Angles A and B are complementary. The measure of angle A
is yº. What is the measure of angle B?

Angles A And B Are Complementary. The Measure Of Angle Ais Y. What Is The Measure Of Angle B?

Answers

Answer 1

Answer:

D, [tex](90-y)[/tex] degrees

Step-by-step explanation:

Complementary angles are angles that add up to 90 degrees. Since angle A and angle B are complementary, they add up to 90. Since the value of angle A is y degrees, we can substitute y into the equation to get

[tex]y+B=90[/tex]

To get the measure of angle B, we must isolate B.

To isolate B, we have to remove every term from its side.

The only term on the side that B is on other than B is y. To remove y from the left side, we must subtract y from both sides. Doing this will result in the equation:

[tex]B=90-y[/tex]

The only answer option that meets this criteria is D.


Related Questions

6a3-5b2+2c2-3a2bc if a=5 b=2c=-1

Answers

6a3-5b2+2c2-3a2bc if a=5 b=2c=-1

Solve for x.
------------------------------------------------------------

Answers

Answer:
x= 20
Why?
Look the image, there is the explanation

see question in image

Answers

Answer:

Total outcomes with two dice is:

6*6 = 3638

Outcomes with sum of 7:

1 &6, 2&5, 3&4, 4&3, 5&2, 6&1 - total of 6

Probability:

P(sum of 7) = 6/36 = 1/639

Outcomes with sum of 5 or 10:

1&4, 2&3, 3&2, 4&1, 4&6, 5&5, 6&4 - total of 7

Probability:

P(5x) = 7/3640

Outcomes with same numbers:

1&1, 2&2, 3&3, 4&4, 5&5, 6&6 - total of 6

Probability:

P(same) = 6/36 = 1/6

I need help asap!!Explain how to do the problem

Answers

Answer:

Step-by-step explanation:

the scale factor is 2. one length is 10, and the other is 5. pythagorean therom approved.

can you help me please.

Answers

45 is the answer
hope this helps :)

Answer:

45

Step-by-step explanation:

1st term is 2

2nd term is 3

3rd term is 4

.

.

.

nth term is (n+1)

because common difference is 1, so 1st term = 1 + common difference = 1+1 = 2, for any term, we take n + common difference, so n+1

putting n = 44,

44th term is 44+1 = 45

Answered by GAUTHMATH

100 points please help... i think the answer is 288 pie squared but not sure
What is the surface area of a dome (a half sphere) with a radius of 12 meters?
576 pie meters squared
48 pie meters squared
288 pie meters squared
96 pie meters squared

Answers

9514 1404 393

Answer:

  (c) 288π m²

Step-by-step explanation:

The area of a sphere is found using the formula ...

  A = 4πr²

Then the area of a half-sphere with radius 12 m will be ...

  A = (1/2)(4π)(12 m)² = 288π m²

The area of a square piece of land is 784metersquared .What is the perimeter​

Answers

Answer:

112 m

Step-by-step explanation:

The area (A) of a square is

A = s² ( s is the length of side )

Here A = 784 , then

s² = 784 ( take the square root of both sides )

s = [tex]\sqrt{784}[/tex] = 28

Then

perimeter = 4s = 4 × 28 = 112 m

Answer:

112m

Step-by-step explanation:

the area of the square is 784m^2 so the square root of 784 would give us the length of the sides(since it's a square the length of each sides are equal). √784 would give 28m. 28 m is the length of each sides..so now the perimeter would be the addition of each sides which in case would be 4 times 28 because it's a square. 4 times 28 gives 112m.

On a coordinate plane, a curved line with a minimum value of (negative 2.5, negative 12) and a maximum value of (0, negative 3) crosses the x-axis at (negative 4, 0) and crosses the y-axis at (0, negative 3).
Which statement is true about the graphed function?

