Answer:
A. -10,000
Explanation:
When x approaches zero, the graph tells us that F(x) either becomes extremely large or extremely small. The best answer is therefore A: -10,000. Best, because we aren't given the exact value of x, but clearly the other results require that x be greater than 1 or less than -1, which is far from zero.
Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please
Answer:
1-bromo-6-chloro-5-methylheptane
Explanation:
There are 3 substituents, 1 chlorine, 1 bromine, and 1 methyl group.
The longest carbon chain consists of 7 carbons.
There are no double bonds, based on the saturation and substituents.
So you have a 1-bromo-6-chloro-5-methylheptane.
Hope that was the brainliest answer!
The cutoff frequency for a certain element is 1.22 x 1015 Hz. What is its work function in eV?
Hint: 1 eV 1.60 x 10-19 J
=[?] eV
someone please teach me how to solve this its gonna make me cry
The work function of the metal is obtained as 5.1 eV
What is the cutoff frequency?The cutoff frequency is the frequency below which photo electric effect can not occur as electrons are not removed from the metal surface.
Now;
fo = 1.22 x 10^15 Hz
Wo = hfo
Wo = 6.6 * 10^-34 * 1.22 x 10^15
Wo = 8.1 * 10^-19 J
If 1 eV = 1.60 x 10-19 J
x eV = 8.1 * 10^-19 J
x = 8.1 * 10^-19/ 1.60 x 10-19
x = 5.1 eV
Learn more about cutoff frequency:https://brainly.com/question/14378802
#SPJ1
what is the approximate distance from the far edge of one lobe to the far edge of the other?
The approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.
What is distance between far edge of two lobes in solar system?
This distance measures the outer space between the edges of the two lobes in a given time.
The approximate distance from the far edge of one lobe to the far edge of the other in a solar system is about 2,100,000 light-years.
Thus, the approximate distance from the far edge of one lobe to the far edge of the other is 2,100,000 light-years.
Learn more about distance here: https://brainly.com/question/2854969
#SPJ11
3.the three major types of radioactive decay of an unstable nucleus are alpha particles, beta particles, and gamma rays.
explain how alpha decay works and how it causes a transmutation. be sure to note all changes to the nucleus in your explanation.
write the equation for the alpha decay of uranium-234.
explain how beta decay works and how it causes a transmutation. be sure to include all changes to the nucleus in your explanation.
write the equation for the beta decay of iodine-131.
a) Alpha decay occurs when an unstable nuclide emits an alpha particle, (which is just a helium-4 atom), which contains 2 protons and 4 neutrons. This means that transmutation has occurred (since a nuclide of a different element will be produced), and this newly produced nuclide will have 2 fewer protons and 4 fewer neutrons than the original nuclide.
b) [tex]^{234}_{92} \text{U} \longrightarrow ^{4}_{2} \text{He}+^{230}_{90} \text{Th}[/tex]
c) Alpha decay occurs when an unstable nuclide emits a beta particle, (also known as an electron). This causes transmutation (since a nuclide of a different element will be produced), and this newly produced nuclide will have 1 more proton than the original nuclide.
d) [tex]^{131}_{53} \text{I} \longrightarrow ^{0}_{-1} \beta+^{131}_{54} \text{Xe}[/tex]
1s22s²2p63s23p64s²3d104p5
Which element is this?
Answer: bromine
Explanation:
There are a total of 2+2+6+2+6+2+10+5=35 electrons, meaning there are 35 protons. The element with atomic number 35 is bromine
What kind of air mass will bring cold, dry weather as it moves toward an area
Answer:
i think the answer is Continental polar air masses
Explanation:
Please check the photo! I will award brainliest ONLY FOR PERSON WHO GIVES A LEGITIMATE ANSWER!!! Thank you :)
From the calculations, the percentage of the mineral left is 6.25%.
What is half life?The term half life refers to the time that it takes for only half of the number of radioactive isotopes to remain.
From;
N/No = (0.5)^t/t1/2
N = ?
No = ??
t = 2000
t1/2 = 500
N/No =(0.5)^(2000/500)
N/No = 0.0625
Thus the percent left = 0.0625 * 100 = 6.25%
Learn more about half life of a nucleus:https://brainly.com/question/23518766
#SPJ1
Which best explains why a firework being ignited is an example of an exothermic reaction and not an endothermic
reaction ?
O The fireworks produce colors.
O The fireworks give off heat.
O Igniting the fireworks requires energy.
O Igniting the fireworks makes an odor.
The best explanation for why a firework being ignited is an example of an exothermic reaction and not an endothermic reaction is:
The fireworks give off heat.
Heat is emitted into the environment in an exothermic reaction. When a firework is lit, it undergoes a number of chemical processes inside the firework combination, which produces gases and produces a great deal of heat. Fireworks' distinctive visual display and audible effects are produced when heat is released as light and sound.
