Find the number in which 8 is in tenths place.
8945.4534
456.89732
9738.45621
6875.1234

Answers

Answer 1

the number in which 8 is in tenth place is

6875.1234

plese mark me as braniliest

Answer 2
It’d be the second option: 10ths is always the point after the decimal, and in the second option 8 is after the decimal

Related Questions

please answer this question!!​

Answers

equilateral triangle
Yh equilateral triangle what he said

What is the value of x in the equation
3x - y = 30, when y = 15?

Answers

Answer:

x = 15

Step-by-step explanation:

3x - y = 30

Given;

y = 15

To find;

value of 'x'

Putting the value of y in the given equation;

3x - 15 = 30

3x = 30 + 15

3x = 45

x = 45/3

x = 15

Answer:

x = 15

Step-by-step explanation:

3x - y = 30let y = 153x - 15 = 303x = 30 + 153x = 45x = 45/3x = 15Let's check:3x - y = 303(15) - 15 = 3045 - 15 = 3030 = 30

[tex]\tt{ \green{P} \orange{s} \red{y} \blue{x} \pink{c} \purple{h} \green{i} e}[/tex]

the first three terms of an arithmetic progression are m,12 and n . Find the value of m+n​

Answers

Answer:  24

===========================================

Explanation:

There are a few approaches. Here's one way to solve.

Let d be the common difference between the terms.

We add d to each term of this arithmetic sequence to get the next term.

First term = mSecond term = 12 = m+dThird term = n = (m+d)+d = m+2d

Focusing on the second equation, we can solve for d like so

m+d = 12

d = 12-m

This is then plugged into the third equation

n = m+2d

n = m+2(12-m)

n = m+24-2m

n = 24-m

Therefore,

m+n = m+(24-m) = 24

It turns out that it doesn't matter what m and n are because m+n is always equal to 24 in this case.

-----------------

A more concrete example:

Let's say m = 2. We won't set up n just yet but we'll be able to compute it fairly soon.

Since m = 2, this means d = 12-m = 12-2 = 10. This is the gap between adjacent or neighboring terms.

If d = 10, then the third term must be n = 12+d = 12+10 = 22

We can then see that m+n = 2+22 = 24

-----------------

I'll do another example:

m = 5

d = 12-m = 12-5 = 7

n = 12+d = 7 = 19

m+n = 5+19 = 24

Whenever in doubt, or if you get stuck, it helps to come up with actual numeric values to hopefully clear things up.

-----------------

An alternative way to get the answer:

Let's try to determine what m+n is actually saying. We have 12 right in the middle of the first term (m) and third term (n). Because the gap between the numbers is the same (that being d), we know that 12 is the midpoint of m and n. It might help to draw out a number line to see what's going on.

The midpoint of m and n is (m+n)/2

Set this equal to 12 and isolate the "m+n"

(firstTerm+thirdTerm)/2 = second term

(m+n)/2 = 12

m+n = 2*12

m+n = 24

So in general, if the first three terms of the arithmetic sequence are m, k, n, then m+n = 2k.

BRAINLEST IF CORRECT

Answers

Answer:

422.39

Step-by-step explanation:

[tex]A = \pi r^2\\A = 144\pi \\\\144\pi -30 = 422.39[/tex]

use a calculator for the above and round

help please ITS OF TRIGONOMETRY
PROVE ​

Answers

Answer:

The equation is true.

Step-by-step explanation:

In order to solve this problem, one must envision a right triangle. A diagram used to represent the imagined right triangle is included at the bottom of this explanation.  Please note that each side is named with respect to the angle is it across from.

Right angle trigonometry is composed of a sequence of ratios that relate the sides and angles of a right triangle. These ratios are as follows,

[tex]sin(\theta)=\frac{opposite}{hypotenuse}\\\\cos(\theta)=\frac{adjacent}{hypotenuse}\\\\tan(\theta)=\frac{opposite}{adjacent}[/tex]

One is given the following equation,

[tex]\frac{sin(A)+sin(B)}{cos(A) +cos(B)}+\frac{cos(A)-cos(B)}{sin(A)-sin(B)}=0[/tex]

As per the attached reference image, one can state the following, using the right angle trigonometric ratios,

