Can someone help me with these two?

Can Someone Help Me With These Two?

Answers

Answer 1

Answer:

adding

opposite

Explanation:

dont blame me if u get them wrong

Answer 2

Answer:

first one is adding i belive and second one is opposite

Explanation:


Related Questions


PLEASE HELP!!
15POINTS!!! And brainliest

Answers

Answer: a. 3.36 L

b. 33.2 g

Explanation:

According to avogadro's law, 1 mole of every substance occupies 22.4 L at STP and contains avogadro's number [tex]6.023\times 10^{23}[/tex] of particles.

Standard condition of temperature (STP)  is 273 K and atmospheric pressure is 1 atm respectively.

To calculate the number of moles, we use the equation:

[tex]\text{Number of moles}=\frac{\text{Given mass}}{\text{Molar mass}}[/tex]

[tex]\text{Number of moles of} Fe_2O_3=\frac{16.0g}{159.69g/mol}=0.1mole[/tex]

[tex]3O_2(g)+4Fe(s)\rightarrow 2Fe_2O_3(s)[/tex]

a. 2 moles of [tex]Fe_2O_3[/tex] are produced by = [tex]3\times 22.4L=67.2L[/tex] of [tex]O_2[/tex]

Thus 0.1 moles of  [tex]Fe_2O_3[tex] are produced by =[tex]\frac{67.2}{2}\times 0.1=3.36L[/tex] of [tex]O_2[/tex]

b. [tex]3\times 22.4L=67.2L[/tex] of [tex]O_2[/tex] react with = [tex]4\times 55.8=223.2g[/tex] of iron

Thus 10.0 L of [tex]O_2[/tex] react with = [tex]\frac{223.2}{67.2}\times 10=33.2g[/tex] of iron

If someone is building a scale model of our solar system which characteristic would be the most difficult to build into the model?
1#The relative sizes of the objects
2#The colors of the objects
3#The distances between objects
4#The composition of the objects

Answers

Answer:

The composition of the objects because not all the planets have been explored

Which of the following statements best goes with the Law of Conservation of Energy?
all energy conversions are 100% efficient
O all energy from the sun is transferred to organisms directly by the 10% rule
O all of the sun's energy is either transformed into kinetic energy, and eventually heat energy
O all matter cannot be created or destroyed

Answers

Answer:

all letter cannot be created or destroyed just transformed

plzzzzzzz help asap its just one question plzzzzz its in the file <3

Answers

Answer:

There are 6 atoms of oxygen in 2Ca(NO3)2

A 1,900-m3 water tower has been cleaned with a chlorine solution. The vapors of chlorine in the tower exceed allowable concentrations for the work crew to enter and finish repairs. If the chlorine concentration is 15 mg/m3 and the allowable concentration is 0.0015 mg/L, how long must the workers vent the tank with clean air flowing at 2.35 m3/s

Answers

Answer:

t = 1862 s

Explanation:

To do this, we need first to determine the theorical detention time, which can be determined with the following expression:

t₀ = ∀/Q  (1)

Where:

t₀: detention time

∀: Volume of the fluid in the reactor

Q: Flow rate in the reactor

With this time, we must use the following expression to determine the time that the workers will take to vent the tank:

C = C₀ e^(-t/t₀)   (2)

From here, we must solve for time t, and the expression will be:

t = ln(C₀/C) * t₀   (3)

Now that we know the expression to use, let's solve for t. Using (1) to determine the detention time, ∀ is 1900 m³, and Q is 2.35 m³/s so:

t₀ = 1900 / 2.35 = 808.51 s

Now, let's solve for the time t. C will be 0.0015 mg/L (or 1.5 mg/m³ cause in 1 m³ we have 1000 L) and C₀ 15 mg/m³:

t = ln(15/1.5) * 808.51

t = 1861.66 s or simply 1862 s

Hope this helps

A balloon full of air has a volume of 1.00L at a temperature of 23 °C. What is the balloon's volume at 33°C?
Answer:1.03L
How do I solve this?

Answers

Answer:

V2= 1.03L

Explanation:

Start off with what you are given.

V^1: 1.00L

T^1: 23°C

V^2?

T^2: 33°C

If you know your gas laws, you have to utilise a certain gas law called Charles' Law:

V^1/T^1 = V^2/T^2

Remember to convert Celsius values to Kelvin whenever you are dealing with gas problems. This can be done by adding 273 to whatever value in Celsius you have.