In contrast, heat is taken from the environment during an endothermic reaction. If a reaction were endothermic, it would need an outside energy source to continue, and because it would be absorbing heat from its environment, it would feel chilly to the touch.
However, because they release heat and energy and brighten the night sky, fireworks are instances of exothermic reactions.
To know more about heat:
https://brainly.com/question/32136211
#SPJ2
Which of the following species of fish have cartilaginous skeletons?
Answer:
sharks have cartilaginous skeletons
Explanation:
Sharks are an example
what can we use to help us predict the results of reaction when we put metals into competition?
The activity series of metals as well as the electrode potential of metals can be used to compare the reactivity of metals.
What is used in comparing reactivity of metals?The reactivity of metals can be compared using their electrode potentials which is a measures of the ability of the metal to donate electrons to another metal.
When comparing the reactivity of metals, the metal with the lesser negative electrode potential will be more reactive than another with a greater negative or positive electrode potential.
Therefore, the activity series of metals as well as the electrode potential of metals can be used to compare the reactivity of metals.
Learn more about activity series of metals at: https://brainly.com/question/17469010
#SPJ12
There are 8.421 g of dry ZnSO4 and
6.579 g H₂O in the sample.
Step 2: Determine the moles of water and anhydrous compound.
Zn = 65.38 g/mol, S = 32.07 g/mol,
H = 1.01 g/mol, O = 16.00 g/mol
How many moles of ZnSO4 are present?
[?] mol ZnSO4
The number of moles of H₂O is 0.36 mol.
The number of moles of LiClO₄ is 0.0521 mol.
What are moles?Mole is an important standard unit used for the measurement of large quantities of atoms, molecules, or other particles. One mole is equal to 6.022×10²³ units.
The number of moles of a substance is calculated by:
Moles =[tex]\frac{mass}{molar \;mass}[/tex]
To find the number of moles of H₂O:
Mass of H₂O in the sample = 6.579 g
The molecular weight of H₂O = 18.02g
Moles = [tex]\frac{mass}{molar \;mass}[/tex]
Moles = [tex]\frac{6.579 g}{18.02g}[/tex]
Moles = 0.36
To find the number of moles of [tex]ZnSO_4[/tex]:
Mass of [tex]ZnSO_4[/tex] in the sample = 8.421 g
The molecular weight of [tex]ZnSO_4[/tex]= 161.47 g/mol
Moles =[tex]\frac{mass}{molar \;mass}[/tex]
Moles = [tex]\frac{8.421 g}{161.47 g/mol}[/tex]
Moles = 0.0521 moles
Learn more about moles here:
https://brainly.com/question/8455949
#SPJ1
An exergonic reaction __________ free energy, and an endergonic reaction __________ free energy.
Answer:
An exergonic reaction releases free energy, and an endergonic reaction absorbs free energy.
Explanation:
hope it helps
In photosynthesis, plants use energy from the sun to produce glucose, c6h12o6 , and oxygen from the reaction of carbon dioxide and water.
6co2 + 6h2o --> c6h12o6 + 6o2
what mass, in grams, of glucose is produced when 3.00 mol of water react with carbon dioxide?
Answer: 324 g (to 3 sf)
Explanation:
Based on the coefficients of the equation, we know that when 3.00 mol of water is consumed, 3.00 mol of carbon dioxide is also consumed.
The atomic mass of carbon is 12.011 g/mol.The atomic mass of oxygen is 15.9994 g/mol.Thus, the formula mass of carbon dioxide is:
[tex]6(15.9994)+12.011=108.0074[/tex] g/mol.
Thus, 3.00 mol has a mass of (108.0074)(3.00)=324 g (to 3 sf)
How many atoms are present in 2.1 moles of Fe
Answer:
1.3 x 10²⁴ atoms Fe
Explanation:
To convert moles to atoms, you need to multiply your given value by Avogadro's Number. This causes the conversion to occur because Avogadro's Number exists as a ratio. It is the ratio that allows for the cancellation of units during multiplication. This is why atoms should be in the numerator of your conversion. The final answer should have 2 sig figs to reflect the given value.
Avogadro's Number:
1 mole = 6.022 x 10²³ atoms
2.1 moles Fe 6.022 x 10²³ atoms
--------------------- x ------------------------------- = 1.3 x 10²⁴ atoms Fe
1 mole
What would cause a nucleus to be unstable?
A. An unequal number of protons and electrons
B. Too few quarks within the nucleus of the atom
C. An equal number of protons and neutrons
D. An imbalance between the electrostatic and strong nuclear forces
SUBMIT
The instability of the nucleus is due to an imbalance between the electrostatic and strong nuclear forces, which is option D.