[tex]sin(A)=\frac{a}{c}\\\\sin(B)=\frac{b}{c}\\\\cos(A)=\frac{b}{c}\\\\cos(B)=\frac{a}{c}[/tex]

Substitute these values into the given equation. Then simplify the equation to prove the idenity,

[tex]\frac{sin(A)+sin(B)}{cos(A) +cos(B)}+\frac{cos(A)-cos(B)}{sin(A)-sin(B)}=0[/tex]

[tex]\frac{\frac{a}{c}+\frac{b}{c}}{\frac{b}{c}+\frac{a}{c}}+\frac{\frac{b}{c}-\frac{a}{c}}{\frac{a}{c}-\frac{b}{c}}=0[/tex]

[tex]\frac{\frac{a+b}{c}}{\frac{a+b}{c}}+\frac{\frac{b-a}{c}}{\frac{a-b}{c}}[/tex]

Remember, any number over itself equals one, this holds true even for fractions with fractions in the numerator (value on top of the fraction bar) and denominator (value under the fraction bar).

[tex]\frac{\frac{a+b}{c}}{\frac{a+b}{c}}+\frac{\frac{b-a}{c}}{\frac{a-b}{c}}[/tex]

[tex]\frac{\frac{a+b}{c}}{\frac{a+b}{c}}+\frac{\frac{-(a-b)}{c}}{\frac{a-b}{c}}[/tex]

[tex]1+(-1)=0[/tex]

[tex]1-1=0[/tex]

[tex]0=0[/tex]

If f(x) = 3x2 - 7x, what is the ordered pair for x = 1 ?
A (1.4)
B (1,-4)
C (1,7)
D(1,10)

Answers

Answer:

b option is the weight answer I think.

Suppose f(x) = x^2. what is the graph of g(x)

Answers

Answer:  g(x) = (1/16)*x^2

========================================================

Explanation:

Plug x = 4 into f(x) to find that f(4) = 16.

The output y = 16 drops to y = 1. We've multiplied by 1/16 to get this to happen.

In other words,

g(x) = (1/16)*f(x)

g(4) = (1/16)*f(4)

g(4) = (1/16)*16

g(4) = 1

So we can say that,

g(x) = (1/16)*f(x)

g(x) = (1/16)*x^2

and furthermore, we can say f(x) has been vertically compressed by a factor of 16.

Determine the perimeter of the following figure
pls help! ill mark brainliest

Answers

Answer:

Step-by-step explanation:

Use Pythagorus to find the length of the unmarked length

c^2 = a^2 + b^2

a = 5

b = 17 -10 = 7

c = ?

c^2 = 5^2 + 7^2

c^2 = 25 + 49

c = sqrt(74)

c =8.602

P = 5 + 10 + 17 + 8.602

P = 40.602

Làm giúp em câu 3+4 trắc nghiệm và bài 2+3 ạ

Answers

Trắc nghiệm 3c, 4b
Tự luận 2a -48/5
2b x= 1/7
x=4/25

find the missing length for the following trapezoid​

Answers

Answer:

KL = 18

Step-by-step explanation:

The midsegment TU is half the sum of the parallel bases , that is

[tex]\frac{KL+JM}{2}[/tex] = TU

[tex]\frac{KL+34}{2}[/tex] = 26 ( multiply both sides by 2 )

KL + 34 = 52 ( subtract 34 from both sides )

KL = 18

Instructions: Find the angle measures given the figure is a rhombus.

Answers

Answer:

m <1 = 147

m <2 = 90

Step-by-step explanation:

In rhombus diagonals are perpendicular to each other so

m <2 = 90

m < 1 = 180- 33

= 147

Answered by Gauthmath

The required angle of the rhombus m∠1 = 57° and m∠2 = 90°.


Given that,
A figure of a rhombus is shown,
An angle of 33° is given,
m∠1 and m∠2 is to be determined.

What is the triangle?

The triangle is a geometric shape that includes 3 sides and sum of the interior angle should not greater than 180°.

What is the angle?

The angle can be defined as the one line inclined over another line.

Here, the rhombus has been shown with an angle of 33° of the side with one of the diagonal.

Since the diagonal of the rhombus bisect each other at an angle of 90 so the angle m∠2 = 90  and the sum of the interior angle of a triangle is 180. So,
m∠1 + 33 + 90 = 180
m∠1 = 180 - 123
m∠1 = 57

Thus, the required angle of the rhombus m∠1 = 57° and m∠2 = 90°.