(23+273 = 296)     (33+273 = 306)

Multiply crisscross

1.00/296= V^2/306

296V^2 = 306

Dividing both sides by 296 to isolate V2, we get

306/296 = 1.0337837837837837837837837837838

V2= 1.03L


When a substance breaks up into two simpler substances, the reaction
is an)
reaction.

Answers

Answer:

Decomposition.

Explanation:

Decomposition Reactions T hose reactions in which a single substance (reactant) splits up into two or more simpler substances (products) are known as decomposition reactions. These reactions are carried out by supplying energy in form of heat, electricity or light which breaks that substance into simpler substances

Decide whether a chemical reaction happens in either of the following situations. If a reaction does happen, write the chemical equation for it. Be sure your chemical equation is balanced and has physical state symbols. situation chemical reaction.

A strip of solid magnesium metal is put into a beaker of 0.042M SnCl3 solution.

Answers

Answer: [tex]3Mg(s)+2SnCl_3(aq)\rightarrow 3MgCl_2(aq)+2Sn(s)[/tex]

Explanation:

Single replacement reaction is a chemical reaction in which more reactive element displaces the less reactive element from its salt solution.

A more reactive element is one which can easily lose or gain electrons as compared to the other element.

As Magnesium is more reactive than tin, it can easily displace tin from its salt solution [tex](SnCl_3)[/tex] and form magnesium chloride and tin in elemental form.

The balanced chemical equation is:

[tex]3Mg(s)+2SnCl_3(aq)\rightarrow 3MgCl_2(aq)+2Sn(s)[/tex]

A combustion reaction involves the reaction of a substance with oxygen gas. The complete combustion of any hydrocarbon (binary compound of carbon and hydrogen) produces carbon dioxide and water as the only products. Heptane is a hydrocarbon that is found in gasoline. Complete combustion of heptane produces 7 liters of carbon dioxide for every 8 liters of water vapor (both measured at the same temperature and pressure). What is the ratio of carbon atoms to hydrogen atoms in a molecule of heptane

Answers

Answer:

7/16

Explanation:

The general formula for the combustion of alkanes is;

CnH2n+2 + 3n+1/2 O2  -------> nCO2 + (n+1)H2O

So, we have;

CnHn + nO2 ------> 7CO2 + 8H2O

So there are 7 carbon atoms and 16 hydrogen atoms in heptane according to the law of conservation of mass.

Therefore, heptane is; C7H16

The ratio of carbon to hydrogen is now; 7/16

PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP PLEASE HELP

DUE IN 5 MINUTES CHEMISTRY DIMENSIONAL ANALYSIS

In 2009, Usain Bolt ran 100 meters in 9.58 seconds. What is this speed in km/hr? (!! DIMENSIONAL ANALYSIS!! NOT A REGULAR PROBLEM)

Answers

100 m = 0.1 km
9.58 sec = 9.58/3600 = 0.00266 hr
Speed = 0.1/0.00266= 37.6 km/hr
Can you mark it brainliest?

What are simple sugars

Answers

Answer:

Simple sugars are a type of carbohydrate.

Explanation:

Carbohydrates are one of the three basic macronutrients — the other two being protein and fat. Simple sugars are found naturally in fruits and milk, or they can be produced commercially and added to foods to sweeten, prevent spoilage, or improve structure and texture.

can you help me with my science

Answers

1-4
2-2
3-3
4-1
Hope you are m right

A normal adult jawbone contains 200 mg of Carbon-14 in a living person. If scientists found a jawbone that only had 50mg of Carbon-14, how old is the bone? (The half-life of C-14 is 5730 years).

Answers

Carbon-14 is a radioisotope of carbon that decays following first-order kinetics. There are four values of interest in this problem: the "normal" (or original) amount of carbon-14 for a jawbone ([tex]\mathrm{N_0}[/tex]), the actual amount of carbon-14 in a jawbone ([tex]\mathrm{N}[/tex]), the half-life of carbon-14 ([tex]\mathrm{t_{1/2}}[/tex]), and the actual time elapsed ([tex]\mathrm{t}[/tex]) from the original time. There is an equation that ties all these values in together,

[tex]N= N_0 e^{-kt}[/tex]

where k is the rate constant, which, for first-order decay, is related to the half-life by

[tex]k = \dfrac{\ln 2}{ t_{1/2} }.[/tex]

What you want to find here is the time elapsed (t). So, you can substitute the latter equation for k into the k in the former equation to get

[tex]N= N_0 e^{\frac{-\ln 2 \;t}{t_{1/2}}.[/tex]

Rearranging to solve for t, the equation becomes

[tex]t = \left(\dfrac{\ln \dfrac{N_0}{N}}{\ln 2} \right) t_{1/2}.[/tex]

You are given all three of the values necessary to solve for t: The normal amount of carbon-14 is 200 mg; the actual amount of carbon-14 in the sample is 50 mg; and the half-life of carbon-14 is 5730 years. Plugging them into the above equation, we get

[tex]t = \left(\dfrac{\ln \dfrac{200 \text{ mg}}{50 \text{ mg}}}{\ln 2} \right) \left(5730 \text{ years} \right) = 11460 \text{ years}.[/tex]

So the jawbone found is 11460 years old (or 11000 if accounting for sig figs).

