harm others.Is the previous statement true or false? Identify the mood of the verb in this sentence.All of the spectators crowded through the exits before the show ended.O indicativeO imperativeO subjunctiveO conditional FORMULAS OF IONIC COMPOUNDSFIND: POSITIVE ION, NEGATIVE ION AND FORMULA IN:NAME:Sodium chlorideMagnesium chlorideCalcium oxideLithium phosphideAluminum sulfideCalcium nitrideIron(III)chlorideIron(II)oxideCopper(I)sulfideCopper(II)nitrideZinc oxideSilver sulfidePotassium carbonateSodium nitrateCalcium bicarbonateAluminum hydroxideLithium phosphatePotassium sulfate A man was negligently driving down the road, not paying attention to where he was going. Because of this, he hit and seriously injured a pedestrian who was lawfully crossing the street. The accident was witnessed by the pedestrian's friend who was standing on the sidewalk. As a result of seeing the pedestrian injured, her friend suffered extreme emotional distress that physically affected her nervous system. The friend brings suit against the driver for negligent infliction of emotional distress in a jurisdiction that has adopted the majority approach in bystander cases. Will the friend prevail Two more than three times a number is 18. 2/4+1=1/6 x-7 what is the value of x in this epuation sin(180+0).cos(180+0)/cos(180+0).sin(180-0)