Learn more about Angles here:
https://brainly.com/question/13954458

#SPJ5




(1)
A piece of wire is bent to form a square of area 121 cm?
Calculate:
a)
The length of each side of the square
b)
The perimeter of the square

Answers

Step-by-step explanation:

that is really a problem ?

come on !

you know, the area of a square is side length × side length = length²

that is basically all of us learn as the very first thing when we are learning about squaring and multiplication.

how do we get the regular side length out of length² ?

we pull the square root. you have a calculator (at least on your computer, cell phone,...).

sqrt(121) = .... .... .... 11 ! tada !

and the perimeter of a square ... you really have to ask ?

it is the way all around the whole square. you need to go along every one of the 4 sides.

so, it is side length × 4 = 11×4 = 44 cm

again - you really needed help with THAT ?

Can someone please help me with these work rate questions!

Answers

Answer:

1/8 rooms per hour

Step-by-step explanation:

We are given that Beatrice can wallpaper 1 room in 8 hours. The work rate is how many rooms Beatrice can wallpaper in one unit of time (in this case, one hour).

Another way of saying 1 room in 8 hours is 1 room/8 hours. We want to find the rate over one hour, so we want to make the denominator ( in hours) equal to 0.

With fractions, we can divide/multiply both the numerator and denominator by the same amount, and still keep the fraction. Therefore, we want to make 8 hours 1 hour by multiplication or division. Since anything divided by itself is equal to 1, we can say that 8/8 is equal to 1. Therefore, we can divide both the numerator and denominator by 8 to get

(1 room/8) = (8 hours / 8)

= (1/8 rooms) / 1 hour

Therefore, the work rate is 1/8 rooms per hour

A hot air balloon is released into the air. During its straight ascent, the angle of elevation was 15° and, 3 minutes later, the angle of elevation increased 20°. How fast is the balloon traveling, in km/h, if the angle measurements were taken 300m away from the launch site?

Answers

Answer:

The speed of the balloon is 0.16 m/s.

Step-by-step explanation:

CD = 300 m

Let AD = x

AB = y

time, t = 3 min

Triangle, ADC

[tex]tan 15 = \frac{AD}{BC}\\\\0.27 \times 300 = x \\\\x = 80.4 m[/tex]

Triangle, BCD

[tex]tan 20 = \frac{BD}{BC}\\\\0.36 \times 300 = x + y \\\\x + y = 109.2 m[/tex]

So, y = 109.2 - 80.4 = 28.8 m

Speed = 28.8/180 = 0.16 m/s

WILL GIVE BRAINLIEST TO THE CORRECT ANSWER!!


Suppose you obtain a five-year lease for a Porsche and negotiate a selling price of $146,000. The annual interest rate is 8.4%, the residual value is $75,000, and you make a down payment of $3000. Find each of the following.

A.) The net capitalized cost.

B.) The money factor. (Rounded to four decimal places)

C.) The average monthly finance charge. (Rounded to the nearest cent).

D.) The average monthly depreciation. (Rounded to the nearest cent.)

E.) The monthly lease payment. (Rounded to the nearest cent.)

Answers

Answer:

Look down below

Step-by-step explanation:

A.)Net capitalized cost=146,000-3000= $143,000

Net capitalized cost = 143,000

B.)Money factor=8.4/100 over 24=0.084/24=0.0035

Money Factor= 0.0035

C.)Average monthly finance charge= (143,000+75,000)x 0.0035= 218,000 x 0.0035=$763

Average Monthly Finance Charge= $763

D.)Average monthly depreciation= 143,000-75000/5 x 12=68000/60=$1133.33

Average monthly deprecation= $1133.33

E.)monthly lease payment=1133.33/5= $226.66

Monthly lease payment= $226.66

Visualise 4.26 on the number line, up to 4 decimal places.

Answers

Answer:

is it 4.2626

Step-by-step explanation:

let me know if it right

 If 2^x-4 = 4^x-6 , then value of x is?​

Answers

Answer: [tex]x=1[/tex]

Step-by-step explanation:

[tex]2^x-4=4^x-6[/tex] is the equation that you've given us.