In humans, normal color perception (N) dominates the expression of color blindness (n), and both of these genes are carried on the X chromosome (XN or Xn). A woman with normal color vision has a color-blind father. Her husband is also color-blind.

a. What is the genotype of the colorblind man? ____
b. What is the genotype of the woman? ______
c. What is the probability of her daughter to be colorblind? __________%
d. What is the probability of her sons to be colorblind? _________%


WHO CAN HELP ME

Answers

Answer:

a: Nn or XN

b: Nn or Xn

c: 75%

d: 50%

Explanation:

(feso4.(Nh4) So4. 6H2o) +Kmno4+H2So4_Fe2(So4)3+K2So4+mnSo4+(Nh4)2So4+H2o​

Answers

Answer:

balancing the equation?

How many moles in 6.57 x 10^24 formula units of NaCl?
0.092 moles
10.91 moles
3.96 X 10^49 moles
145 moles​

Answers

Answer:

3.955*10^48

Explanation:

1 mole of a substance gives 6.02*10^23/6.57*10^24 will give x then cross multiply the answer. is 3.955*10^48

Bond energies can be used to estimate the energy of a reaction. Why is this only an estimate?

A) It's difficult to measure such a smal amount of energy.

B) The bonds in all molecules are the same, but not all molecules have bonds that are easily measured.

C)The same bond in a different molecule has a different energy. For example, O-H in water versus ethanol has different energies.

D) It's difficult to isolate an individual bond.​

Answers

Answer:

C)The same bond in a different molecule has a different energy. For example, O-H in water versus ethanol has different energies.

Explanation:

This is true going by the the statement about the bond energies and the bonding being different among the various elements. In the example given which is between ethanol and water, the bonds which exist among the elements is stronger in water than in ethanol. That is why, ethanol is easily combustible than water.

Answer:

The same bond in a different molecule has a different energy. For example, O-H in water versus ethanol has different energies.

Explanation:

2NH3+2O2- N2o+3H2O

If 80.0 grams of O2 are reacted in the above reaction,how many grams of N2O will be produced?

Answers

Answer:

55.025g of N2O

Explanation:

2 NH3 + 2 O2 → N2O + 3 H2O

moles of O2 = 80.0/32 = 2.5 moles O2

moles of N2O = 2.5 moles O2 * 1 mole N2O

= 1.25 moles N2O

moles = mass/Molar mass

mass = moles * Molar mass = 1.25 x 44.02 = 55.025 g

suppose you start out with only reactants in a rigid container. if the initial concentration of SO2Cl2(g) is 0.543 M, and 43.6% of this initial concentration remains when the system has reached equilibrium, what are the equilibrium concentrations of each gas in the system

Answers

Answer:

Explanation:

From the information given:

The Chemical equation is:

[tex]SO_2Cl_{2(g)} \iff SO_{2(g)} + Cl_{2(g)}\\[/tex]

since 43.6% of the initial concentration remains at equilibrium

Then; the amount of [tex]SO_2Cl_2[/tex] that is being reacted is:

= 0.543 × (100 -43.6)%

= 0.306 M

The ICE table can be computed as follows:

           [tex]SO_2Cl_2[/tex]               ⇔           [tex]SO_{2(g)[/tex]           +             [tex]Cl_{2(g)[/tex]

I            0.543                                    0                           0

C          0.306                                 +0.306                     0.306

E           0.237                                  0.306                      0.306

[tex]K_c = \dfrac{[SO_2] [Cl_{2}]}{[SO_2Cl_2]}[/tex]

[tex]K_c = \dfrac{0.306 \times 0.306}{0.237}[/tex]

[tex]K_c = 0.995[/tex]

Thus; the concentration at equilibrium for the species are:

[tex]SO_2Cl_2[/tex]  = 0.237 M

[tex]SO_{(2g)[/tex] = 0.306 M

[tex]Cl_{2(g)[/tex] = 0.306 M

Order the sequence of steps that occur when you add heat to a chemical reaction. Place these steps in a logical order keeping in mind how adding temperature affects the rate of reaction.