F(x) < 0 over the interval (–∞, –4)
F(x) < 0 over the interval (–∞, –3)
F(x) > 0 over the interval (–∞, –3)
F(x) > 0 over the interval (–∞, –4)

Answers

Answer:

f(x) > 0 over the interval  (–∞, –4)

Step-by-step explanation:

We know that:

Our curve has a minimum at (-2.5, -12)

Our curve has a maximum at (0, - 3)  (I assume that is a local maximum).

We know that the curve crosses the x-axes at (-4, 0)

We know that the curve crosses the y-axis at (0, -3)

Notice that when our curve crosses the x-axis at (-4, 0), it goes from above the axis to below the axis.

How we know this?

Remember that "crossing" the x-axis means that the sign of f(x) changes.

At the value x = -2.5  (which is larger than x = -4) the function is negative.

f(-2.5) = -12

and:

f(-4) = 0

So we can see that after f(x) crosses the x-axis at x = -4, the function is negative.

This means that before that point, the function must be positive.

So for values of x smaller than -4, the function should be larger than zero.

f(x) > 0 if x < -4

From this, we can conclude that in the range (-∞, –4), the function is above the x-axis.

Then we would write this as:

f(x) > 0 over the interval  (–∞, –4)

The correct option is the last option.

Answer:

Its D

Step-by-step explanation:

what is a fraction between 1/31 and 1/22?​

Answers

~Fraction

__________

Step-by-step explanation:

Q = { 1/31 < x < 1/22 }

Q = { 1/30, 1/29, 1/28, 1/27, 1/26, 1/25, 1/24, 1/23 }

#mathisfun

Determine the 3 digit chopping and rounding approximately of the number 0.9

Answers

Answer:

We want to "chop and round" the periodic number 0.9 at 3 digits.

First, remember that we can write our periodic number as:

0.9 = 0.9999...

Such that the nine repeats infinitely.

Now we want to chop it at the third digit, and then round.

To chop at the third digit we just "cut" the number at the third digit after the decimal point, we will get:

0.9 ≈ 0.999

Now we round.

Remember that to round a number, we need to look at the last digit after the decimal point.

If the last digit is 5 or larger, we round up, adding 1 to the previous decimal.

If the last digit is 4 or smaller, we round down, don't adding anything to the previous decimal.

in our number:

0.999

The last digit is a 9, so we round up.

Then we add "1" to the previous decimal

but the previous decimal is a 9, so when we add 1, it will transform into a 10.

So it also adds one to the previous decimal, which also is a 9, so the process repeats, this time adding 1 to the decimal to its left, in this case, that decimal will be the first decimal at the left of the decimal point.

So after rounding, we will get:

0.999 ≈ 1

Then we can conclude that:

he 3 digit chopping and rounding approximately of the number 0.9 is 1"

find the slope of the tangent line of the curve r = cos (3theta) at theta = pi / 3

Answers

The slope of the tangent line to the curve at a point (x, y) is dy/dx. By the chain rule, this is equivalent to

dy/dθ × dθ/dx = (dy/dθ) / (dx/dθ)

where y = r(θ) sin(θ) and x = r(θ) cos(θ). Then

dy/dθ = dr/dθ sin(θ) + r(θ) cos(θ)

dx/dθ = dr/dθ cos(θ) - r(θ) sin(θ)

Given r(θ) = cos(3θ), we have

dr/dθ = -3 sin(3θ)

and so

dy/dx = (-3 sin(3θ) sin(θ) + cos(3θ) cos(θ)) / (-3 sin(3θ) cos(θ) - cos(3θ) sin(θ))

When θ = π/3, we end up with a slope of

dy/dx = (-3 sin(π) sin(π/3) + cos(π) cos(π/3)) / (-3 sin(π) cos(π/3) - cos(π) sin(π/3))

dy/dx = -cos(π/3) / sin(π/3)

dy/dx = -cot(π/3) = -1/√3

Find the slope of the line that passes through (23, -30) and (-7, 18).