Now if we plot these two equations on the graph we notice there's an intersection at (1,-2). Therefore meaning that [tex]x=1[/tex].

We can prove that by doing the following calculations to prove that both sides are equal to each other.

The left side of the equal sign:

Step 1: Write the equation down:

[tex]2^x-4[/tex]

Step 2: Substitute x for the numerical value we found.

[tex]2^1-4[/tex]

Step 3: Find the square of [tex]2^1[/tex], which is itself, 2.

[tex]2-4[/tex]

Step 4: Subtract 2 from 4. Which is a negative number, thus being -2.

[tex]-2[/tex]

The right side of the equal sign:

Step 1: Write the equation down:

[tex]4^x-6[/tex]

Step 2: Substitute x for the numerical value we found.

[tex]4^1-6[/tex]

Step 3: Find the square of [tex]4^1[/tex], which is itself, 4.

[tex]4-6[/tex]

Step 4: Subtract 4 from 6. Which is a negative number, thus being -2.

[tex]-2[/tex]

We know that [tex]x=1[/tex] because when substituting x with 1, we get -2 on both sides. Therefore making this statement true and valid.

[tex]-2=-2[/tex]

someone answer this please

Answers

Answer:

720º

Step-by-step explanation:

To find the total amount of interior angles in any polygon, we have to use the formula, (n-2)*180.

Here, the n is the number of sides the polygon has. In this case, your polygon has 8 sides. Therefore it would be (8-2)*180 --> 4*180 = 720º.

Answer:

the answer is 720. Please give me brainliest

WILL MARK BRAINLIEST!! Multiply. −1/2⋅3/4 a)−2/3 b) −3/8 c) 3/8 d)2/3

Answers

Answer:  B)  -3/8

Explanation:

When multiplying fractions, we multiply the numerators together, and the denominators are handled separately.

The numerators in this case are -1 and 3. They multiply to -3

The denominators multiply to 2*4 = 8

So that's how we end up with -3/8 as the final answer

This fraction cannot be reduced any further, because 3 and have 8 no factors (other than 1) in common.

What is the resulting ordered pair if the value of the independent variable is 2?
f(x) = -5x + 4

Answers

Answer:

y= -6

x = 2

(2,-6)

Step-by-step explanation:

Indepedent variable = x = 2

Plug 2 in for x

f(2) = -5(2) + 4

-10 + 4 = -6

y = -6

Mark Brainliest please

Answer : x= 2 & y= -6

f(x) = –5x + 4
Putting x=2 f(x) = –5(2) + 4 f(x) = -10+4 = -6

So, x=2 , y=-6

According to above explanation, (2, –6) , is the correct answer.

Use the grouping method to factor this polynomial.
x2 + 2x2 + 12x + 24
O A. (x2 +12)(x+2)
O B. (x2 +6)(x+2)
C. (x² + 2)(x+6)
O D. (x2 + 2)(x+12)

Answers

Answer:

A. (x² + 12)·(x + 2)

Step-by-step explanation:

Question; Factor x³ + 2·x² + 12·x + 24, using the grouping method

The given polynomial is presented as follows;

x³ + 2·x² + 12·x + 24

Using the grouping method, we have;

(x³ + 2·x²)( + 12·x + 24)

Which gives;

x²·(x + 2) + 12·(x + 2)

Therefore, we get;

(x² + 12)·(x + 2)

The correct option is A. (x² + 12)·(x + 2).

log 55 is the power to which ---- must be raised in order to produce a value of 55

Answers

Answer:

10

Step-by-step explanation:

just took the quiz

Find the value of x in the triangle shown below.

Answers

This is a isoceles triangle so base angles will be equal.

Therefore

ATQ

55 + 55 + x = 180

110 + x = 180 (Angle Sum Property)

x = 180 - 110

x = 70

Therefore x° = 70°

Answered by Gauthmath must click thanks and mark brainliest

Answer:x°=70°

Step-by-step explanation:

This is an isoceles triagle because the values on the sides of the figure are the same. Therefore the base angles will be equal.

55+55+x=180

110+x=180

Next, you will subtract 110 from both sides.

110+x=180

-110     -110

x°=70°

In the SuperLottery, three balls are drawn (at random) from ten white balls numbered from $1$ to $10$, and one SuperBall is drawn (at random) from ten red balls numbered from $11$ to $20$. When you buy a ticket, you choose three numbers from $1$ to $10,$ and one number from $11$ to $20$.

