3x - 2y = 16 and x - 2y = 4 (any method <3)​

Answers

Answer 1

Answer:   (x, y) = (6, 1)

This means x = 6 and y = 1

==========================================================

Explanation:

I'll use the substitution method to solve this system.

Let's solve the second equation for x

x-2y = 4

x = 4+2y

Then plug that into the first equation so we can solve for y.

3x - 2y = 16

3(4+2y) - 2y = 16 ... x replaced with 4+2y

12+6y - 2y = 16

12 + 4y = 16

4y = 16-12

4y = 4

y = 4/4

y = 1

Lastly, use this y value to find x

x = 4 + 2y

x = 4 + 2(1)

x = 6

The solution as an ordered pair is (x, y) = (6, 1)

---------------------------------

Checking the answer:

Plug those x,y coordinates into the first equation

3x - 2y = 16

3(6) - 2(1) = 16

18 - 2 = 16

16 = 16

That confirms the first equation. Repeat for the second equation

x - 2y = 4

6 - 2(1) = 4

6 - 2 = 4

4 = 4

Both equations are confirmed.


Related Questions

Determine the perimeter of triangleABC with A(2;3) B(3;-2) and C (-2;-3).​

Answers

Answer:

Plot the coordinates on a graph and join them to form a triangle. After doing that, you can count the length of each triangular side and find the sum of the 3 sides. That will be your answer.

Shaded areas ( What is the area of the shaded region? )

Answers

Answer:

119.43 cm²

Step-by-step explanation:

The shaded area (A) is calculated as

A = area of rectangle - area of circle

   = (11 × 12) - π × 2²

  = 132 - 4π

  ≈ 119.43 cm² ( to the nearest hundredth )

Todd is putting new oak baseboard trim in his living room. He has one piece that is 12 1/2 ft long and another that is 8 2/3 ft long. How much trim does he have total?​

Answers

Answer:

21 1/6 ft

Step-by-step explanation:

Add the lengths together

12 1/2 + 8 2/3

Get a common denominator of 6

12 1/2 *3/3  + 8 2/3 *2/2

12 3/6 + 8 4/6

20 7/6

20 +6/6+1/6

21 1/6

This two-way frequency table shows the results of a survey of users of the mass-transit system in a city. People were asked their age and whether they used the system regularly (three or more times per week).

Answers

Answer:

if Q={1,3,5,7,9}Express it in description methods

Answer: With the condition that age is 30 or under, the sample space is restricted to the first column. This simplifies the problem to:

P(uses mass transit |age is 30 or under) = 125/575=0.217

Step-by-step explanation:

edmentum

PLS HELP ME ON THIS QUESTION I WILL MARK YOU AS BRAINLIEST IF YOU KNOW THE ANSWER PLS GIVE ME A STEP BY STEP EXPLANATION!!
Data should be analyzed using each of the following except:
A. measures of central tendency
B. shape
C. population size
D. spread

Answers

The answer would seem to be c
The answer to your question is c

TRIGONOMETRY
Could someone please help me with 5.2 please...it would really help alot:)​

Answers

sin(x+y) - sin(x-y) - 1 = cos(2x)

sin(90) - sin(x-y) - 1 = cos(2x)

1 - sin(x-(90-x)) - 1 = cos(2x)

-sin(2x-90) = cos(2x)

-1*(sin(2x)cos(90) - cos(2x)sin(90)) = cos(2x)

-1*(sin(2x)*0 - cos(2x)*1) = cos(2x)

-1*(0 - cos(2x)) = cos(2x)

-1*(-cos(2x)) = cos(2x)

cos(2x) = cos(2x)

This confirms the identity is true.

Notice that throughout this proof, I only changed the left hand side.

On the 5th line, I used the identity sin(A-B) = sin(A)cos(B)-cos(A)sin(B).

PLS HELP ME ON THIS QUESTION I WILL MARK YOU AS BRAINLIEST IF YOU KNOW THE ANSWER!! Determine the Value of K in the diagram ( secant lines to circles).