Answers

Answer:

slope = - [tex]\frac{8}{5}[/tex]

Step-by-step explanation:

Calculate the slope m using the slope formula

m = [tex]\frac{y_{2}-y_{1} }{x_{2}-x_{1} }[/tex]

with (x₁, y₁ ) = (23, - 30) and (x₂, y₂ ) = (- 7, 18)

m = [tex]\frac{18-(-30)}{-7-23}[/tex] = [tex]\frac{18+30}{-30}[/tex] = [tex]\frac{48}{-30}[/tex] = - [tex]\frac{8}{5}[/tex]

solve each given equation​

Answers

I think that they are
30

Infinite

No solution

Answer:

x = 30

Infinite Solutions

No Solutions

Step-by-step explanation:

First, combine like terms

Then move all variable to one side and isolate them by undoing the action being done to them

Example 1:

6x + 4x - 6 = 24 + 9x

10x - 6 = 24 + 9x

-9x                 -9x

x - 6 = 24

  +6     +6

x = 30

Example 2:

25 - 4x = 15 - 3x + 10 -x

25 - 4x = 25 - 4x

Since they are the same on both sides, this equation has Infinite Solutions

Example 3:

4x + 8 = 2x + 7 + 2x -20

4x + 8 = 4x - 13

-4x        -4x

8 = -13

This statement is untrue, therefore this equation has No Solution

Find the area and the circumference of a diameter 8yd Use the value 3.14 for π, and do not round answer

Answers

Answer:

circumference = 25.12 yards

area = 50.24 yards squared or yd^2

Step-by-step explanation:

circumference = pi * d

3.14 * 8 =

25.12

area = pi* r^2

r = 1/2 of d = 4

area = pi * 16

3.14 * 16 =

50.24

Answer:

Area: 50.24yds^2            Circumference: 25.12yds

Step-by-step explanation:

Area: The formula for area of a circle is a = πr^2.

The radius (r) of the circle is 4yds because it is half the length of the diameter. The equation would like like this:

A = (3.14)(4)^2

A = (3.14)(16)

A = 50.24yds

Circumference: The formula for circumference is 2πr. We already know all of the variables so we can plug them in.

C = 2(3.14)(4)

C = 25.12yds

Hope this helps

Use the special angles to evaluate: a) cosec 60° cot 30° + cos 45º cosec 45° 2​

Answers

Answer:

the required answer is 4√2+1/2√2

I need help with this question pls!

Answers

Answer:

Answer is D

Step-by-step explanation:

cuh s

Find the number of bit strings that satisfies the given conditions. The bit strings of length 11 having at least four 1s

Answers

Answer:

Step-by-step explanation:

carly walks 30 feet in seven seconds. At this rate, how many minutes will it take for carly to walk a mile if there are 5,280 feet in one mile?

Answers

Answer:

20.53 minutes

Step-by-step explanation:

Speed = Distance/Time = 30/7

Time = Distance / Speed

= 5280/30/7

= 1232 seconds / 60 = 20.53 minutes

Answered by Gauthmath

Rita and Tina each make $11 an hour working as cashiers at a supermarket. Last week, Rita worked r hours while Tina worked t hours. Rita also worked overtime hours during the week, for which she was paid an extra $32 flat wage. Which expressions represent the total weekly wages of both Rita and Tina?
Rita and Tina's total weekly wages can be represented as

Answers

Answer:

Step-by-step explanation:

11t= tina

Rita= 11r+32

help me with the question of O.math​

Answers

Answer:

By comparing of elements of both matrices, we will get,

[tex]x + y = 5 \: \: \: - - - (1) \\ \sf \: and \\ x - 2 = 3 \\ = > x = 3 + 2 \\ = > \green{ \boxed{x = 5}} \\ \\ so \: \: from \: eqn.(1) \\ 5 + y = 5 \\ = > y = 5 - 5 \\ = > \green{ \boxed{ y = 0}}[/tex]