If the numbers on your ticket match the three white balls and the red SuperBall, then you win the jackpot. (You don't need to match the white balls in order). What is the probability that you win the jackpot?

Answers

This question is solved using probability concepts.

A probability is given by the number of desired outcomes divided by the number of total outcomes.The order in which the balls are chosen don't matter, which means that the combinations formula is used to find the number of outcomes.

Doing this, we get that:

[tex]\frac{1}{1200}[/tex] probability that you win the jackpot.

------------------------------------------

Combinations formula:

[tex]C_{n,x}[/tex] is the number of different combinations of x objects from a set of n elements, given by the following formula.

[tex]C_{n,x} = \frac{n!}{x!(n-x)!}[/tex]

----------------------------------------------------

Total outcomes:

3 white from a set of 10(numbered from $1 to $10).1 red from a set of 10(numbered from $11 to $20).

Thus:

[tex]T = C_{10,3}C_{10,1} = \frac{10!}{7!3!} \times \frac{10!}{1!9!} = 120 \times 10 = 1200[/tex]

Desired outcomes:

The correct balls, order does not matter, so only one outcome, that is, [tex]D = 1[/tex]

What is the probability that you win the jackpot?

[tex]p = \frac{D}{T} = \frac{1}{1200}[/tex]

[tex]\frac{1}{1200}[/tex] probability that you win the jackpot.

A similar question is given at https://brainly.com/question/23966554

Answer:

6/7200=1/1200

Step-by-step explanation:

[3! ways to arrange the three white balls] over [10x9x8 ways to pick three white balls and 10 ways to pick a red]  =3x2x1/10x9x8x10=6/72x100=6/7200=1/1200

<(-_-)>__ConNelL__>(-_-)<

Teresa has $451 in a personal bank account,and then withdraws $10 per week.Andrew has $10 in a personal bank account,and then deposits $53 earned from dog grooming each week.After how many weeks will they have the same amount of money in the bank.

Answers

Given:

Teresa has $451 in a personal bank account,and then withdraws $10 per week.

Andrew has $10 in a personal bank account,and then deposits $53 each week.

To find:

After how many weeks will they have the same amount of money in the bank.

Solution:

Let x be the number of weeks after which they have the same amount.

Teresa has $451 in a personal bank account,and then withdraws $10 per week. So, the amount in Teresa's account is:

[tex]\text{Teresa's account}=451-10x[/tex]

Andrew has $10 in a personal bank account,and then deposits $53 each week. So, the amount in his account is:

[tex]\text{Andrew's account}=10+53x[/tex]

They have equal amount after x weeks. So,

[tex]451-10x=10+53x[/tex]

Isolate variable terms.

[tex]451-10=10x+53x[/tex]

[tex]441=63x[/tex]

Divide both sides by 63.

[tex]\dfrac{441}{63}=x[/tex]

[tex]7=x[/tex]

Therefore, they will have the same amount of money in the bank after 7 weeks.

please answer correctly and i will give 10 extra points

Answers

Answer:

I believe the answer would be 48.6 milliliters

Step-by-step explanation:

54 * 0.9 = 48.6

HELP PLS!! ILL GIVE POINTS !! :(( m

Find the product of the complex numbers. Express your answer in
trigonometric form.
Z1 =5(cos15° + i sin 15°)
Z2=3(cos70° + i sin 70°)
A. 8(cos85° + isin85°)
B. 2 (cos(-55°) + i sin(-55°))
C. 2 (cos305° + i sin 305°)
D. 15(cos85° + i sin85°)

Answers

Answer:  Choice D

15(cos85° + i sin85°)

===========================================================

Explanation:

Let's say we had these two general complex numbers, which are in polar form.

[tex]z_1 = r_1*\left(\cos(\theta_1)+i*\sin(\theta_1)\right)\\\\z_2 = r_2*\left(\cos(\theta_2)+i*\sin(\theta_2)\right)\\\\[/tex]

We can abbreviate them into the shorthand form

[tex]z_1 = r_1*\text{cis}(\theta_1)\\\\z_2 = r_2*\text{cis}(\theta_2)\\\\[/tex]

The notation "cis" stands for "cosine i sine".