Answers

Answer:

k = 10

Step-by-step explanation:

According to intersecting secants theorem we have the following equation:

3x*(3x + 5x) = 2x*(2x + kx)

Solve it for k:

3x*8x = 4x² + 2kx²24x² = (4 + 2k)x²24 = 4 + 2k20 = 2kk = 10

Please help explanation if possible

Answers

Answer:

Jordans' age = 31 ; Anna's age = 19

Step-by-step explanation:

Given the 2 equations relating their ages

J + A = 50 → (1)

J = 12 + A → (2)

Substitute J = 12 + A into (1)

12 + A + A = 50

12 + 2A = 50 ( subtract 12 from both sides )

2A = 38 ( divide both sides by 2 )

A = 19

Substitute A = 19 into (2)

J = 12 + 19 = 31

Then Jordans' age = 31 ; Anna's age = 19

Answer:

Step-by-step explanation:

J = 12 + A equation 1

J + A = 50 equation 2

Solving equation 2

J + A = 50

A = 50 - J equation 3

Putting value of A in equation 1

J = 12 + A

J = 12 + 50 - J

Bringing like terms on one side

J + J = 12 + 50

2J = 62

J = 62/2 = 31

Putting value of J in equation 3

A = 50 - J

A = 50 - 31 = 19

Checking answer by putting values in equation 2

J + A = 50

31 + 19 = 50

50 = 50

So the age of Jordan is 31 and Anna is 19

What is the equation of this line?

Answers

Answer:

this is your test right pls study and answer

Erica recently invested in gold that is growing in value 4% annually. She invested $4000 initially. Find the value of her investment after 6 years.

Answers

Answer:

4%  = 0.04

4000 = 0.04

6 years = 0.04

Step-by-step explanation:

Hope this helps!

.....................​

Answers

Answer:

2nd option is the correct one

log|x|-f(x)+k

Given the table below, determine which type of equation best models the data and use a calculator to find an equation of best fit.

Answers

Answer:

Hello,

Step-by-step explanation:

Best fit: quadratic y=5.3x²-9.3+6.1

with an total error  of 0.4

Factorize no i, l, o​

Answers

Answer:

here ,

question no. L the question is incomplete.

rest all are solved hope this helped u ☺️

2. Write an equation that can be used to find M-Angle M. Then Solve it. Round to the nearest degree​

Answers

Answer:

M = sin ^-1 (5/11)

M = 27 degrees

Step-by-step explanation:

Since this is a right triangle, we can use trig functions

sin theta = opp / hyp

sin M = 5/11

Taking the inverse sin of each side

sin ^-1 sin M = sin ^-1 (5/11)

M = sin ^-1 (5/11)

M=27.03569

To the nearest degree

M = 27

Yet another calculus question :)


Given [tex]y = x^3 - 2x[/tex] for [tex]x \geq 0[/tex], find the equation of the tangent line to y where the absolute value of the slope is minimized.

I have tried taking both the first and second derivatives and setting them equal to 0 and using that as the answer, but they're incorrect. Could somebody please explain how to complete the question correctly? Thank you so much!

Answers

Answer:  y = (-4/3)*sqrt(2/3)

This is the same as writing [tex]y = -\frac{4}{3}\sqrt{\frac{2}{3}}[/tex]

============================================================

Explanation:

The phrasing "where the absolute value of the slope is minimized" is an interesting way of saying "the tangent slope is 0". This is because absolute values are never negative, so the smallest it can get is 0.

Your teacher has given you

y = x^3 - 2x

which differentiates into

dy/dx = 3x^2 - 2

after using the power rule

The derivative function lets us determine the slope of the tangent. The slope is the dy/dx value. Since we want a slope of 0, we'll set 3x^2-2 equal to zero and solve for x. So you have the correct idea, but you won't involve the second derivative.

dy/dx = 0

3x^2 - 2 = 0

3x^2 = 2

x^2 = 2/3

x = sqrt(2/3)

Notice how I'm ignoring the negative version of this root. This is due to the fact that [tex]x \ge 0[/tex]

-------------------------

Now plug this x value back into the original equation to find its corresponding y coordinate.

y = x^3 - 2x

y = x(x^2 - 2)

y = sqrt(2/3)*( 2/3 - 2 )

y = sqrt(2/3)*( -4/3 )

y = (-4/3)*sqrt(2/3)

Note that x = sqrt(2/3) leads to x^2 = 2/3 after squaring both sides.