The reaction rate of the experiment is recorded and found to have occurred at a faster rate than it did without the addition of heat.

Temperature increases due to the higher ketic energy of particles.

Two chemicals are mixed together and slowly some bubbles appeanr

Heat is added to the experiment with a Bunsen burner.

More collisions of particles occurs due to the increased kinetic energy.​

Answers

Answer:

C,A,B,D

Explanation:

That's the correct order, hope this helps

An element X has a triiodide with the empirical formula XI3 and a trichloride with the empirical formula XCl3. The triiodide is converted to the trichloride according to the equation XI3 Cl2XCl3 I2 If the complete conversion of 1.196 g of XI3 results in the formation of 0.436 g of XCl3, what is the atomic mass of the element X

Answers

Answer:

51.03g/mol is the molar mass of X

Explanation:

Based on the reaction:

2XI₃ + 3Cl₂X → 2XCl₃ + 3I₂

Where 2 moles of XI₃ reacts to produce 2 moles of XCl₃ -The ratio of reaction is 1:1-

To solve this question we must find the mass of X per mole (This is the atomic mass of X).

As the moles of both compounds are the same:

1.196g / 0.436g = Molar mass XI₃ / molar mass XCl₃ (1)

Also:

Molar mass XI₃ = Molar mass X + 380.71g/mol

Molar mass XCl₃ = Molar mass X + 106.36g/mol

Replacing in (1):

2.7431 = (Molar mass X + 380.71g/mol) / (Molar mass X + 106.36g/mol)

2.7431 Molar mass X + 291.76g/mol = Molar mass X + 380.71g/mol

1.7431 Molar mass X = 88.95g/mol

Molar mass X = 51.03g/mol

51.03g/mol is the molar mass of X

Help please !!!!!!! 10 points for this

Answers

i think it’s increase, then decrease- sorry if i’m wrong

Please help I’m so confused on this it’s stoichiometry

Answers

Answer:

48.27g Na

Explanation:

To start we need to balance the equation. The trick is to make sure both sides have equal amounts of each atom:

2Na + Cl2 --> 2NaCl

Now we can use sociometry

We have 75 g of Cl2, and for every 1 mole of Cl2, there are 70.9 grams:

[tex]75g Cl2 * \frac{1mole Cl2}{70.9g Cl2}= 1.05 mole Cl2[/tex]

Now we have moles of Cl2. To get to grams of Na, we need to first use mole to mole ratio:

[tex]1.05mole Cl2 *\frac{2 mole Na}{1 mole Cl2} =2.1 mole Na[/tex]

 From here we convert moles of Na into grams of Na

[tex]2.1mol Na*\frac{22.99g Na}{1 mole Na} = 48.27g Na[/tex]

It's usually easier to just make one singular equation with all of these smaller equations.

[tex]75gNa*\frac{1molCl2}{70.9gCl2} *\frac{2mol Na}{1 mol Cl2} *\frac{22.99g Na}{1 mol Na}=48.27 gNa[/tex]

The trick to sociometry is making sure your units cancel out until you only have the unit you want. If there are moles of Na in the numerator, there needs to be moles of Na in the denominator. If there are grams of Cl2 in the numerator, there needs to be grams of Cl2 in the denominator and so one and so on

The PH of a solution of Hcl is 2.find out the amount of acid present in a litre of the solution ​

Answers

Answer:

The solution is 10^-2 or 0.01M in HCl.

Explanation:

meaning of pH is "power of hydrogen".

what is the molar concentration of a HCl solution with pH=2?

Let say pH=2

[H+]=10^-2M

HCL is a strong acid that dissociates completely:

[H+]=[HCL]

Therefore solution is 10^-2 or 0.01M in HCL.

Put these elements in order of decreasing electronegativity, with the highest electronegative element as number 1.
a. tin (Sn, Group 14, Period 5)
b. rubidium (Rb, Group 1, Period 5)
c. bromine (Br, Group 17, Period 4)
d. lithium (Li, Group 1, Period 2)
e. cadmium (Cd, Group 12, Period 5)

Answers

Answer:the answer is a c and e

Explanation:

515282 quarts into milliliters. I

Answers

Answer:

487638640,7819

dndndnndndbxbdbdbdbdb

anyone wanna do my chem test for 500 points? my insta is niqsariot_1 hmu if your interested and for everyone else FREE 100 POINTS

Answers

Answer:

I would be if I do it your no learning anything but I would but I don't have insta yet

Explanation:

sorry

Answer:

k

Explanation:

What is the molecular formula for a compound that is 44.87% potassium, 36.7%
oxygen, 18.0% sulfur and a molecular mass of 696g.