Now that we have those complex numbers set up, multiplying them is as simple as saying this:

[tex]z_1*z_2 = (r_1*r_2)*\text{cis}(\theta_1+\theta_2)[/tex]

We do two basic things:

Multiply the r values out frontAdd the theta values inside the the cis function

---------------------------------------

With all that in mind, let's tackle the problem your teacher gave you.

The given complex numbers

[tex]z_1 = 5*\left(\cos(15^{\circ})+i*\sin(15^{\circ})\right)\\\\z_2 = 3*\left(\cos(70^{\circ})+i*\sin(70^{\circ})\right)\\\\[/tex]

abbreviate into

[tex]z_1 = 5*\text{cis}(15^{\circ})\\\\z_2 = 3*\text{cis}(70^{\circ})\\\\[/tex]

then those multiply to

[tex]z_1*z_2 = (r_1*r_2)*\text{cis}(\theta_1+\theta_2)\\\\z_1*z_2 = (5*3)*\text{cis}(15+70)\\\\z_1*z_2 = 15\text{cis}(85^{\circ})\\\\z_1*z_2 = 15\left(\cos(85^{\circ})+i\sin(85^{\circ})\right)\\\\[/tex]

which is why choice D is the final answer.

or which polygon is the sum of the interior angles equal to 540? A 5-sided figure. A 6-sided figure. A 6-sided figure. A 4-sided figure.

Answers

Answer:

A 5 sided figure

Step-by-step explanation:

To find the sum of interior angles we use the formula

S = (n - 2) *180

540 = 180n - 360

180n = 540 + 360

180n = 900

n = 900/180

n = 5

The number of sides of a polygon with the given sum of interior angles is 5.

Option A)5-sided figure is the correct answer.

What is a polygon?

A polygon is simply a two-dimensional a plane shape enclosed by line segments called sides.

The formula for calculating the sum of interior angles of a polygon is;

S =  ( n − 2 ) × 180°

Where S is the sum and n is the number of sides.

Given that the sum of the interior angles equal to 540°.

From the above expression;

S =  ( n − 2 ) × 180°

540° =  ( n − 2 ) × 180°

540° =  180°n − 360°

180°n = 540° + 360°

180°n = 900°

n = 900° / 180°

n = 5

The number of sides of a polygon with the given sum of interior angles is 5.

Option A)5-sided figure is the correct answer.

Learn more about polygons here: brainly.com/question/22408868

#SPJ2

Olympia ate lunch at a restaurant. The amount of her check was $6.89. She left $8.00 on the table, which included the amount she owed plus a tip for the waiter. Which equation shows t, the amount of her tip, in dollars?
6.89 + t = 8.00
6.89 - t = 8.00
6.89t = 8.00
6.89 = 8.00 Divided by t

Answers

Answer:

not sure if the answer is obvious but I'd say $6.89 + t = $8.00

Step-by-step explanation:

so to make it more understandable you have to first go over the question and ask your self is the tip included in the totally amount owed or is it apart

after you figure out that its apart all you have to do is plug in the numbers you could verify this by checking every equation like this

$6.89 + t = $8.00 (t) in this case is the tip which would be $1.11 all you do to arrive at that answer is subtract the amout owed from the amount given like this $8.00 - $6.89 = $1.11 which will be your tip

now continue checking your answer next is , $6.89 - t = $8.00

which would be $6.89- $1.11 = $5.78 not quite right because now she is short on the pay , on to the next its $6.89t= $8.00 which would be $6.89 x $1.11= $7.65 rounded to neartest tenth which would included the amount but not all the tip given meaning tip would be short 0.35 cents and finally $6.89= $8.00 divided by t , now this takes the amount give which is $8.00 and divides by t which is $1.11 doing this $6.89 = $8.00/$1.11 which it is trying to imply that $6.89 is equal to $7.21 which would be incorrect making the only reasonable equation $6.89 + t = $8.00 reaveling that the tip given was $1.11

hopefully that help maybe i can get brainlist?!