A nucleus can become unstable if there is an imbalance between the electrostatic repulsion between protons and the strong nuclear force that holds the nucleus together. The electrostatic repulsion between protons tends to push them apart, while the strong nuclear force acts to hold the protons and neutrons together.
If the number of protons in the nucleus is too large, the electrostatic repulsion becomes stronger, making the nucleus unstable. Similarly, if the number of neutrons is too large or too small compared to the number of protons, it can also lead to an imbalance in the forces and instability of the nucleus.
Therefore, the correct option is option d.
Learn more about the nucleus here:
https://brainly.com/question/11801308
#SPJ 7
What is the mass in grams of 4.85 x 10^22 Al atoms? (Report your answer to two places past the decimal
Answer:
2.17 gm Al
Explanation:
First, find the number of moles . Then multiply by the mole weight of aluminum.
# moles = 4.85 x 10^22 / 6.022 x 10^23 = .08053 moles
.0805 moles * 26.981 gm/mole = 2.173 gm
In 2007, the population of Canada was 1.26 × 108, the population of Mexico was 10.6 × 107, the population of Brazil was 13.6 × 107, and the population of China was 1.86 × 109. Which two countries have the highest population?
A. Canada and China
B. Mexico and China
C. China and Brazil
D. Brazil and Mexico
A 2. 75-l container filled with co2 gas at 25°c and 225 kpa pressure springs a leak. When the container is re-sealed, the pressure is 185 kpa and the temperature is 10°c. How many moles of gas were lost?.
Answer:
Moles Lost = 0.0335 moles
Explanation:
This type of question requires the Ideal Gas Law equation. The equation looks like this:
PV = nRT
In this formula,
-----> P = pressure (kPa)
-----> V = volume (L)
-----> n = number of moles
-----> R = constant (8.314 L*kPa/mol*K)
-----> T = temperature (K)
(Step 1)
To find how many moles were lost, you first need to find how many moles you had to begin with. This can be done by plugging the starting values into the equation and solving for "n". But first, you need to convert Celsius to Kelvin (by adding 273.15).
P = 225 kPa R = 8.314 L*kPa/mol*K
V = 2.75 L T = 25°C + 273.15 = 298.15 K
n = ?
PV = nRT
(225 kPa)(2.75 L) = n(8.314 L*kPa/mol*K)(298.15 K)
618.75 = n(2478.8191)
0.250 = n
(Step 2)
Next, you need to find the number of moles in the container after it has been re-sealed. The volume is the same because the container did not change. The process should be the same as above.
P = 185 kPa R = 8.314 L*kPa/mol*K
V = 2.75 L T = 10°C + 273.15 = 283.15 K
n = ?
PV = nRT
(185 kPa)(2.75 L) = n(8.314 L*kPa/mol*K)(283.15 K)
508.75 = n(2354.1091)
0.216 = n
(Step 3)
Finally, you can find the number of moles lost by subtracting the final amount of moles from the original amount. When doing this calculation, I used the value of the moles saved in my calculator (with more decimal places) to get a more accurate number.
Moles Lost = Initial Moles - Final Moles
Moles Lost = 0.250 moles - 0.216 moles
Moles Lost = 0.0335 moles
Compare
Ion and Radical
Atom and molecule
Organic and inorganic compounds
Answer:
'An ion has a non-zero electric charge. A radical has an atom with unfilled electron shells and so is very reactive, but is electrically neutral.'
'Atoms are single neutral particles. Molecules are neutral particles made of two or more atoms bonded together.'
'The primary difference that lies between these organic compounds and inorganic compounds is that organic compounds always have a carbon atom while most of the inorganic compounds do not contain the carbon atom in them.'
Organic and inorganic compounds:
Similarities:::---
1) In both organic and inorganic compound, the elements joining in making compound complete their octet.
2) Organic compound shows isomerism (R/S , E/Z , cis/trans, enantiomers, diastereomers, etc), just as inorganic compound do (Δ/Λ, enantiomers, R/S enantiomers, cis/trans, fac/mer isomers, etc).
3) Organic compound and inorganic compounds can be very active in chemical reactions, e.g. organolithium reagents could be flammable or even pyrophoric (generally stored under 10°C), while inorganic reagents like in this paper are quite rapid...
Differences:::---
1) Organic compound are very long in size so they can make polymer but inorganic compound are not very long but its structure might me complex.
2) The boiling,melting point of organic compound is lass than inorganic compound.
3) Organic compound always contains carbon but inorganic compounds might not.
4) Organic compound
_____________________________
Ion and Radical Atoms:
In some sense they are a bit similar. The main difference is that a neutral radical has no charge imbalance between the protons and electrons, but the cation or anion does.
Ions are written with an explicit charge because of that charge imbalance, but radicals may or may not have an imbalance of charge. Just because a molecule is a radical doesn't mean it's neutral.