-------------------------

Therefore, the equation of this tangent line is y = (-4/3)*sqrt(2/3)

All horizontal lines are of the form y = k, for some constant k. This constant value is basically what number you want the horizontal line to go through on the y axis. That number would be (-4/3)*sqrt(2/3).

find the value of x and y​

Answers

Answer x = 25°

In triangle ABC

Angle BAC = BCA

= 50

Because its isoceles triangle and base angles are equal.

x + x + 80 = 180

2x = 100

x = 50

Angle ACD is exterior angle so 80 + 50

= 130

Triangle ACD is also Isoceles Angle x = Angle CDA

130 + x + x = 180

2x = 50

x = 25

please help me solve this exercise.!!
find the value of tanx if sinx+cosx=1/5 and 0<x<π.

Answers

Answer:  -4/3

=============================================================

Explanation:

Let's square both sides and do a bit of algebra to get the following.

[tex]\sin(x) + \cos(x) = 1/5\\\\\left(\sin(x) + \cos(x)\right)^2 = \left(1/5\right)^2\\\\\sin^2(x) + 2\sin(x)\cos(x) + \cos^2(x) = 1/25\\\\\sin^2(x) + \cos^2(x) + 2\sin(x)\cos(x) = 1/25\\\\1 + 2\sin(x)\cos(x) = 1/25\\\\\sin(2x) = 1/25 - 1\\\\\sin(2x) = 1/25 - 25/25\\\\\sin(2x) = -24/25\\\\[/tex]

Now apply the pythagorean trig identity to determine cos(2x) based on this. You should find that cos(2x) = -7/25

This then means tan(2x) = sin(2x)/cos(2x) = 24/7.

From here, you'll use this trig identity

[tex]\tan(2x) = \frac{2\tan(x)}{1-\tan^2(x)}\\\\[/tex]

which is the same as solving

[tex]\tan(2x) = \frac{2w}{1-w^2}\\\\[/tex]

where w = tan(x)

Plug in tan(2x) = 24/7 and solve for w to get w = -4/3 or w = 3/4

So either tan(x) = -4/3 or tan(x) = 3/4.

If we were to numerically solve the original equation for x, then we'd get roughly x = 2.21; then notice how tan(2.21) = -1.345 approximately when your calculator is in radian mode.

Since tan(x) < 0 in this case, we go for tan(x) = -4/3

the area of a parallelogram is 48cm².if the two adjacent sides are 8cm and 6cm, find the length of its diagonal .​

Answers

Answer:

10cm

Step-by-step explanation:

Assuming the shape is a rectangle since it's already stated that it's a parallelogram, and the area is stated, we can use the Pythagorean theorem to find the length

[tex]a^{2} +b^2=c^2[/tex], where c will be the length

isolate c

[tex]c^2=a^2+b^2[/tex]

[tex]c=\sqrt{a^2+b^2}[/tex]

substitute for a and b

[tex]c=\sqrt{8^2+6^2}[/tex]

[tex]c=\sqrt{64+36}[/tex]

[tex]c=\sqrt{100}[/tex]

[tex]c=10[/tex]



If sinө= 7/25 , find the values of cosө and tanө

Answers

Step-by-step explanation:

sinx = p/h = 7/25

so

p = 7

h = 25

now

h^2 = p^2 + b^2

25^2 = 7^2 + b^2

or, 625 = 49 + b^2

or, 625-49 = b^2

or, 576 = b^2

or,  b = [tex]\sqrt{576}[/tex]

so, b = 24

so

cosx = b/h = 24/25

tanx = p/b = 7/24

Match the vocabulary word to its correct definition.