Answers

Answer:

Molecular formula: S4K8O16  empirical formula: SK2O4

Explanation:

First we find the moles of each by first finding grams (using the percent) and then using stoichiometry to convert into moles:

Sulfur: 696 *.18 = 125.28grams S* [tex]\frac{1 mole S}{32.065 g S} = 3.907 moles S[/tex]

Potassium: 696 *.4487 = 312.2952 *[tex]\frac{1 mole K}{39.08 g K}[/tex]= 7.99117 mole K

Oxygen: 696 * .367 = 255.432 * [tex]\frac{1 mol O}{16g O}[/tex] = 15.9654 mole O

Then we divide each value by the atom with the smallest number of moles to find the mole ratio:

3.907/3.907= 1

7.99117 mole K/ 3.907= 2.043

15.9654 mole O/ 3.907= 4.08

The empirical formula is SK2O4

To find the molecular formula, we divide the mass given (696) by the mass of the empirical formula (174.22) to get 4. We then divide each atom by 4.

Molecular formula: S4K8O16

How much of NaCl is in 1.14 L of 0.400 M
NaCl?

Answers

Answer:

44 g NaCI

Explanation:

The problem provides you with the molarity and volume of the target solution, so your first step here will be to use this information to figure out how many moles of sodium chloride.

State the postulate of Bohr theory

Answers

Answer:

Bohr's model of the hydrogen atom is based on three postulates:

1) An electron moves around the nucleus in a circular orbit,

2) An electron's angular momentum in the orbit is quantised,

3) The change in an electron's energy as it makes a quantum jump from one orbit to another is always accompanied by the emission or absorption of a photon. Bohr's model is semi-classical because it combines the classical concept of electron orbit (postulate 1) with the new concept of quantisation ( postulates 2 and ).

Other Questions
Hello, I need help!!!!? You want to have $10,000 in your account after five years. Find the amount your initial deposit should be if the account pays 3.5% annual interest compounded monthly. Ellen and Bob went to Olive Garden for dinner. Ellens dinner costs $24.95 and Bobs dinner costs $21.95. If they leave an 18% tip, what is the total cost of their dinner, including tip? (Round your answer to the nearest cent, and do not include the $ sign.) air passes from the nose into the bronchi true or false? CAN YALL HELP!!!!!!!!!!!!! 8TH GRADE If you know that a denominator in your ratio table is 12 and one ofthe other ratios is 1/3, what numerator should you apply to your12 denominator to make that ratio have the same value? (1x)/(2)=12PLEASE SHOW THE WORK!!! Solve and explination What are TWO methods that can be used by the villagers to catch fish in the river? Explain the difference between homology and analogy using a wolf, a whale, and a shark: PLSSSSSS HELPPPPPPP FAST WILL GIVE BRAINLIEST I NEED A 3 PARAGRPAH ESSAY ON THIS SCIENCE ARTICLE!! INTRODUCION BODY AND CONCLUSION EACH PARAGRAPH 5 SENTENCES OR MORE!!!!!! Characters Response to the EventIn Sister Clubplease answer 20 points!!! help me plss its kinda easy but im not sure Algebra 1 Find the GCF In a study of all 3813 students at a college, it is found that 45% own a vehicle. Is this a statistic or parameter? if f (x) = x 3, then find f (8) = What events lead up to Patrick Henry's Give me liberty give me death speech? To test the effectiveness of an exercise program in reducing high blood pressure, 15 participants had their blood pressures recorded before beginning the program and again after completing the program. The difference (after minus before) in blood pressure was recorded for each participant, and the sample mean difference was calculated. A hypothesis test will be conducted to investigate whether there is convincing statistical evidence for a reduction in blood pressure for all who complete the program. Which of the following is the correct set of hypotheses?A. H0 : bar xD = 0 Ha : bar xD is not equal to 0B. H0 : bar xD = 0 Ha : bar xD > 0 C. H0 : mu D = 0 Ha : mu D is not equal to 0D. H0 : mu D = 0 Ha : mu D > 0E. H0 : mu D = 0 Ha : mu d < 0 Determine whether the relation represents a function. If it is a function, state the domain and range. {(-3, 7), (2, 5), (5, -3), (8, -2)} What would the woman most likely say next?Puedo dejar un mensaje?Bien, gracias.Mucho gusto.Soy yo, Katrina.