[tex]\large \green{ \: \: \: \: \boxed{\boxed{\begin{array}{cc} \sf \: mark \: \\ me \: as\\ \bf \: brainliest \: \end{array}}}} \\ [/tex]

A walking trail is 1,580.76 feet long. A lake is located 70.62 feet away from the end of the trail. What is the total distance from the start of the trail to the lake? 1,510.14 feet 1,651.38 feet 2,286.96 feet 8,642.76 feet

Answers

Answer:[tex]1651.38\ ft[/tex]

Step-by-step explanation:

Given

A walking trail is [tex]1580.76\ ft[/tex] long and a lake is located [tex]70.62\ ft[/tex] away  from end  of the trail

The distance from the start of the trail to the lake is the sum of the length of the trail and lake

[tex]\Rightarrow 1580.76+70.62\\\Rightarrow 1651.38\ ft[/tex]

Answer:

B

Step-by-step explanation:

Solve the equation. Then check your solution.

x - 4 = 2
a.–6
c.7
b.6
d.–2



Please select the best answer from the choices provided


A
B
C
D

Answers

Answer:

b) 6

Step-by-step explanation:

x - 4 = 2

x = 2 + 4

x = 6

Tìm x
(x+1)^2=x+1
Help me!!Pls

Answers

x^2+2x+1=x+1
x^2+2x-x+1-1=0
x^2-x=0
x(x-1)=0
x=0
x-1=0
x=1


If u vector= a vector-b vector and v vector= a vector+b vector and magnitude of a = b = 2, then magnitude of u vector multiply v vector =???

Answers

Answer:

zero

Step-by-step explanation:

[tex]\overrightarrow{u} = \overrightarrow{a} - \overrightarrow{b}\\\\\overrightarrow{v}= \overrightarrow{a} + \overrightarrow{b}\\\\\overrightarrow{u} . \overrightarrow{v} = a^2 - b^2 \\\\\overrightarrow{u} . \overrightarrow{v} = 2^2 - 2^2 = 0[/tex]

So, vector u and vector v are perpendicular to each other.

Which label on the cone below represents the vertex?
D
B
А.
С
ОА
D
Mark this and stum
Save and Exit

Answers

D is the answer because it represents the vertex

HI I NEED HELP WITH THIS QUESTION ASAP!!!!!! ITS URGENT PLEASE HELP


A group of rowdy teenagers near a wind turbine decide to place a pair of
pink shorts on the tip of one blade. They notice that the shorts are at its
maximum height of 16 metres at t = 10 s and its minimum height of 2 metres at
t = 25 s.

a) Determine the equation of the sinusoidal function that describes
the height of the shorts in terms of time.

b) Determine the height of the shorts at exactly t = 10 minutes, to
the nearest tenth of a metre.

Answers

a) The sinusoidal function is y = 7·sin(π/15(t - 2.5)) + 9

b) The height of the shorts at t =  10 minute is approximately 6 meters

The above answers were arrived at as follows

a) The general form of a sinusoidal equation is presented as follows;

y = A·sin(B(t - h)) + k

Where;

A = The amplitude of the graph of the function

The period, T = 2·π/B

h = The horizontal shift

k = The vertical shift

The maximum height of the blade = 16 meters

The minimum height of the blade  = 2 meters

The time the blade moves from maximum height to minimum height = 25 s - 10 s = 15 s

Therefore, the time it takes the blade to move from maximum height to minimum height, the period, T= 2 × 15 s = 30 s

Therefore;

B = 2·π/30 = π/15

B = π/15

When B·(t - h) = π/2, t = 10

Therefore;

(π/15)·(10 - h) = π/2

10 - h = 15/2

h = 10 - 15/2 = 2.5

The horizontal shift, h = 2.5

The amplitude, A = (Max - Min)/2

∴ A = (16 - 2)/2 = 7

A = 7

The vertical shift, k = Min - (-Amplitude)