For example, if you shoot 2-pentanone with an electron beam for Electron "Impact" Mass Spectroscopy, where you essentially study molecules whose structures break into smaller pieces as a result of interacting with stray electrons to identify the molecules, you get a cationic radical (middle, or far right of the following diagram).
A 126.1-gram block of granite at 92.6°c is dropped into a tub of water at 24.7°c in an isolated system. the final temperature of both the granite and the water is 51.9°c. the specific heat capacity of granite is 0.795 joules/gram degree celsius, and the specific heat capacity of water is 4.186 joules/gram degree celsius. the granite block transferred of energy, and the mass of the water is .
The granite block transferred 4,080 joules of energy, and the mass of the water is 35.8 grams.
How we calculate heat transfer of any system ?Heat transfer in any system can be calculated as follow:
q = mCΔT
Given ;
m = mass of granite = 126.1 g C = specific heat of granite = 0.795 joules/gram degree CelsiusΔT = change in temperature of granite = 51.9 °C - 92.6 °C = -40.7 °CPutting all the values in folowing equation,
q = mCΔT
we get
q = 126.1 × 0.795 × -40.7 = -4080 J
Now by using same formula, we can also calculate the mass of water in the following way:
m = q / CΔT
where
C = specific heat of water = 4.186 joules/gram degree Celsius ΔT = change in temperature of water = 51.9 °C – 24.7 °C = 27.2 °CPutting all these values ;
m = -4080 / 4.186 × 27.2 = 35.8 g.
Hence, 4,080 joules of energy is transferred by granite block and 35.8 g is the mass of water.
To learn more about heat transfer here ;
brainly.com/question/18980657
#SPJ1
How can i calculate the concentration of 2.357g of sodium chloride in 75ml solution
Answer:
See below
Explanation:
Simply : 2.357 g / 75 ml = .03142 gm/ml or 31.42 gm / liter
An educated guess which explains observations is called:
a a law
b an experiment
c a hypothesis
d a variable
Answer:
c. a hypothesis is the correct answer
Explanation:
Grams in 1.083e+24
Molecules Na BR
Please help explain why
Answer:
185 gms o NaBr
Explanation:
Na Br mole weight = 22.989 +79.904 = 102.893 gm/mole
1.083 x 10^24 molecules / 6.022 x 10^23 molecules / mole = 1.798 moles
102.893 * 1.798 = 185 gms
Only certified electricians are allowed to work on facility electrical system?
What conditions make AG always positive?
Answer: when a reaction absorbs heat or decreases the entropy of the system,
Explanation: :)
The AP Biology teacher is measuring out 638.0 g of dextrose (C6H12O6) for a lab. How many moles of dextrose is this equivalent to?
The AP Biology teacher is measuring out 638.0 g of dextrose (C6H12O6) for a lab the moles of dextrose is this equivalent to is 3.6888 moles.
What are moles?A mole is described as 6.02214076 × 1023 of a few chemical unit, be it atoms, molecules, ions, or others. The mole is a handy unit to apply due to the tremendous variety of atoms, molecules, or others in any substance.
To calculate molar equivalents for every reagent, divide the moles of that reagent through the moles of the restricting reagent. The calculation is follows:
655/12 x 6 + 12+ 16 x 6 = 655/ 180 = 3.6888 moles.Read more about moles:
https://brainly.com/question/24322641
#SPJ1
Which phrase describes a homogeneous catalyst?
Answer:
It is in the same phase as the reactants.
Explanation:
i took the test
It is the year 2040, and you are a research scientist. The amount of sunlight that reaches the earth has been drastically reduced due to a major event like pollution, fires, or volcanoes. Farmers are asking you for help to save their failing crops.
Which type of electromagnetic wave has less energy than a microwave?
OA. Ultraviolet wave
OB. Radio wave
O C. An X-ray
OD. Infrared wave
A 35. 0-l steel tank at 20. 0?c contains acetylene gas, c2h2, at a pressure of 1. 39 atm. Assuming ideal behavior, how many grams of acetylene are in the tank?.
52.66 grams of acetylene are in the tank.
PV=nRT is the formula for ideal gases, where P is the pressure and R is the constant and T is the temperature (P is 1.39 atm in this case)
Volume = 35.0 L
Gas constant = 0.08206 L.atm/K.mole
Temperature = 20.0 °C = 293 °C
We also know that we can apply the formula ;
Number of mole(n) = [tex]\frac{MmPV}{RT}[/tex]
m = ( 26.04 × 1.39 × 35 )/ (0.08206 × 293.15)
m = 52.66 g
Thus, the mass is 52.66 grams.
Learn more about ideal gases here:
https://brainly.com/question/12281987
#SPJ4