Answer:

6.89 + t = 8.00

Step-by-step explanation:

it's A

Edge 2021

11) Seven times a number subtracted from 29 gives 43. Find the number.​

Answers

Answer:

-2

Step-by-step explanation:

Answer:

-2

Step-by-step explanation:

7x-2=-14

29-(-14)=43

hope this helps :)

Other Questions
Identify the mood of the verb in this sentence.All of the spectators crowded through the exits before the show ended.O indicativeO imperativeO subjunctiveO conditional FORMULAS OF IONIC COMPOUNDSFIND: POSITIVE ION, NEGATIVE ION AND FORMULA IN:NAME:Sodium chlorideMagnesium chlorideCalcium oxideLithium phosphideAluminum sulfideCalcium nitrideIron(III)chlorideIron(II)oxideCopper(I)sulfideCopper(II)nitrideZinc oxideSilver sulfidePotassium carbonateSodium nitrateCalcium bicarbonateAluminum hydroxideLithium phosphatePotassium sulfate A man was negligently driving down the road, not paying attention to where he was going. Because of this, he hit and seriously injured a pedestrian who was lawfully crossing the street. The accident was witnessed by the pedestrian's friend who was standing on the sidewalk. As a result of seeing the pedestrian injured, her friend suffered extreme emotional distress that physically affected her nervous system. The friend brings suit against the driver for negligent infliction of emotional distress in a jurisdiction that has adopted the majority approach in bystander cases. Will the friend prevail Two more than three times a number is 18. 2/4+1=1/6 x-7 what is the value of x in this epuation sin(180+0).cos(180+0)/cos(180+0).sin(180-0) Name the property shown by the statement a + (b + 2) = (a + b) + 2 what is the volume of the cylinder In India, secularism has now been pronounced by the Supreme Court of India to be a part of the basic structure of the Constitution and cannot be done away with even by a constitutional amendment.[9] Articles 25 to 28 guarantee individuals as well as groups the right to freedom of religion. However, Article 25 restricts the exercise of this right in the interests of public order, morality and health and all other rights enumerated in Part III of the Constitution. Therefore, it is constitutional for the legislature to place social welfare and reform over and above religious interests. In fact, Article 17 of the Constitution is a rare example of a penal constitutional provision which criminalizes untouchability ; a practice that can essentially be traced to Hinduism. Article 25, itself specifies that the freedom of religion cannot be used to restrict access to Hindu places of worship to upper castes. This relatively lower position that has been accorded to the freedom of religion in the Constitution is starkly different from the manner in which this has been played out in courts and political arenas in India. Many recent constitutional controversies in India have focused on religious rights. 1. How many articles in the Constitution guarantee 'Right to freedom of religion? a. 7 b. 6 c. 12 d. 9 2. Which article restricts the Right to freedom of religion under the rights enumerated in Part III of the Constitution? a. 29 b. 17 c. 25 d. 27 3. Which article criminalizes untouchability? a. 25 b. 17 c. 28 d. 29 4. What do the constitutional controversies recently focus on? a. Religious rights b. Religious tolerance c. Religious interests d. Religious practice 5. What is secularism? a. State supports religion b. State is separate from religion c. State Policy framework d. State supports public A tank is capable of holding 36,18 and 72 litres of milk . Determine which is the greatest vessel which can be uses to fill each one of them on exact number of times All of these are reasons for underreporting of child sexual abuse, EXCEPT: Group of answer choices children may fear retaliation of the abuser. children's allegations of sexual abuse are not taken seriously. very young children may not be able to talk and explain what happened. young children may not interpret what's happening as sexual abuse. A car salesman claims that the variance of prices on convertibles is higher than the variance on station wagons. To test this claim, he selects random samples of each type of car, and records the prices. The standard deviation of 16 convertibles is $6800 and the standard deviation of 24 station wagons is $3900. For , what is the p-value? Group of answer choices joule is a unit of_____and_____ analyse Mrs malard in The story of an Hour Hi! I'd appreciate it if you could help me on this question. The question I need help with is question 42. Thank you If you could help me!! Which of the following would best enhance a readers understanding of this poem Help is needed here Joule is equal to:Awatt x metreB.watt x second C. Newton x Metre D. Both b and c For a business to be considered a corporation: Multiple Choice it must issue both common and preferred stock. its stock must be sold in very large amounts. it must be organized as a separate legal entity. it must pay dividends. Who and what is a true believer? Do they operate and make decisions based on logic and rationality or by fanatical faith in some ideal? Can you rationalize with one?