∴ k = 2 - (-7) = 9

The vertical shift, k = 9 Up

Therefore, the equation of the sinusoidal equation that describes the height of shorts in terms of time is given by plugging in the values of the variables, A, B, h, and k to  get the following equation;

y = 7·sin(π/15·(t - 2.5)) + 9

b) The height of the shorts at exactly, t = 10 minutes = 600 seconds, is given as follows;

y = 7·sin(π/15·(t - 2.5)) + 9

10 minutes =  600 seconds

When t = 10 minutes = 600 seconds

y = 7·sin(π/15(600 - 2.5)) + 9 = 5.5 ≈ 6

The height of the shorts at exactly t = 10 minutes ≈ 6 meters.

Get more information on  sinusoidal functions here;

https://brainly.com/question/16820464

Doubling x and adding 3 is the same as tripling x and adding 1

Answers

If x was tripled, then it would indeed be 3x. The answer wouldn't be x^3 because x isn't being multiplied by itself three times in a row. Whenever value is tripled, it's multiplied by three, but not the power of 3.

Answer:

2x + 3 = 3x + 1

x = 2

hope that helps ✌

Full working out for this question please.

Answers

Answer:

B. 3.2

Step-by-step explanation:

5 companies have 0 computers.

10 companies have 1 computer.

10 companies have 2 computers.

30 companies have 3 computers.

25 companies have 4 computers.

20 companies have 5 computers.

To find mean:

0 x 5 = 0

10 x 1 = 10

10 x 2 = 20

30 x 3 = 90

25 x 4 = 100

20 x 5 = 100

100 + 100 + 90 + 20 + 10 + 0 = 320

20 + 25 + 30 + 10 + 10 + 5 = 100

100 companies were surveyed.

100 companies use 320 computers in total.

320 / 100 = 3.2

Concrete is made by mixing screenings cement and sand in the ratio 3:1:15. How much sand would be needed
to make 125 tonnes of concrete?

Answers

Answer:

98.7 tonnes of sand.

Step-by-step explanation:

First find the total :

3 + 1 + 15 = 19

if 19 = 125 tonnes,

what about 15 = ?

(cross multiply)

[tex] \frac{15}{19} \times 125[/tex]

= 1875 ÷ 19

= 98.68

(rounded off to 1 decimal place)

= 98.7 tonnes of sand.

13 + {16 + 2 -[25 + 45) x 3] + 9}

Answers

Answer: -170

Concept:

When encountering questions that require multiple steps of the calculation, it is suggested to follow the PEMDAS.

ParenthesisExponentsMultiplicationDivisionAdditionSubtraction

Solve:

**Disclaimer** I assume that it is supposed to be (25 + 45). If it was, then you may refer to my answer. If the ")" after 45 is just a typo, you may point it out and I will redo it.

Given expression

 13 + {16 + 2 - [(25 + 45) × 3] + 9}

Do the parenthesis of the inner most

=13 + {16 + 2 - [70 × 3] + 9}

=13 + {16 + 2 - 210 + 9}

Do addition first, then subtraction

=13 + {18 - 210 + 9}

=13 + {27 - 210}

=13 - 183

=-170

Hope this helps!! :)