1. mean
The mean is the average value of the data you collect. In statistics, you find the mean of your sample. Then you use that mean to approximate the mean of the entire population. If you want the mean of the data to be a good approximation of the mean of the entire population, your need to make sure that you collect a random sample. To find the mean, you find the sum of the data points you collected and divide it by the number of data points in the set. For example, if the data you collected was {3, 3, 6}. Then the mean would be (3 + 3 + 6) ÷ 3 = 12 ÷ 3 = 4. It's important to note that the mean does not have to be a data point in your set. You can generalize the formula as well. If you collect n data points {d1, d2, d3, … dn}, then the mean of your data set is . The Greek letter μ—pronounced "mu"—is used because the word "mean" begins with the letter "m." It is important that you divide by the number of data points in your set, n.
2. population
An experiment is a well-defined procedure under controlled conditions designed to gather data that tests a hypothesis. For example, you want to test the hypothesis that flowers grow faster when they are watered every other day as opposed to every day. Then you could water one set of plants every day and another set of plants every other day. What data would you collect? The height of each plant once a day. What conditions would you need to control? You would need to make sure that the groups of plants are treated the same in every other way by getting the same amount of sun and being maintained at the same temperature, etc.
3. experiment
Bias is the preference for a particular group or subset. In the example above, the bias was toward viewers who like sports. When your sample is not chosen at random, you introduce bias into your study. So, in a certain sense, a biased sample is the opposite of a random sample. Why? In a biased sample, some members of the population are more likely to be chosen than others. In a random sample, every member of the population is equally likely to be chosen. Bias may also occur in surveys. See "survey" below for more information on this type of bias.
4. sample
A population is the entire group you want to understand. So, in a certain sense, you can think of the population as the "opposite" of the sample because a sample is not the entire population. A sample is chosen subset upon that you use to draw conclusions about the entire population.
5. bias
Random means free from bias. So, if you choose a random sample from a population, every member of the population has an equal chance of being chosen. It should be pointed out that this "true randomness" is an ideal which is difficult to achieve in real world experiments conducted on real world populations. That is why statisticians make every effort to ensure their samples chosen as free from bias as is possible, that is, as randomly as possible under real world conditions.
6. survey
A sample is a subset chosen from a population. In most cases, you want a random sample. Why? A random sample has the best chance of accurately representing the entire population.
7. random
A survey is the means of collecting a sample. In statistics, a survey is often a question or set of questions. It is critical that the questions, like the sample itself, be free from bias. Bias in a question tends to favor one response. As an extreme example of a biased question about colors might be, "Don't you think blue is beautiful and yellow is yucky?" An unbiased form of the question might be, "Which color do you prefer, blue or yellow?" Though careful, statisticians might be concerned about the order in which the colors are offered, so that might further simplify the question to, "What is your favorite color?" This type of question is most free from bias because it does not suggest a response and therefore does not favor a response.

Answers

Answer:

1. mean-The mean is the average value of the data you collect. In statistics, you find the mean of your sample. Then you use that mean to approximate the mean of the entire population. If you want the mean of the data to be a good approximation of the mean of the entire population, your need to make sure that you collect a random sample. To find the mean, you find the sum of the data points you collected and divide it by the number of data points in the set. For example, if the data you collected was {3, 3, 6}. Then the mean would be (3 + 3 + 6) ÷ 3 = 12 ÷ 3 = 4. It's important to note that the mean does not have to be a data point in your set. You can generalize the formula as well. If you collect n data points {d1, d2, d3, … dn}, then the mean of your data set is . The Greek letter μ—pronounced "mu"—is used because the word "mean" begins with the letter "m." It is important that you divide by the number of data points in your set, n.

2. Population-A population is the entire group you want to understand. So, in a certain sense, you can think of the population as the "opposite" of the sample because a sample is not the entire population. A sample is chosen subset upon that you use to draw conclusions about the entire population.

3. Experiment-An experiment is a well-defined procedure under controlled conditions designed to gather data that tests a hypothesis. For example, you want to test the hypothesis that flowers grow faster when they are watered every other day as opposed to every day. Then you could water one set of plants every day and another set of plants every other day. What data would you collect? The height of each plant once a day. What conditions would you need to control? You would need to make sure that the groups of plants are treated the same in every other way by getting the same amount of sun and being maintained at the same temperature, etc.

4. Sample-A sample is a subset chosen from a population. In most cases, you want a random sample. Why? A random sample has the best chance of accurately representing the entire population.

5. Bais-Bias is the preference for a particular group or subset. In the example above, the bias was toward viewers who like sports. When your sample is not chosen at random, you introduce bias into your study. So, in a certain sense, a biased sample is the opposite of a random sample. Why? In a biased sample, some members of the population are more likely to be chosen than others. In a random sample, every member of the population is equally likely to be chosen. Bias may also occur in surveys. See "survey" below for more information on this type of bias.

6. Survey-A survey is the means of collecting a sample. In statistics, a survey is often a question or set of questions. It is critical that the questions, like the sample itself, be free from bias. Bias in a question tends to favor one response. As an extreme example of a biased question about colors might be, "Don't you think blue is beautiful and yellow is yucky?" An unbiased form of the question might be, "Which color do you prefer, blue or yellow?" Though careful, statisticians might be concerned about the order in which the colors are offered, so that might further simplify the question to, "What is your favorite color?" This type of question is most free from bias because it does not suggest a response and therefore does not favor a response.

7. Random-Random means free from bias. So, if you choose a random sample from a population, every member of the population has an equal chance of being chosen. It should be pointed out that this "true randomness" is an ideal which is difficult to achieve in real world experiments conducted on real world populations. That is why statisticians make every effort to ensure their samples chosen as free from bias as is possible, that is, as randomly as possible under real world conditions.

Step-by-step explanation:

It says what each of them are in each paragraph, you just need to match them up.

Hope this helps :)

simplify the expression (3+4i) - (1-5i)

Answers

Answer:

9i + 2

Step-by-step explanation:

3 + 4i - 1 + 5i

=> 3 - 1 + 4i + 5i

=> 2 + 9i

=> 9i + 2

Answer:

9i + 2

Brainliest, please!

Step-by-step explanation:

(3 + 4i) - (1 - 5i)

3 + 4i - 1 + 5i

9i + 2

I NEED THE ANSWER FOR JUST NUMBER 5 PLEASE

Answers

Answer:

126

Step-by-step explanation:

∠S : ∠T = 7:3

∠S = 7x  

∠T = 3x

∠S + ∠T = 180               {Supplementary angles}

7x + 3x = 180

10x = 180

Divide both sides by 10

x = 180/10

x = 18

∠S = 7x = 7*18 = 126°

The perimeter of a rectangle is 64 feet. If one side of the rectangle has a length of 20 feet. How long is the other side?


Please answer thanks

Answers

Answer:

b=12

Step-by-step explanation:

Perimeter=2*(l+b)

64=2*(20+b)

b=12

Answer:

The width is 12 feet

Step-by-step explanation:

If the length is 20 feet, the other side must be 20 feet as well. The perimeter is the addition of all sides of a rectangle. Length: 20 on one side, 20 on other side. Subtract the length from total perimeter and you get 24 feet remaining. Divide 24 by 2. 12 feet for the width.

What is the sum of -6 and 9?

Answers

Sum means add.

Start at -6 and add 9

-6 + 9 = 3

Answer: 3

[tex]\huge\text{Hey there!}[/tex]

[tex]\huge\text{What is the sum of -6 \& 9?}[/tex]

[tex]\huge\textsf{The word \underline{sum} means to \bf add/addition }[/tex]

[tex]\huge\text{The EQUATION: -6 + 9 = [blank]}[/tex]

[tex]\huge\bullet\huge\textsf{To find out your result you have to start}\\\huge\textsf{at -6 \& go UP 9 spaces to the right}\\\huge\textsf{since you are ADDING \& NOT}\\\huge\textsf{SUBTRACTING.}\\\\\huge\bullet\huge\textsf{If you are subtracting you would do the}\\\huge\textsf{opposite \& go down to the left}[/tex]