Please let me know if you have any questions

Other Questions
Which of the following describes a positive correlation?As the number of hours spent on homework increases, the tests scores increase.As the number of apples eaten per year increases, the number of times visiting the doctor every year remains the same.As the number of times going to bed early increases, the number of times waking up late decreases.The amount of time a team spent practicing increases, the number of games lost in a season decreases.THIS IS A MULTIPLE CHOICE QUESTION Any point on the budget constraint Multiple Choice Gives the consumer the highest level of utility. Represent a combination of two goods that are affordable. Represents combinations of two goods that yield the same utility. Reflects the price of one good divided by the price of another good. Trousers are sold at $40. During a clearance sale, the trousers are sold for $30. What is the markdown rate?A.20%B.25%C.30%D.33% hey I'm trying to reachout for someone and that person knows who it is and if you see this message please, comment below and my question is Misdemeanors do not include any violent crimes or crimes with the potential to harm others.Is the previous statement true or false? Identify the mood of the verb in this sentence.All of the spectators crowded through the exits before the show ended.O indicativeO imperativeO subjunctiveO conditional FORMULAS OF IONIC COMPOUNDSFIND: POSITIVE ION, NEGATIVE ION AND FORMULA IN:NAME:Sodium chlorideMagnesium chlorideCalcium oxideLithium phosphideAluminum sulfideCalcium nitrideIron(III)chlorideIron(II)oxideCopper(I)sulfideCopper(II)nitrideZinc oxideSilver sulfidePotassium carbonateSodium nitrateCalcium bicarbonateAluminum hydroxideLithium phosphatePotassium sulfate A man was negligently driving down the road, not paying attention to where he was going. Because of this, he hit and seriously injured a pedestrian who was lawfully crossing the street. The accident was witnessed by the pedestrian's friend who was standing on the sidewalk. As a result of seeing the pedestrian injured, her friend suffered extreme emotional distress that physically affected her nervous system. The friend brings suit against the driver for negligent infliction of emotional distress in a jurisdiction that has adopted the majority approach in bystander cases. Will the friend prevail Two more than three times a number is 18. 2/4+1=1/6 x-7 what is the value of x in this epuation sin(180+0).cos(180+0)/cos(180+0).sin(180-0) Name the property shown by the statement a + (b + 2) = (a + b) + 2 what is the volume of the cylinder In India, secularism has now been pronounced by the Supreme Court of India to be a part of the basic structure of the Constitution and cannot be done away with even by a constitutional amendment.[9] Articles 25 to 28 guarantee individuals as well as groups the right to freedom of religion. However, Article 25 restricts the exercise of this right in the interests of public order, morality and health and all other rights enumerated in Part III of the Constitution. Therefore, it is constitutional for the legislature to place social welfare and reform over and above religious interests. In fact, Article 17 of the Constitution is a rare example of a penal constitutional provision which criminalizes untouchability ; a practice that can essentially be traced to Hinduism. Article 25, itself specifies that the freedom of religion cannot be used to restrict access to Hindu places of worship to upper castes. This relatively lower position that has been accorded to the freedom of religion in the Constitution is starkly different from the manner in which this has been played out in courts and political arenas in India. Many recent constitutional controversies in India have focused on religious rights. 1. How many articles in the Constitution guarantee 'Right to freedom of religion? a. 7 b. 6 c. 12 d. 9 2. Which article restricts the Right to freedom of religion under the rights enumerated in Part III of the Constitution? a. 29 b. 17 c. 25 d. 27 3. Which article criminalizes untouchability? a. 25 b. 17 c. 28 d. 29 4. What do the constitutional controversies recently focus on? a. Religious rights b. Religious tolerance c. Religious interests d. Religious practice 5. What is secularism? a. State supports religion b. State is separate from religion c. State Policy framework d. State supports public A tank is capable of holding 36,18 and 72 litres of milk . Determine which is the greatest vessel which can be uses to fill each one of them on exact number of times All of these are reasons for underreporting of child sexual abuse, EXCEPT: Group of answer choices children may fear retaliation of the abuser. children's allegations of sexual abuse are not taken seriously. very young children may not be able to talk and explain what happened. young children may not interpret what's happening as sexual abuse. A car salesman claims that the variance of prices on convertibles is higher than the variance on station wagons. To test this claim, he selects random samples of each type of car, and records the prices. The standard deviation of 16 convertibles is $6800 and the standard deviation of 24 station wagons is $3900. For , what is the p-value? Group of answer choices joule is a unit of_____and_____ analyse Mrs malard in The story of an Hour Hi! I'd appreciate it if you could help me on this question. The question I need help with is question 42. Thank you If you could help me!! Which of the following would best enhance a readers understanding of this poem