[tex]\huge\boxed{\star}\huge\text{ Without further ado, we have reached}\\\huge\text{our result to your question is \boxed{\bf 3}}[/tex]

[tex]\boxed{\boxed{\huge\text{Answer: \bf 3}}}\huge\checkmark[/tex]

[tex]\huge\textsf{Good luck on your assignment \& enjoy your day!}[/tex]

~[tex]\huge\boxed{\frak{Amphitrite1040:)}}[/tex]

A line passes through the point (-3,6) and is parallel to the line with the equation y=
- 4x + 5. What's the equation of the line?

Answers

Answer:

y=-4x-6

Step-by-step explanation:

y=-4x+5  m1=-4

m1=m2=-4 (the number near x is equal for the line and the searched line)

y=m2x+b

6=-4(-3)+b

b=-6

y=-4x-6

Please help me Simplify: 6! − 3!

Answers

Answer: Option B 3!((6×5×4)-1)

Step-by-step explanation:

6! - 3!

= (1×2×3×4×5×6) - (1×2×3)

= 720 - 6

= 714

As you told you forgot to put options lemme answer it.

It will be option B

3!((6×5×4)-1)

It will be 6((6×5×4)-1)

= 6(120) -6

= 720 - 6

= 714

please click thanks and mark brainliest if you like :)

[tex]\\ \sf\longmapsto 6!-3![/tex]

[tex]\\ \sf\longmapsto (6\times 5\times 4\times 3\times 2\times 1)-(3\times 2\times 1)[/tex]

[tex]\\ \sf\longmapsto (720)-6[/tex]

[tex]\\ \sf\longmapsto 714[/tex]

Note:-

[tex]\boxed{\sf n!=n\times (n-1)(n-2)\dots}[/tex]

or

[tex]\\ \sf\longmapsto n!=n\times( n-1)![/tex]

A shopkeeper marks the price of an article 25% above the cost price. Then he allows a discount of 10% of the marked price. Find the profit percentage.​

Answers

here is your answer hope you will understand it

If I Have 100 Dollars And i go to the bank and i ask for 30 more and use that money on a store and i have 12 Dollars Left How Much Did the Thing I Bought Cost/ How Much Money did i spend?

Answers

Answer:

$118

Step-by-step explanation:

First, find how much money you had after going to the bank:

100 + 30

= $130

Find how much money you spent at the store by subtracting 12 from 130:

130 - 12

= 118

So, you spent $118

define a ploynomial with real coeffients​

Answers

Answer:

an expression of more than two algebraic terms, especially the sum of several terms that contain different powers of the same variable is called polynomial. A polynomial with real coefficients is a product of irreducible polynomials of first and second degrees.

FOR BRAINLIEST ANSWER THIS:


The area of a triangle is 12 square meters . The base is 2 meters longer than the height Find the height of the triangle .

Answers

Answer:

The height of the triangle is four meters.

Step-by-step explanation:

We are given that the area of a triangle is 12 square meters. The base is two meters longer than the height, and we want to determine the height of the triangle.

Recall that the area of a triangle is given by:

[tex]\displaystyle A = \frac{1}{2}bh[/tex]

Since the area is 12 square meters:

[tex]\displaystyle 12 = \frac{1}{2}bh[/tex]

The base is two meters longer than the height. In other words, we can write that:

[tex]b = h + 2[/tex]

Substitute:

[tex]\displaystyle 12=\frac{1}{2}(h+2)h[/tex]

Solve for h. Multiply both sides by two:

[tex]24 = (h+2)h[/tex]

Distribute:

[tex]h^2+2h=24[/tex]

Isolate:

[tex]h^2+2h-24=0[/tex]

Factor:

[tex](h+6)(h-4)=0[/tex]

Zero Product Property:

[tex]h + 6 = 0\text{ or } h -4 =0[/tex]

Solve for each case:

[tex]h = -6\text{ or } h = 4[/tex]

Since the height cannot be negative, we can ignore the first solution.

Thus, the height of the triangle is four meters.

Other Questions
Adding a participant variable to a design with an existing independent variable is one way to increase external validity. True or False 8. Find the number of real number solutions for the equation. x2 + 5x + 7 = 0A. 2B. cannot be determinedC. 0D. 1 ii)The outer electronic configuration of an element is 3d8 4s2.To which group and period it belongs? What causes asthenopia? If the density of the wood is 3 pounds per cubic foot and if the weight of the solid is360 pounds, what is the width, w, in feet, of the solid?(A) 5.0(B) 2.5(C) 2.4(D) 1.5The area of the triangular face of the solid is 48 if that helps Steve and Herb are choosing seats at the baseball stadium.The seats are numbers like a coordinate grid. Stevechooses the seat at (1, 2). If Herb does not want to sit in thesame vertical or horizontal row as Steve's seat, which seatshould he choose?OA) (0,2)B) (0,1)C) (1,0)OD) (-1,2) 256x+ - xy + 49y+ 4) When the sun warms water, which resulting process occurs? *A precipitationB runoffC evaporationD condensation5) Students observed a piece of iron change from shiny to rusty. What caused this change? *A a chemical reactionB a heat reactionC a cold reactionD a physical reaction6) Which is the best example of the transfer of heat by radiation? *A water boilingB ice meltingC a hot air balloon risingD a lightbulb glowing7) Jason fills a glass container completely with water and screws the lid on tightly. He places the container in a freezer. Which will most likely result? *A The container will prevent the water from freezing.B The water will freeze and take up less space in the container.C The water in the container will expand when it freezes and cause the container to crack.D The container will absorb heat from the water, causing it to crack.8) Which is most responsible for the changes in seasons? *A the jet streamB the ocean currentsC the distance from Earth to the sunD the tilt of Earth on its axis9) Which type of animal usually eats both producers and consumers? *A an omnivoreB a carnivoreC a herbivoreD a predator10) In North Carolina, the wind is blowing from the north. If the wind changes direction and begins to blow from the south, what will most likely result? *A The temperatures will increase.B The temperatures will decrease.C The air pressure will increase.D The wind speeds will decrease.11) Which best explains why a storm that affects an area in the western United States may affect an area in the eastern United States a few days later? *A The jet stream winds blow storms from east to west.B The jet stream winds blow storms from west to east.C Cool Gulf Stream water causes storms to form in the east.D Warm Gulf Stream water causes storms to form in the west.12) Which is a characteristic of most single-celled organisms? *A They have a complex nervous system.B They contain several different types of cells.C They perform all life processes.D They have a circulatory and a respiratory system. The sum of the first n terms of an arithmetic series is 2n(n+3).Find the first term of the series using the formula n/2(2a+(n-1)d) I need help plz step by step explanation A hunter walks 400m Up a hill which slopes at an angle of 20 to the horizontal. Calculate,correct to the nearest metre, the: a. horizontal distance he covered b.vertical height through which he rises. PLS HELP! WILL MARK BRAINLIEST!!! 50 PTS RATIO of longest wavelengths corresponding to Lyman and Balmer series in hydrogen spectrum is:1) 7/292) 9/313) 5/274) 5/23 You are planning to attend college next year. The total cost of tuition and textbooks is $10,000. If you go to school, your room and board will cost you $5,000. If you did not go to school, however, you would live at home, and your total room and board would only be $1,000. Additionally, if you did not go to college, you would work a job making $20,000 for the year.1. In terms of room and board alone, what would be opportunity cost of attending college. Be sure to explain your answer 2. What are the explicit costs of attending school? How much should be included for room and board?3. What would be the implicit cost of attending college next year?4. What would be the total opportunity cost of attending college next year? What is the value of X? how many feet is 2 1/2 miles How is casting useful for a sculptor? AndWhat materials are usually involved in the process? state function and non state function Help help help help help help help help help help help help help Thnh tu v hn ch ca ci cch th ch nhm nng cao nng lc cnh tranh v mi trng kinh doanh ti vit nam giai on 2015-2020